1.0 2010-04-08 22:04:29 UTC 2019-11-26 02:54:35 UTC FDB000243 Caffeic acid ethyl ester Caffeic acid ethyl ester, also known as (E)-ethyl 3,4-dihydroxycinnamate or (E)-ethyl caffeate, belongs to coumaric acids and derivatives class of compounds. Those are aromatic compounds containing Aromatic compounds containing a cinnamic acid moiety (or a derivative thereof) hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. Caffeic acid ethyl ester is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Caffeic acid ethyl ester can be found in eggplant and vinegar, which makes caffeic acid ethyl ester a potential biomarker for the consumption of these food products. Ethyl caffeate is an ester of an hydroxycinnamic acid, a naturally occurring organic compound . (E)-3-(3,4-Dihydroxy-phenyl)-acrylic acid ethyl ester 2-Propenoic acid, 3-(3,4-dihydroxyphenyl)-, ethyl ester 3-(3,4-Dihydroxy-phenyl)-acrylic acid ethyl ester 3,4-Dihydroxycinnamic acid, ethyl ester Caffeic acid phenethyl ester Ethyl 3,4-dihydroxycinnamate Ethyl caffeate Phenethyl caffeate C11H12O4 208.2106 208.073558872 ethyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate ethyl cinnamate,3,4-dihydroxy 102-37-4 CCOC(=O)\C=C\C1=CC(O)=C(O)C=C1 InChI=1S/C11H12O4/c1-2-15-11(14)6-4-8-3-5-9(12)10(13)7-8/h3-7,12-13H,2H2,1H3/b6-4+ WDKYDMULARNCIS-GQCTYLIASA-N belongs to the class of organic compounds known as coumaric acids and derivatives. These are aromatic compounds containing Aromatic compounds containing a cinnamic acid moiety (or a derivative thereof) hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. Coumaric acids and derivatives Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids Carbonyl compounds Catechols Cinnamic acid esters Enoate esters Fatty acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Styrenes 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid Alpha,beta-unsaturated carboxylic ester Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid derivative Carboxylic acid ester Catechol Cinnamic acid ester Coumaric acid or derivatives Enoate ester Fatty acid ester Fatty acyl Hydrocarbon derivative Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Styrene hydroxycinnamic acid logp 2.60 ALOGPS logs -2.41 ALOGPS solubility 8.10e-01 g/l ALOGPS logp 2.26 ChemAxon pka_strongest_acidic 9.21 ChemAxon pka_strongest_basic -6.3 ChemAxon iupac ethyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate ChemAxon average_mass 208.2106 ChemAxon mono_mass 208.073558872 ChemAxon smiles CCOC(=O)\C=C\C1=CC(O)=C(O)C=C1 ChemAxon formula C11H12O4 ChemAxon inchi InChI=1S/C11H12O4/c1-2-15-11(14)6-4-8-3-5-9(12)10(13)7-8/h3-7,12-13H,2H2,1H3/b6-4+ ChemAxon inchikey WDKYDMULARNCIS-GQCTYLIASA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 56.54 ChemAxon polarizability 21.58 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 5735 Specdb::MsMs 94455 Specdb::MsMs 94456 Specdb::MsMs 94457 Specdb::MsMs 158487 Specdb::MsMs 158488 Specdb::MsMs 158489 Specdb::MsMs 3596887 Specdb::MsMs 3596888 Specdb::MsMs 3596889 Specdb::MsMs 3596890 Specdb::MsMs 3596891 Specdb::MsMs 3596892 Eggplant Type 1 specific Solanum melongena 4111 Vinegar Type 2 specific 0.026543 0.026543478 0.026543478 mg/100 g