1.0 2010-04-08 22:04:36 UTC 2025-11-18 22:19:13 UTC FDB000521 Homoserine Homoserine, also known as L-isomer of homoserine or 2-amino-4-hydroxybutanoic acid, is a member of the class of compounds known as alpha amino acids. Alpha amino acids are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Homoserine is soluble (in water) and a moderately acidic compound (based on its pKa). Homoserine can be found in common pea and ginkgo nuts, which makes homoserine a potential biomarker for the consumption of these food products. Homoserine (also called isothreonine) is an α-amino acid with the chemical formula HO2CCH(NH2)CH2CH2OH. L-Homoserine is not one of the common amino acids encoded by DNA. It differs from the proteinogenic amino acid serine by insertion of an additional -CH2- unit into the backbone. Homoserine, or its lactone form, is the product of a cyanogen bromide cleavage of a peptide by degradation of methionine . Homoserine, 9CI C4H9NO3 119.1192 119.058243159 2-amino-4-hydroxybutanoic acid homoserine 498-19-1 NC(CCO)C(O)=O InChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8) UKAUYVFTDYCKQA-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds 1,3-aminoalcohols Amino acids Carbonyl compounds Carboxylic acids Fatty acids and conjugates Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Primary alcohols Short-chain hydroxy acids and derivatives 1,3-aminoalcohol Alcohol Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Carbonyl group Carboxylic acid Fatty acid Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary alcohol Primary aliphatic amine Primary amine Short-chain hydroxy acid non-proteinogenic L-alpha-amino acid logp -3.31 ALOGPS logs 0.55 ALOGPS solubility 4.23e+02 g/l ALOGPS logp -3.8 ChemAxon pka_strongest_acidic 2.22 ChemAxon pka_strongest_basic 9.16 ChemAxon iupac 2-amino-4-hydroxybutanoic acid ChemAxon average_mass 119.1192 ChemAxon mono_mass 119.058243159 ChemAxon smiles NC(CCO)C(O)=O ChemAxon formula C4H9NO3 ChemAxon inchi InChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8) ChemAxon inchikey UKAUYVFTDYCKQA-UHFFFAOYSA-N ChemAxon polar_surface_area 83.55 ChemAxon refractivity 26.91 ChemAxon polarizability 11.44 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 20573 Specdb::MsMs 20574 Specdb::MsMs 20575 Specdb::MsMs 22124 Specdb::MsMs 22125 Specdb::MsMs 22126 Specdb::CMs 1342 Specdb::CMs 90390 Common pea Type 1 specific Pisum sativum 3888 73.3 73.3 73.3 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 Anti-sickling 614