1.0 2010-04-08 22:04:58 UTC 2025-11-18 22:31:23 UTC FDB001457 (+)-trans-Sabinol (+)-trans-sabinol is a member of the class of compounds known as bicyclic monoterpenoids. Bicyclic monoterpenoids are monoterpenoids containing exactly 2 rings, which are fused to each other (+)-trans-sabinol is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). (+)-trans-sabinol can be found in common sage, dill, and sunflower, which makes (+)-trans-sabinol a potential biomarker for the consumption of these food products. trans-Sabinol C10H18O 154.2493 154.135765198 (1S,3R,5S)-4-methyl-1-(propan-2-yl)bicyclo[3.1.0]hexan-3-ol (1S,3R,5S)-1-isopropyl-4-methylbicyclo[3.1.0]hexan-3-ol 471-16-9 CC(C)[C@@]12C[C@H]1C(C)[C@H](O)C2 InChI=1S/C10H18O/c1-6(2)10-4-8(10)7(3)9(11)5-10/h6-9,11H,4-5H2,1-3H3/t7?,8-,9+,10-/m0/s1 DZVXRFMREAADPP-UPBARMNASA-N belongs to the class of organic compounds known as bicyclic monoterpenoids. These are monoterpenoids containing exactly 2 rings, which are fused to each other. Bicyclic monoterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Monoterpenoids Aliphatic homopolycyclic compounds Cyclic alcohols and derivatives Hydrocarbon derivatives Secondary alcohols Alcohol Aliphatic homopolycyclic compound Bicyclic monoterpenoid Cyclic alcohol Hydrocarbon derivative Organic oxygen compound Organooxygen compound Secondary alcohol Thujane monoterpenoid logp 1.59 ALOGPS logs -2.25 ALOGPS solubility 8.59e-01 g/l ALOGPS logp 1.9 ChemAxon pka_strongest_acidic 18.66 ChemAxon pka_strongest_basic -1.2 ChemAxon iupac (1S,3R,5S)-4-methyl-1-(propan-2-yl)bicyclo[3.1.0]hexan-3-ol ChemAxon average_mass 154.2493 ChemAxon mono_mass 154.135765198 ChemAxon smiles CC(C)[C@@]12C[C@H]1C(C)[C@H](O)C2 ChemAxon formula C10H18O ChemAxon inchi InChI=1S/C10H18O/c1-6(2)10-4-8(10)7(3)9(11)5-10/h6-9,11H,4-5H2,1-3H3/t7?,8-,9+,10-/m0/s1 ChemAxon inchikey DZVXRFMREAADPP-UPBARMNASA-N ChemAxon polar_surface_area 20.23 ChemAxon refractivity 45.46 ChemAxon polarizability 24.22 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 53970 Specdb::MsMs 53971 Specdb::MsMs 53972 Specdb::MsMs 115245 Specdb::MsMs 115246 Specdb::MsMs 115247 Specdb::MsMs 3597433 Specdb::MsMs 3597434 Specdb::MsMs 3597435 Specdb::MsMs 3597436 Specdb::MsMs 3597437 Specdb::MsMs 3597438 Common sage Type 1 specific Salvia officinalis 38868 28.05 28.05 28.05 mg/100 g Dill Type 1 specific Anethum graveolens 40922 Rabbiteye blueberry Type 1 specific Vaccinium virgatum Sunflower Type 1 specific Helianthus annuus 4232 Anti-helmintic 72 A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. Emmenagogue 900 Perfumery 1206 A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. Pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. Toxic 1371 A role played by the molecular entity or part thereof which causes the development of a pathological process.