1.0 2010-04-08 22:05:24 UTC 2025-11-18 22:38:03 UTC FDB002520 (R)-Oxypeucedanin Isolated from Angelica glauca. (R)-Oxypeucedanin is found in herbs and spices. Amgard CPC Amgard CPC 405 Black orus Black phosphorus Bonide blue death rat killer Common sense cockroach and rat preparations ECO2FUME Exolit 385 Exolit 405 Exolit LPKN Exolit LPKN 275 Exolit RP 605 Exolit RP 650 Exolit RP 652 Exolit RP 654 Exolit VPK-n 361 FR-T 2 (element) Gas-ex-b Hishigado Hishigado ap Hishigado CP Hishigado NP 10 Hishigado PL Hostaflam RP 602 Hostaflam RP 614 Hostaflam RP 622 Hostaflam RP 654 Ine Ine (fumigant) Nova Sol R 20 Novaexcel 140 Novaexcel 150 Novaexcel F 5 Novaexcel ST 100 Novaexcel ST 140 Novaexcel ST 300 Novared 120UF Novared 120UFA Novared 120VFA Novared 140 Novared 280 Novared C 120 Novared F 5 Orus (red) ORUS metal, 99.999%, red Orus-31 Orus, amorphous Orus, white Oxypeucedanin Phosphine Phosphine (fumigant) Phosphine [UN2199] [Poison gas] Phosphorus (red) PHOSPHORUS METAL, 99.999%, RED Phosphorus-31 Phosphorus, amorphous [UN1338] [Flammable solid] Phosphorus, white Rat-nip C16H14O5 286.2794 286.084123558 4-[(3,3-dimethyloxiran-2-yl)methoxy]-7H-furo[3,2-g]chromen-7-one 4-[(3,3-dimethyloxiran-2-yl)methoxy]furo[3,2-g]chromen-7-one 3173-02-2 CC1(C)OC1COC1=C2C=CC(=O)OC2=CC2=C1C=CO2 InChI=1S/C16H14O5/c1-16(2)13(21-16)8-19-15-9-3-4-14(17)20-12(9)7-11-10(15)5-6-18-11/h3-7,13H,8H2,1-2H3 QTAGQHZOLRFCBU-UHFFFAOYSA-N belongs to the class of organic compounds known as psoralens. These are organic compounds containing a psoralen moiety, which consists of a furan fused to a chromenone to for 7H-furo[3,2-g]chromen-7-one. Psoralens Organic compounds Phenylpropanoids and polyketides Coumarins and derivatives Furanocoumarins Aromatic heteropolycyclic compounds 1-benzopyrans Alkyl aryl ethers Benzenoids Benzofurans Dialkyl ethers Epoxides Furans Heteroaromatic compounds Hydrocarbon derivatives Lactones Organic oxides Oxacyclic compounds Pyranones and derivatives 1-benzopyran Alkyl aryl ether Aromatic heteropolycyclic compound Benzenoid Benzofuran Benzopyran Dialkyl ether Ether Furan Heteroaromatic compound Hydrocarbon derivative Lactone Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Oxirane Psoralen Pyran Pyranone logp 2.79 ALOGPS logs -3.74 ALOGPS solubility 5.24e-02 g/l ALOGPS melting_point Mp 104-105° logp 2.32 ChemAxon pka_strongest_basic -2.8 ChemAxon iupac 4-[(3,3-dimethyloxiran-2-yl)methoxy]-7H-furo[3,2-g]chromen-7-one ChemAxon average_mass 286.2794 ChemAxon mono_mass 286.084123558 ChemAxon smiles CC1(C)OC1COC1=C2C=CC(=O)OC2=CC2=C1C=CO2 ChemAxon formula C16H14O5 ChemAxon inchi InChI=1S/C16H14O5/c1-16(2)13(21-16)8-19-15-9-3-4-14(17)20-12(9)7-11-10(15)5-6-18-11/h3-7,13H,8H2,1-2H3 ChemAxon inchikey QTAGQHZOLRFCBU-UHFFFAOYSA-N ChemAxon polar_surface_area 61.2 ChemAxon refractivity 74.65 ChemAxon polarizability 28.89 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 19361 Specdb::CMs 151449 Specdb::MsMs 7778 Specdb::MsMs 7779 Specdb::MsMs 7780 Specdb::MsMs 14450 Specdb::MsMs 14451 Specdb::MsMs 14452 Specdb::MsMs 2413183 Specdb::MsMs 2413184 Specdb::MsMs 2413185 Specdb::MsMs 2552120 Specdb::MsMs 2552121 Specdb::MsMs 2552122 HMDB30622 #<Reference:0x000055ce30615748> #<Reference:0x000055ce30615590> #<Reference:0x000055ce306153d8> Adzuki bean Type 1 specific Vigna angularis 3914 174.0 174.0 174.0 mg/100 g Agar Type 1 specific Eucheuma 31444 14.0 14.0 14.0 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 35.0 70.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 61.775 148.0 22.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 491.0 491.0 491.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 229.142857 312.0 139.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 210.0 210.0 210.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 225.0 250.0 200.0 mg/100 g Apple Type 1 specific Malus pumila 283210 15.76 38.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 33.533333 65.7 13.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 134.0 350.0 2.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 51.75 85.5 27.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 220.0 220.0 220.0 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 180.0 180.0 180.0 mg/100 g Avocado Type 1 specific Persea americana 3435 46.5 46.5 46.5 mg/100 g Baby food Type 2 specific 261.0 261.0 261.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 37.333333 50.0 31.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 273.0 300.0 246.0 mg/100 g Beer Type 2 specific 13.65 21.5 9.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 9.0 9.0 9.0 mg/100 g Biscuit Type 2 specific 84.333333 190.0 0.0 mg/100 g Black salsify Type 1 specific Scorzonera hispanica 114289 94.0 94.0 94.0 mg/100 g Black tea Type 1 315.5 630.0 1.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 379.0 379.0 379.0 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 18.36 47.9 0.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 590.0 590.0 590.0 mg/100 g Breakfast cereal Type 2 specific 375.0 1055.0 32.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 67.966667 86.9 50.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 38.175 83.7 0.0 mg/100 g Burbot Type 1 specific Lota lota 69944 190.0 190.0 190.0 mg/100 g Butter Type 2 specific 24.0 24.0 24.0 mg/100 g Buttermilk Type 2 specific 90.5 92.0 89.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 210.0 210.0 210.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 28.75 33.1 24.0 mg/100 g Casein Type 2 specific 0.0 0.0 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 510.5 531.0 490.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 27.0 27.0 27.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 180.0 180.0 180.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 190.021277 420.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 40.88 48.1 12.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 74.0 74.0 74.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 0.0 0.0 0.0 mg/100 g Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 195.0 195.0 195.0 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 50.0 50.0 50.0 mg/100 g Charr Type 1 specific Salvelinus 8033 280.0 300.0 260.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 18.0 18.0 18.0 mg/100 g Cheese Type 2 specific 457.866667 930.0 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 26.0 26.0 26.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 40.6 41.3 39.9 mg/100 g Chestnut Type 1 specific Castanea 21019 74.0 74.0 74.0 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 182.285714 320.0 130.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 300.0 300.0 300.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 35.7 40.0 31.4 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 40.2 40.2 40.2 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 53.0 53.0 53.0 mg/100 g Chocolate Type 2 specific 176.0 240.0 120.0 mg/100 g Chocolate spread Type 2 specific 183.0 183.0 183.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 64.0 64.0 64.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 176.0 192.0 144.0 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 199.15 450.0 0.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 346.666667 660.0 190.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 76.0 187.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 134.0 350.0 2.0 mg/100 g Cold cut Type 2 specific 189.25 236.0 150.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 277.5 307.0 248.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 153.75 477.0 19.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 209.75 377.0 117.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 38.066667 73.9 29.3 mg/100 g Common dab Type 1 specific Limanda limanda 27771 182.0 182.0 182.0 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 80.55 85.1 76.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 109.0 109.0 109.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 153.72 407.0 60.6 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 312.666667 481.0 48.0 mg/100 g Corn Type 1 specific Zea mays 4577 97.322222 180.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 263.333333 350.0 220.0 mg/100 g Cracker Type 2 specific 110.0 110.0 110.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 110.0 110.0 110.0 mg/100 g Cream Type 2 specific 78.4 100.0 57.0 mg/100 g Crisp bread Type 2 specific 306.0 430.0 170.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 19.633333 39.7 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 34.85 51.4 17.0 mg/100 g Curry powder Type 2 specific 349.0 349.0 349.0 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 26.0 29.0 23.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 56.0 56.0 56.0 mg/100 g Dill Type 1 specific Anethum graveolens 40922 297.45 543.0 51.9 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 177.098765 369.0 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 883.0 956.0 810.0 mg/100 g Dumpling Type 2 specific 0.0 0.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 15.15 30.3 0.0 mg/100 g Eggs Unknown generic 324.153846 920.0 11.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 18.6 55.8 0.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 28.0 28.0 28.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 48.9 78.2 19.6 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 262.9 487.0 38.8 mg/100 g Fig Type 1 specific Ficus carica 3494 60.133333 83.1 31.0 mg/100 g Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 182.0 182.0 182.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 273.5 547.0 0.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 34.0 34.0 34.0 mg/100 g Fruit gum Type 2 specific 4.0 4.0 4.0 mg/100 g Fruit juice Type 2 specific 11.0 11.0 11.0 mg/100 g Fruit preserve Type 2 specific 14.666667 18.0 13.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 142.0 142.0 142.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 152.928571 500.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 76.0 76.0 76.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 24.2 24.2 24.2 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 76.675 356.0 19.0 mg/100 g Garfish Type 1 specific Belone belone 129037 251.0 251.0 251.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 288.5 417.0 160.0 mg/100 g Gelatin Type 2 specific 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 34.0 34.0 34.0 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 72.3 72.3 72.3 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 23.6 23.6 23.6 mg/100 g Grape Type 1 specific Vitis 3603 34.95 107.0 0.0 mg/100 g Grape wine Type 2 specific 11.6 20.0 6.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 15.75 19.5 12.0 mg/100 g Green tea Type 1 315.5 630.0 1.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 175.333333 210.0 158.0 mg/100 g Groundcherry Type 1 specific Physalis 24663 27.0 27.0 27.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 40.0 40.0 40.0 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 96.666667 170.0 0.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 4.0 4.0 4.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 349.0 349.0 349.0 mg/100 g Herbal tea Type 1 315.5 630.0 1.0 mg/100 g Herbs and Spices Unknown generic Horseradish Type 1 specific Armoracia rusticana 3704 52.35 80.5 24.2 mg/100 g Hot chocolate Type 2 specific 97.0 98.0 95.0 mg/100 g Ice cream Type 2 specific 53.4 116.0 0.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 72.3 72.3 72.3 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 14.5 29.0 0.0 mg/100 g Kefir Type 2 specific 95.0 95.0 95.0 mg/100 g Ketchup Type 2 specific 17.2 34.4 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 32.8 32.8 32.8 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 46.0 46.0 46.0 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 250.0 250.0 250.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 19.0 19.0 19.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 260.0 260.0 260.0 mg/100 g Lard Type 2 specific 3.0 3.0 3.0 mg/100 g Leavening agent Type 2 specific 2541.0 8430.0 104.0 mg/100 g Leek Type 1 specific Allium porrum 45.6 45.6 45.6 mg/100 g Lemon Type 1 specific Citrus limon 2708 17.9 21.0 12.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 235.5 271.0 200.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 321.25 373.0 173.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 30.175 39.2 22.5 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 31.0 31.0 31.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 18.0 18.0 18.0 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 13.0 16.0 10.0 mg/100 g Liquor Type 2 specific 7.0 50.0 0.0 mg/100 g Liquorice Type 2 specific 13.75 29.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 26.0 26.0 26.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 27.0 27.0 27.0 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 101.5 203.0 0.0 mg/100 g Malus (Crab apple) Type 1 specific Malus 3749 15.0 15.0 15.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 18.25 19.2 17.3 mg/100 g Mango Type 1 specific Mangifera indica 29780 15.5 15.5 15.5 mg/100 g Margarine Type 2 specific 18.5 23.0 10.0 mg/100 g Margarine-like spread Type 2 specific 17.8 17.8 17.8 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 159.666667 189.0 145.0 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Marzipan Type 2 specific 120.0 240.0 0.0 mg/100 g Meat bouillon Type 2 specific 257.2 590.0 3.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meringue Type 2 specific 6.0 6.0 6.0 mg/100 g Milk (Cow) Type 2 specific 94.725 97.0 89.0 mg/100 g Milk (Human) Type 2 specific 15.0 16.0 14.0 mg/100 g Milk (Other mammals) Type 2 specific 111.0 111.0 111.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 240.0 240.0 240.0 mg/100 g Miso Type 2 specific 310.0 310.0 310.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 210.0 210.0 210.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 247.5 395.0 100.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 23.0 38.9 7.2 mg/100 g Mustard Type 2 specific 152.0 170.0 134.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 27.4 27.4 27.4 mg/100 g Northern pike Type 1 specific Esox lucius 8010 240.0 240.0 240.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 144.0 144.0 144.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 213.0 213.0 213.0 mg/100 g Oat Type 1 specific Avena sativa 4498 501.75 622.0 411.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 63.0 63.0 63.0 mg/100 g Olive Type 1 specific Olea europaea 4146 13.81 29.0 0.0 mg/100 g Other alcoholic beverage Type 2 specific 5.0 5.0 5.0 mg/100 g Other animal fat Type 2 specific 13.0 26.0 0.0 mg/100 g Other bread Type 2 specific 126.0 154.0 105.0 mg/100 g Other bread product Type 2 specific 100.0 100.0 100.0 mg/100 g Other candy Type 2 specific 3.75 15.0 0.0 mg/100 g Other dish Type 2 specific 77.666667 133.0 0.0 mg/100 g Other fermented milk Type 2 specific 97.0 99.0 95.0 mg/100 g Other fish product Type 2 specific 0.0 0.0 0.0 mg/100 g Other frozen dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Other fruit product Type 2 specific 70.4 70.4 70.4 mg/100 g Other snack food Type 2 specific 155.666667 195.0 129.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 153.0 153.0 153.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 175.0 175.0 175.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 37.0 37.0 37.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 10.3 10.3 10.3 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 71.55 72.0 71.1 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 94.0 94.0 94.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 69.2 69.2 69.2 mg/100 g Pasta Type 2 specific 186.666667 370.0 50.0 mg/100 g Pastry Type 2 specific 46.272727 210.0 0.0 mg/100 g Pate Type 2 specific 163.0 163.0 163.0 mg/100 g Peach Type 1 specific Prunus persica 3760 52.933333 120.0 16.9 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 282.5 409.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 16.1 18.8 13.4 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 277.666667 293.0 263.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 52.242857 176.0 17.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 173.0 173.0 173.0 mg/100 g Perciformes Type 1 specific Perciformes 8111 240.0 240.0 240.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 17.0 17.0 17.0 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 220.0 220.0 220.0 mg/100 g Pine nut Type 1 specific Pinus 3337 575.0 575.0 575.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 12.325 17.4 8.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 487.5 490.0 485.0 mg/100 g Pizza Type 2 specific 0.0 0.0 0.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 117.333333 220.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 113.333333 170.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 8.0 8.0 8.0 mg/100 g Poppy Type 1 specific Papaver 3468 849.0 849.0 849.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 111.12 290.0 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 24.0 24.0 24.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 11.825 27.9 0.0 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 17.0 17.0 17.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 210.0 210.0 210.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 275.0 290.0 260.0 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 25.8 36.2 17.0 mg/100 g Red tea Type 1 315.5 630.0 1.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 23.8 50.9 10.0 mg/100 g Remoulade Type 2 specific 55.0 55.0 55.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 356.7875 1677.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 134.0 350.0 2.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 290.0 290.0 290.0 mg/100 g Rose hip Type 1 specific Rosa 3764 48.0 104.0 5.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 22.285714 38.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 223.6 360.0 119.0 mg/100 g Rye bread Type 2 specific 135.941176 197.0 100.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Salad dressing Type 2 specific 20.166667 74.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 268.0 440.0 200.0 mg/100 g Salt Type 2 specific 3.066667 8.0 0.0 mg/100 g Sauce Type 2 specific 20.333333 44.0 0.0 mg/100 g Sausage Type 2 specific 173.058824 255.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 42.0 42.0 42.0 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 243.5 267.0 220.0 mg/100 g Semolina Type 2 specific 68.1 68.1 68.1 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 439.666667 739.0 0.0 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 196.777778 400.0 130.0 mg/100 g Sherry Type 2 specific 9.333333 11.0 7.0 mg/100 g Shrimp Type 1 specific Caridea 6694 165.666667 265.0 113.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Soft drink Type 2 specific 17.4 33.0 3.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 63.0 63.0 63.0 mg/100 g Soup Type 2 specific 27.0 27.0 27.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 208.333333 560.0 0.0 mg/100 g Soy milk Type 2 specific 89.0 89.0 89.0 mg/100 g Soy sauce Type 2 specific 125.0 125.0 125.0 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 43.85 46.4 41.3 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 253.0 253.0 253.0 mg/100 g Spirit Type 2 specific 1.25 5.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 12.0 12.0 12.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 11.575 22.7 0.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 62.5 125.0 0.0 mg/100 g Sugar Type 2 specific 7.366667 20.0 0.1 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 270.0 540.0 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 42.6 42.6 42.6 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 18.9 22.1 13.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 43.933333 55.3 29.5 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 46.0 46.0 46.0 mg/100 g Syrup Type 2 specific 2.5 2.5 2.5 mg/100 g Tallow Type 2 specific 106.666667 190.0 0.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 113.0 113.0 113.0 mg/100 g Tea Type 1 specific Camellia sinensis 4442 210.333333 630.0 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 184.25 211.0 163.0 mg/100 g Toffee Type 2 specific 32.0 64.0 0.0 mg/100 g Tofu Type 2 specific 126.0 126.0 126.0 mg/100 g True frog Type 1 specific Ranidae 8397 147.0 147.0 147.0 mg/100 g True seal Type 1 specific Phocidae 9709 213.0 213.0 213.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 203.0 203.0 203.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 189.25 236.0 150.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 50.0 50.0 50.0 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 12.0 13.0 11.0 mg/100 g Vegetable juice Type 2 specific 32.5 32.5 32.5 mg/100 g Vermouth Type 2 specific 5.5 7.0 4.0 mg/100 g Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Water Type 2 specific 1.5 3.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 68.3 68.3 68.3 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 19.8 19.8 19.8 mg/100 g Wheat Type 1 specific Triticum 4564 299.285714 1000.0 0.0 mg/100 g Wheat bread Type 2 specific 131.789474 268.0 0.0 mg/100 g Whey Type 2 specific 436.666667 932.0 46.0 mg/100 g Whisky Type 2 specific 3.0 3.0 3.0 mg/100 g White bread Type 1 154.0 154.0 154.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 290.0 290.0 290.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 183.0 183.0 183.0 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 30.1 30.1 30.1 mg/100 g Yam Type 1 specific Dioscorea 4672 55.0 55.0 55.0 mg/100 g Ymer Type 2 specific 132.0 134.0 130.0 mg/100 g Yogurt Type 2 specific 78.31 99.0 0.1 mg/100 g