1.0 2010-04-08 22:06:42 UTC 2025-11-18 22:59:21 UTC FDB005473 Esterase Esterase belongs to alkaloids and derivatives class of compounds. Those are naturally occurring chemical compounds that contain mostly basic nitrogen atoms. This group also includes some related compounds with neutral and even weakly acidic propertiesand is also some synthetic compounds of similar structure are attributed to alkaloids. In addition to carbon, hydrogen and nitrogen, alkaloids may also contain oxygen, sulfur and more rarely other elements such as chlorine, bromine, and phosphorus. Esterase can be found in a number of food items such as fig, cabbage, wild leek, and white cabbage, which makes esterase a potential biomarker for the consumption of these food products. A wide range of different esterases exist that differ in their substrate specificity, their protein structure, and their biological function . Carboxyl esterase Esterase from porcine liver C8H14BrNO2 236.106 235.020791344 methyl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate hydrobromide arecoline hydrobromide Br.COC(=O)C1=CCCN(C)C1 InChI=1S/C8H13NO2.BrH/c1-9-5-3-4-7(6-9)8(10)11-2;/h4H,3,5-6H2,1-2H3;1H AXOJRQLKMVSHHZ-UHFFFAOYSA-N belongs to the class of organic compounds known as alkaloids and derivatives. These are naturally occurring chemical compounds that contain mostly basic nitrogen atoms. This group also includes some related compounds with neutral and even weakly acidic properties. Also some synthetic compounds of similar structure are attributed to alkaloids. In addition to carbon, hydrogen and nitrogen, alkaloids may also contain oxygen, sulfur and more rarely other elements such as chlorine, bromine, and phosphorus. Alkaloids and derivatives Organic compounds Alkaloids and derivatives Aliphatic heteromonocyclic compounds Amino acids and derivatives Azacyclic compounds Carbonyl compounds Enoate esters Hydrobromides Hydrocarbon derivatives Hydropyridines Methyl esters Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Trialkylamines Aliphatic heteromonocyclic compound Alkaloid or derivatives Alpha,beta-unsaturated carboxylic ester Amine Amino acid or derivatives Azacycle Carbonyl group Carboxylic acid derivative Carboxylic acid ester Enoate ester Hydrobromide Hydrocarbon derivative Hydropyridine Methyl ester Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Tertiary aliphatic amine Tertiary amine logp 0.65 ChemAxon pka_strongest_basic 8.23 ChemAxon iupac methyl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate hydrobromide ChemAxon average_mass 236.106 ChemAxon mono_mass 235.020791344 ChemAxon smiles Br.COC(=O)C1=CCCN(C)C1 ChemAxon formula C8H14BrNO2 ChemAxon inchi InChI=1S/C8H13NO2.BrH/c1-9-5-3-4-7(6-9)8(10)11-2;/h4H,3,5-6H2,1-2H3;1H ChemAxon inchikey AXOJRQLKMVSHHZ-UHFFFAOYSA-N ChemAxon polar_surface_area 29.54 ChemAxon refractivity 43.86 ChemAxon polarizability 17.1 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 52197 Specdb::MsMs 52198 Specdb::MsMs 52199 Specdb::MsMs 175785 Specdb::MsMs 175786 Specdb::MsMs 175787 38462 Cabbage Type 1 specific Brassica oleracea var. capitata 3716 Common wheat Type 1 specific Triticum aestivum 4565 Fig Type 1 specific Ficus carica 3494 Rice Type 1 specific Oryza sativa 4530 Soy bean Type 1 specific Glycine max 3847 White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. Wild leek Type 1 specific Allium ampeloprasum 4681