1.0 2010-04-08 22:09:56 UTC 2019-11-26 03:05:57 UTC FDB012010 Glucosyringic acid Glucosyringic acid, also known as glucosyringate, is a member of the class of compounds known as hydrolyzable tannins. Hydrolyzable tannins are tannins with a structure characterized by either of the following models. In model 1, the structure contains galloyl units (in some cases, shikimic acid units) are linked to diverse polyol carbohydrate-, catechin-, or triterpenoid units. In model 2, contains at least two galloyl units C-C coupled to each other, and do not contain a glycosidically linked catechin unit. Glucosyringic acid is slightly soluble (in water) and a weakly acidic compound (based on its pKa). Glucosyringic acid can be found in fennel, which makes glucosyringic acid a potential biomarker for the consumption of this food product. Benzoic acid, 4-(beta-D-glucopyranosyloxy)-3,5-dimethoxy- Gluco-syringic acid Glucosyringic acid Syringin 4-O-beta-glucoside C15H20O10 360.3133 360.10564686 3,5-dimethoxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}benzoic acid 3,5-dimethoxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}benzoic acid 33228-65-8 COC1=CC(=CC(OC)=C1OC1OC(CO)C(O)C(O)C1O)C(O)=O InChI=1S/C15H20O10/c1-22-7-3-6(14(20)21)4-8(23-2)13(7)25-15-12(19)11(18)10(17)9(5-16)24-15/h3-4,9-12,15-19H,5H2,1-2H3,(H,20,21) BLKMDORKRDACEI-UHFFFAOYSA-N belongs to the class of organic compounds known as hydrolyzable tannins. These are tannins with a structure characterized by either of the following models. In model 1, the structure contains galloyl units (in some cases, shikimic acid units) that are linked to diverse polyol carbohydrate-, catechin-, or triterpenoid units. In model 2, contains at least two galloyl units C-C coupled to each other, and do not contain a glycosidically linked catechin unit. Hydrolyzable tannins Organic compounds Phenylpropanoids and polyketides Tannins Hydrolyzable tannins Aromatic heteromonocyclic compounds Acetals Alkyl aryl ethers Anisoles Benzoic acids Benzoyl derivatives Carboxylic acids Dimethoxybenzenes Gallic acid and derivatives Hexoses Hydrocarbon derivatives M-methoxybenzoic acids and derivatives Monocarboxylic acids and derivatives O-glycosyl compounds Organic oxides Oxacyclic compounds Oxanes Phenolic glycosides Phenoxy compounds Polyols Primary alcohols Secondary alcohols Sugar acids and derivatives Acetal Alcohol Alkyl aryl ether Anisole Aromatic heteromonocyclic compound Benzenoid Benzoic acid Benzoic acid or derivatives Benzoyl Carboxylic acid Carboxylic acid derivative Dimethoxybenzene Ether Gallic acid or derivatives Glycosyl compound Hexose monosaccharide Hydrocarbon derivative Hydrolyzable tannin M-dimethoxybenzene M-methoxybenzoic acid or derivatives Methoxybenzene Monocarboxylic acid or derivatives Monocyclic benzene moiety Monosaccharide O-glycosyl compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Oxane Phenol ether Phenolic glycoside Phenoxy compound Polyol Primary alcohol Secondary alcohol Sugar acid logp -0.86 ALOGPS logs -1.60 ALOGPS solubility 9.10e+00 g/l ALOGPS melting_point Mp 206-207° logp -1.3 ChemAxon pka_strongest_acidic 3.87 ChemAxon pka_strongest_basic -3 ChemAxon iupac 3,5-dimethoxy-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}benzoic acid ChemAxon average_mass 360.3133 ChemAxon mono_mass 360.10564686 ChemAxon smiles COC1=CC(=CC(OC)=C1OC1OC(CO)C(O)C(O)C1O)C(O)=O ChemAxon formula C15H20O10 ChemAxon inchi InChI=1S/C15H20O10/c1-22-7-3-6(14(20)21)4-8(23-2)13(7)25-15-12(19)11(18)10(17)9(5-16)24-15/h3-4,9-12,15-19H,5H2,1-2H3,(H,20,21) ChemAxon inchikey BLKMDORKRDACEI-UHFFFAOYSA-N ChemAxon polar_surface_area 155.14 ChemAxon refractivity 80.37 ChemAxon polarizability 34 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 10 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 51120 Specdb::MsMs 51121 Specdb::MsMs 51122 Specdb::MsMs 128403 Specdb::MsMs 128404 Specdb::MsMs 128405 Specdb::MsMs 3605296 Specdb::MsMs 3605297 Specdb::MsMs 3605298 Specdb::MsMs 3605299 Specdb::MsMs 3605300 Specdb::MsMs 3605301 Fennel Type 1 specific Foeniculum vulgare 48038