1.0 2010-04-08 22:11:24 UTC 2025-11-19 00:48:47 UTC FDB014671 Grosheimin Grosheimin belongs to guaianolides and derivatives class of compounds. Those are diterpene lactones with a structure characterized by the presence of a gamma-lactone fused to a guaiane, forming 3,6,9-trimethyl-azuleno[4,5-b]furan-2-one or a derivative. Grosheimin is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Grosheimin is a bitter tasting compound found in globe artichoke, which makes grosheimin a potential biomarker for the consumption of this food product. 8-Hydroxy-3-oxo-10(14),11(13)-guaiadien-12,6-olide Grosheimin Grossheimin Grosshemin C15H18O4 262.301 262.120509064 4-hydroxy-9-methyl-3,6-dimethylidene-dodecahydroazuleno[4,5-b]furan-2,8-dione 4-hydroxy-9-methyl-3,6-dimethylidene-octahydroazuleno[4,5-b]furan-2,8-dione 22489-66-3 CC1C2C3OC(=O)C(=C)C3C(O)CC(=C)C2CC1=O InChI=1S/C15H18O4/c1-6-4-11(17)13-8(3)15(18)19-14(13)12-7(2)10(16)5-9(6)12/h7,9,11-14,17H,1,3-5H2,2H3 YGMIBVIKXJJQQJ-UHFFFAOYSA-N belongs to the class of organic compounds known as guaianolides and derivatives. These are diterpene lactones with a structure characterized by the presence of a gamma-lactone fused to a guaiane, forming 3,6,9-trimethyl-azuleno[4,5-b]furan-2-one or a derivative. Guaianolides and derivatives Organic compounds Lipids and lipid-like molecules Prenol lipids Terpene lactones Aliphatic heteropolycyclic compounds Cyclic alcohols and derivatives Cyclic ketones Enoate esters Gamma butyrolactones Guaianes Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Secondary alcohols Tetrahydrofurans Alcohol Aliphatic heteropolycyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Cyclic alcohol Cyclic ketone Enoate ester Gamma butyrolactone Guaiane sesquiterpenoid Guaianolide-skeleton Hydrocarbon derivative Ketone Lactone Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Secondary alcohol Sesquiterpenoid Tetrahydrofuran logp 0.18 ALOGPS logs -1.74 ALOGPS solubility 4.77e+00 g/l ALOGPS melting_point Mp 205° logp 1.15 ChemAxon pka_strongest_acidic 14.71 ChemAxon pka_strongest_basic -2.9 ChemAxon iupac 4-hydroxy-9-methyl-3,6-dimethylidene-dodecahydroazuleno[4,5-b]furan-2,8-dione ChemAxon average_mass 262.301 ChemAxon mono_mass 262.120509064 ChemAxon smiles CC1C2C3OC(=O)C(=C)C3C(O)CC(=C)C2CC1=O ChemAxon formula C15H18O4 ChemAxon inchi InChI=1S/C15H18O4/c1-6-4-11(17)13-8(3)15(18)19-14(13)12-7(2)10(16)5-9(6)12/h7,9,11-14,17H,1,3-5H2,2H3 ChemAxon inchikey YGMIBVIKXJJQQJ-UHFFFAOYSA-N ChemAxon polar_surface_area 63.6 ChemAxon refractivity 68.43 ChemAxon polarizability 27.12 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 63126 Specdb::MsMs 63127 Specdb::MsMs 63128 Specdb::MsMs 120027 Specdb::MsMs 120028 Specdb::MsMs 120029 Specdb::MsMs 3605731 Specdb::MsMs 3605732 Specdb::MsMs 3605733 Specdb::MsMs 3605734 Specdb::MsMs 3605735 Specdb::MsMs 3605736 Globe artichoke Type 1 specific Cynara scolymus 59895 bitter