1.0 2010-04-08 22:12:22 UTC 2019-11-26 03:13:03 UTC FDB016329 1,1-Dimethoxydecane Flavouring ingredient 1,1-Dimethoxy-decane 1,1-Dimethoxydecane 10,10-Dimethoxydecane Aldehyde C-10 dimethylacetal Capraldehyde dimethyl acetal Decanal dimethyl acetal Decanal, dimethyl acetal Decanal, dimethyl acetal (8CI) Decanal, dimethylacetal Decane, 1,1-dimethoxy- Decylaldehyde dimethyl acetal Decylaldehyde dimethylacetal Decylaldehyde dma FEMA 2363 N-decanal dimethyl acetal C12H26O2 202.3336 202.193280076 1,1-dimethoxydecane decane, 1,1-dimethoxy- 7779-41-1 CCCCCCCCCC(OC)OC InChI=1S/C12H26O2/c1-4-5-6-7-8-9-10-11-12(13-2)14-3/h12H,4-11H2,1-3H3 NCRNCSZWOOYBQF-UHFFFAOYSA-N belongs to the class of organic compounds known as acetals. Acetals are compounds having the structure R2C(OR')2 ( R' not Hydrogen) and thus diethers of geminal diols. Originally, the term was confined to derivatives of aldehydes (one R = H), but it now applies equally to derivatives of ketones (neither R = H ). Mixed acetals have different R' groups. Acetals Organic compounds Organic oxygen compounds Organooxygen compounds Ethers Aliphatic acyclic compounds Hydrocarbon derivatives Acetal Aliphatic acyclic compound Hydrocarbon derivative logp 4.10 ALOGPS logs -4.41 ALOGPS solubility 7.93e-03 g/l ALOGPS logp 4.17 ChemAxon pka_strongest_basic -4 ChemAxon iupac 1,1-dimethoxydecane ChemAxon average_mass 202.3336 ChemAxon mono_mass 202.193280076 ChemAxon smiles CCCCCCCCCC(OC)OC ChemAxon formula C12H26O2 ChemAxon inchi InChI=1S/C12H26O2/c1-4-5-6-7-8-9-10-11-12(13-2)14-3/h12H,4-11H2,1-3H3 ChemAxon inchikey NCRNCSZWOOYBQF-UHFFFAOYSA-N ChemAxon polar_surface_area 18.46 ChemAxon refractivity 60.38 ChemAxon polarizability 26.24 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 7527 Specdb::CMs 18316 Specdb::CMs 29198 Specdb::CMs 101870 Specdb::CMs 172929 Specdb::MsMs 82437 Specdb::MsMs 82438 Specdb::MsMs 82439 Specdb::MsMs 143793 Specdb::MsMs 143794 Specdb::MsMs 143795 Specdb::MsMs 2842827 Specdb::MsMs 2842828 Specdb::MsMs 2842829 Specdb::MsMs 2866851 Specdb::MsMs 2866852 Specdb::MsMs 2866853 HMDB37310 #<Reference:0x000055ce334f2a98> Blackberry Type 1 specific Rubus Evergreen blackberry Type 1 specific Rubus laciniatus citrus green herbal neroli