1.0 2010-04-08 22:13:22 UTC 2025-11-19 02:05:53 UTC FDB017889 (R)-3,4-Dihydro-6,8-dihydroxy-3-methyl-1H-2-benzopyran-1-one (r)-3,4-dihydro-6,8-dihydroxy-3-methyl-1h-2-benzopyran-1-one belongs to hydroxybenzoic acid derivatives class of compounds. Those are compounds containing a hydroxybenzoic acid (or a derivative), which is a benzene ring bearing a carboxyl and a hydroxyl groups (r)-3,4-dihydro-6,8-dihydroxy-3-methyl-1h-2-benzopyran-1-one is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). (r)-3,4-dihydro-6,8-dihydroxy-3-methyl-1h-2-benzopyran-1-one can be found in carrot and wild carrot, which makes (r)-3,4-dihydro-6,8-dihydroxy-3-methyl-1h-2-benzopyran-1-one a potential biomarker for the consumption of these food products. (3R)-6,8-dihydroxy-3-methyl-3,4-dihydro-1H-isochromen-1-one 3,4-Dihydro-6,8-dihydroxy-3-methylisocoumarin 6,8-Dihydroxy-3-methyl-3,4-dihydroisocoumarin 6,8-dihydroxy-3-methyl-isochroman-1-one 6HM C10H10O4 194.184 194.057908808 6,8-dihydroxy-3-methyl-3,4-dihydro-1H-2-benzopyran-1-one 6,8-dihydroxy-3-methyl-3,4-dihydro-2-benzopyran-1-one 70901-60-9 CC1CC2=C(C(O)=CC(O)=C2)C(=O)O1 InChI=1S/C10H10O4/c1-5-2-6-3-7(11)4-8(12)9(6)10(13)14-5/h3-5,11-12H,2H2,1H3 DHLPMLVSBRRUGA-UHFFFAOYSA-N belongs to the class of organic compounds known as hydroxybenzoic acid derivatives. Hydroxybenzoic acid derivatives are compounds containing a hydroxybenzoic acid (or a derivative), which is a benzene ring bearing a carboxyl and a hydroxyl groups. Hydroxybenzoic acid derivatives Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids 2-benzopyrans Carboxylic acid esters Hydrocarbon derivatives Lactones Monocarboxylic acids and derivatives Organic oxides Organooxygen compounds Oxacyclic compounds Vinylogous acids 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid 2-benzopyran Aromatic heteropolycyclic compound Benzopyran Carboxylic acid derivative Carboxylic acid ester Dihydroxybenzoic acid Hydrocarbon derivative Isochromane Lactone Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Vinylogous acid a small molecule logp 1.64 ALOGPS logs -1.57 ALOGPS solubility 5.18e+00 g/l ALOGPS melting_point Mp 214-217° logp 2.28 ChemAxon pka_strongest_acidic 8.51 ChemAxon pka_strongest_basic -4 ChemAxon iupac 6,8-dihydroxy-3-methyl-3,4-dihydro-1H-2-benzopyran-1-one ChemAxon average_mass 194.184 ChemAxon mono_mass 194.057908808 ChemAxon smiles CC1CC2=C(C(O)=CC(O)=C2)C(=O)O1 ChemAxon formula C10H10O4 ChemAxon inchi InChI=1S/C10H10O4/c1-5-2-6-3-7(11)4-8(12)9(6)10(13)14-5/h3-5,11-12H,2H2,1H3 ChemAxon inchikey DHLPMLVSBRRUGA-UHFFFAOYSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 49.77 ChemAxon polarizability 19.01 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 48729 Specdb::MsMs 48730 Specdb::MsMs 48731 Specdb::MsMs 151293 Specdb::MsMs 151294 Specdb::MsMs 151295 Specdb::MsMs 3606272 Specdb::MsMs 3606273 Specdb::MsMs 3606274 Specdb::MsMs 3606275 Specdb::MsMs 3606276 Specdb::MsMs 3606277 Carrot Type 1 specific Daucus carota ssp. sativus 79200 Wild carrot Type 1 specific Daucus carota 4039