1.0 2010-04-08 22:15:44 UTC 2019-11-26 03:20:27 UTC FDB021491 Avenanthramide G Stress metabolite in oats (Avena sativa) induced by Victorin M <ht>JTT63-H</ht>. Avenanthramide G is found in oat and cereals and cereal products. 4-Hydroxy-N-(4-hydroxycinnamoyl)anthranilic acid Avenanthramide G C16H13NO5 299.2781 299.079372531 4-hydroxy-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enamido]benzoic acid 4-hydroxy-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enamido]benzoic acid OC(=O)C1=CC=C(O)C=C1NC(=O)\C=C\C1=CC=C(O)C=C1 InChI=1S/C16H13NO5/c18-11-4-1-10(2-5-11)3-8-15(20)17-14-9-12(19)6-7-13(14)16(21)22/h1-9,18-19H,(H,17,20)(H,21,22)/b8-3+ QSUPRDNLJSCNSD-FPYGCLRLSA-N belongs to the class of organic compounds known as avenanthramides. These are a group of phenolic alkaloids consisting of conjugate of three phenylpropanoids (ferulic, caffeic, or p-coumaric acid) and anthranilic acid. Avenanthramides Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Acylaminobenzoic acid and derivatives Anilides Benzoic acids Benzoyl derivatives Carbonyl compounds Carboxylic acids Coumaric acids and derivatives Hydrocarbon derivatives Hydroxybenzoic acid derivatives Monocarboxylic acids and derivatives N-arylamides N-cinnamoylanthranilic acids Organic oxides Organopnictogen compounds Secondary carboxylic acid amides Styrenes Vinylogous amides 1-hydroxy-2-unsubstituted benzenoid Acylaminobenzoic acid or derivatives Anilide Aromatic homomonocyclic compound Avenanthramide Benzenoid Benzoic acid Benzoic acid or derivatives Benzoyl Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Cinnamic acid amide Coumaric acid or derivatives Hydrocarbon derivative Hydroxybenzoic acid Monocarboxylic acid or derivatives Monocyclic benzene moiety N-arylamide N-cinnamoylanthranilic acid Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenol Secondary carboxylic acid amide Styrene Vinylogous amide logp 2.97 ALOGPS logs -3.82 ALOGPS solubility 4.51e-02 g/l ALOGPS melting_point Mp 290-291° logp 3.27 ChemAxon pka_strongest_acidic 3.87 ChemAxon pka_strongest_basic -2.1 ChemAxon iupac 4-hydroxy-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enamido]benzoic acid ChemAxon average_mass 299.2781 ChemAxon mono_mass 299.079372531 ChemAxon smiles OC(=O)C1=CC=C(O)C=C1NC(=O)\C=C\C1=CC=C(O)C=C1 ChemAxon formula C16H13NO5 ChemAxon inchi InChI=1S/C16H13NO5/c18-11-4-1-10(2-5-11)3-8-15(20)17-14-9-12(19)6-7-13(14)16(21)22/h1-9,18-19H,(H,17,20)(H,21,22)/b8-3+ ChemAxon inchikey QSUPRDNLJSCNSD-FPYGCLRLSA-N ChemAxon polar_surface_area 106.86 ChemAxon refractivity 82.56 ChemAxon polarizability 30.13 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 5 ChemAxon donor_count 4 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 21928 Specdb::CMs 47361 Specdb::CMs 162492 Specdb::MsMs 314698 Specdb::MsMs 314699 Specdb::MsMs 314700 Specdb::MsMs 360499 Specdb::MsMs 360500 Specdb::MsMs 360501 Specdb::MsMs 2670816 Specdb::MsMs 2670817 Specdb::MsMs 2670818 Specdb::MsMs 3010581 Specdb::MsMs 3010582 Specdb::MsMs 3010583 HMDB41516 #<Reference:0x000055ce330c91d8> Breakfast cereal Type 2 specific Cereals and cereal products Unknown generic Oat Type 1 specific Avena sativa 4498