1.0 2011-09-21 00:13:53 UTC 2025-11-19 02:41:40 UTC FDB022432 4-Phosphopantothenoylcysteine 4-Phosphopantothenoylcysteine (PPC) is an intermediate in the biosynthetic machinery (pathway) that converts pantothenate (vitamin B5) into coenzyme A (CoA). The enzyme Phosphopantothenoylcysteine decarboxylase catalyzes the decarboxylation of PPC to 4'-phosphopantetheine. Coenzyme A is the principal acyl carrier and is required for many synthetic and degradative reactions in intermediary metabolism, and is an essential cofactor in all living systems. (PMID: 15450493, 16371361, 14501115) [HMDB] (R)-4'-O-N-Pantothenoyl-L-cysteine (R)-4'-Opantothenoyl-L-cysteine (R)-4'-phospho-N-pantothenoyl-L-cysteine (R)-N-[N-[2-Hydroxy-3,3-dimethyl-1-oxo-4-(onooxy)butyl]-b-alanyl]-L-cysteine (R)-N-[N-[2-Hydroxy-3,3-dimethyl-1-oxo-4-(onooxy)butyl]-beta-alanyl]-L-cysteine (R)-N-[N-[2-hydroxy-3,3-dimethyl-1-oxo-4-(phosphonooxy)butyl]-b-alanyl]-L-Cysteine (R)-N-[N-[2-hydroxy-3,3-dimethyl-1-oxo-4-(phosphonooxy)butyl]-beta-alanyl]-L-Cysteine 4-P-N-pantothenoylcysteine 4'-O-N-Pantothenoylcysteine 4'-Opantothenoyl-L-cysteine 4'-Opantothenoylcysteine 4'-P-N-pantothenoylcysteine 4'-phospho-N-pantothenoylcysteine 4'-Phosphopantothenoyl-L-cysteine 4'-phosphopantothenoylcysteine N-((R)-4-Opantothenoyl)-L-cysteine N-((R)-4-phosphopantothenoyl)-L-cysteine N-((R)-4'-Opantothenoyl)-L-cysteine N-((R)-4'-phosphopantothenoyl)-L-cysteine N-[(R)-4'-Opantothenoyl]-L-cysteine Pantothenoylcysteine 4'-ate Pantothenoylcysteine 4'-phosphate C12H23N2O9PS 402.358 402.086187546 (2R)-2-{3-[(2R)-2-hydroxy-3-methyl-3-[(phosphonooxy)methyl]butanamido]propanamido}-3-sulfanylpropanoic acid (2R)-2-{3-[(2R)-2-hydroxy-3-methyl-3-[(phosphonooxy)methyl]butanamido]propanamido}-3-sulfanylpropanoic acid 7196-09-0 CC(C)(COP(O)(O)=O)[C@@H](O)C(=O)NCCC(=O)N[C@@H](CS)C(O)=O InChI=1S/C12H23N2O9PS/c1-12(2,6-23-24(20,21)22)9(16)10(17)13-4-3-8(15)14-7(5-25)11(18)19/h7,9,16,25H,3-6H2,1-2H3,(H,13,17)(H,14,15)(H,18,19)(H2,20,21,22)/t7-,9-/m0/s1 XQYALQVLCNHCFT-CBAPKCEASA-N belongs to the class of organic compounds known as hybrid peptides. Hybrid peptides are compounds containing at least two different types of amino acids (alpha, beta, gamma, delta) linked to each other through a peptide bond. Hybrid peptides Organic compounds Organic acids and derivatives Peptidomimetics Hybrid peptides Aliphatic acyclic compounds Alkylthiols Beta amino acids and derivatives Carbonyl compounds Carboxylic acids Cysteine and derivatives Hydrocarbon derivatives Monoalkyl phosphates Monocarboxylic acids and derivatives Monosaccharides N-acyl amines N-acyl-L-alpha-amino acids Organic oxides Organonitrogen compounds Organopnictogen compounds Secondary alcohols Secondary carboxylic acid amides Alcohol Aliphatic acyclic compound Alkyl phosphate Alkylthiol Alpha-amino acid or derivatives Beta amino acid or derivatives Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Cysteine or derivatives Fatty acyl Fatty amide Hybrid peptide Hydrocarbon derivative Monoalkyl phosphate Monocarboxylic acid or derivatives Monosaccharide N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine N-acyl-l-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organic phosphoric acid derivative Organonitrogen compound Organooxygen compound Organopnictogen compound Organosulfur compound Phosphoric acid ester Secondary alcohol Secondary carboxylic acid amide L-cysteine derivative Solid logp -0.88 ALOGPS logs -3.08 ALOGPS solubility 3.36e-01 g/l ALOGPS logp -2 ChemAxon pka_strongest_acidic 1.78 ChemAxon pka_strongest_basic -3.8 ChemAxon iupac (2R)-2-{3-[(2R)-2-hydroxy-3-methyl-3-[(phosphonooxy)methyl]butanamido]propanamido}-3-sulfanylpropanoic acid ChemAxon average_mass 402.358 ChemAxon mono_mass 402.086187546 ChemAxon smiles CC(C)(COP(O)(O)=O)[C@@H](O)C(=O)NCCC(=O)N[C@@H](CS)C(O)=O ChemAxon formula C12H23N2O9PS ChemAxon inchi InChI=1S/C12H23N2O9PS/c1-12(2,6-23-24(20,21)22)9(16)10(17)13-4-3-8(15)14-7(5-25)11(18)19/h7,9,16,25H,3-6H2,1-2H3,(H,13,17)(H,14,15)(H,18,19)(H2,20,21,22)/t7-,9-/m0/s1 ChemAxon inchikey XQYALQVLCNHCFT-CBAPKCEASA-N ChemAxon polar_surface_area 182.49 ChemAxon refractivity 87.41 ChemAxon polarizability 36.25 ChemAxon rotatable_bond_count 11 ChemAxon acceptor_count 8 ChemAxon donor_count 7 ChemAxon physiological_charge -3 ChemAxon formal_charge 0 ChemAxon Pantothenate and CoA Biosynthesis SMP00027 map00770 Specdb::CMs 3399 Specdb::CMs 37931 Specdb::CMs 157264 Specdb::NmrOneD 21242 Specdb::NmrOneD 21243 Specdb::NmrOneD 21244 Specdb::NmrOneD 21245 Specdb::NmrOneD 21246 Specdb::NmrOneD 21247 Specdb::NmrOneD 21248 Specdb::NmrOneD 21249 Specdb::NmrOneD 21250 Specdb::NmrOneD 21251 Specdb::NmrOneD 21252 Specdb::NmrOneD 21253 Specdb::NmrOneD 21254 Specdb::NmrOneD 21255 Specdb::NmrOneD 21256 Specdb::NmrOneD 21257 Specdb::NmrOneD 21258 Specdb::NmrOneD 21259 Specdb::NmrOneD 21260 Specdb::NmrOneD 21261 Specdb::MsMs 23054 Specdb::MsMs 23055 Specdb::MsMs 23056 Specdb::MsMs 29852 Specdb::MsMs 29853 Specdb::MsMs 29854 Specdb::MsMs 2842824 Specdb::MsMs 2842825 Specdb::MsMs 2842826 Specdb::MsMs 2866854 Specdb::MsMs 2866855 Specdb::MsMs 2866856 HMDB01117 15769 #<Reference:0x000055ce302ad218> #<Reference:0x000055ce302ad060> #<Reference:0x000055ce302acea8> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823 Pantothenate kinase 1 Q8TE04 PANK1 Pantothenate kinase 3 Q9H999 PANK3 Pantothenate kinase 4 Q9NVE7 PANK4 Phosphopantothenate--cysteine ligase Q9HAB8 PPCS