1.0 2011-09-21 00:16:17 UTC 2024-11-29 22:26:16 UTC FDB022582 Pyrroline hydroxycarboxylic acid Pyrroline hydroxycarboxylic acid is a metabolite identified in the urine of patients with type II hyperprolinemia. (OMIM 239510) The urinary excretion of Pyrroline hydroxycarboxylic acid increased in hyperprolinemic patients but not in healthy controls during oral loading of hydroxyproline and hydroxyproline-ornithine. (PMID: 533224) Hyperprolinemia type II (HP II) is a rare inherited metabolic disease due to the deficiency of pyroline-5-carboxylate dehydrogenase. It is generally believed to be a benign condition although some patients have neurological problems such as refractory convulsions. (PMID: 15214748) The oxidation of pyrroline-carboxylate generates glutamate and pyrroline-hydroxycarboxylate, a reaction catalyzed by hydroxyproline oxidase (PMID: 500817) [HMDB] 3-Hydroxy-L-1-pyrroline-5-carboxylate L-1-pyrroline 3-hydroxy-5-carboxylate L-1-Pyrroline-3-hydroxy-5-carboxylate L-Delta1-pyrroline 3-hydroxy-5-carboxylate pyrroline-hydroxy-carboxylate C5H7NO3 129.114 129.042593095 4-hydroxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid pyrroline-hydroxy-carboxylate 22573-88-2 OC1CC(N=C1)C(O)=O InChI=1S/C5H7NO3/c7-3-1-4(5(8)9)6-2-3/h2-4,7H,1H2,(H,8,9) WFOFKRKDDKGRIK-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. Alpha amino acids and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic heteromonocyclic compounds Azacyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Imines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Propargyl-type 1,3-dipolar organic compounds Pyrroline carboxylic acids Secondary alcohols Alcohol Aliphatic heteromonocyclic compound Alpha-amino acid or derivatives Azacycle Carbonyl group Carboxylic acid Hydrocarbon derivative Imine Monocarboxylic acid or derivatives Organic 1,3-dipolar compound Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Propargyl-type 1,3-dipolar organic compound Pyrroline Pyrroline carboxylic acid Pyrroline carboxylic acid or derivatives Secondary alcohol 1-pyrrolinecarboxylic acid Solid logp -1.10 ALOGPS logs -0.58 ALOGPS solubility 3.39e+01 g/l ALOGPS logp -1.5 ChemAxon pka_strongest_acidic 3.72 ChemAxon pka_strongest_basic 2.59 ChemAxon iupac 4-hydroxy-3,4-dihydro-2H-pyrrole-2-carboxylic acid ChemAxon average_mass 129.114 ChemAxon mono_mass 129.042593095 ChemAxon smiles OC1CC(N=C1)C(O)=O ChemAxon formula C5H7NO3 ChemAxon inchi InChI=1S/C5H7NO3/c7-3-1-4(5(8)9)6-2-3/h2-4,7H,1H2,(H,8,9) ChemAxon inchikey WFOFKRKDDKGRIK-UHFFFAOYSA-N ChemAxon polar_surface_area 69.89 ChemAxon refractivity 28.85 ChemAxon polarizability 11.6 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Arginine and Proline Metabolism SMP00020 map00330 Metabolism and Physiological Effects of Oxalic acid SMP0124875 Specdb::CMs 2714 Specdb::CMs 38042 Specdb::CMs 165574 Specdb::MsMs 1537 Specdb::MsMs 178719 Specdb::MsMs 178720 Specdb::MsMs 178721 Specdb::MsMs 181038 Specdb::MsMs 181039 Specdb::MsMs 181040 Specdb::MsMs 2398137 Specdb::MsMs 2398138 Specdb::MsMs 2398139 Specdb::MsMs 2536784 Specdb::MsMs 2536785 Specdb::MsMs 2536786 Specdb::NmrOneD 147570 Specdb::NmrOneD 147571 Specdb::NmrOneD 147572 Specdb::NmrOneD 147573 Specdb::NmrOneD 147574 Specdb::NmrOneD 147575 Specdb::NmrOneD 147576 Specdb::NmrOneD 147577 Specdb::NmrOneD 147578 Specdb::NmrOneD 147579 Specdb::NmrOneD 147580 Specdb::NmrOneD 147581 Specdb::NmrOneD 147582 Specdb::NmrOneD 147583 Specdb::NmrOneD 147584 Specdb::NmrOneD 147585 Specdb::NmrOneD 147586 Specdb::NmrOneD 147587 Specdb::NmrOneD 147588 Specdb::NmrOneD 147589 HMDB01369 #<Reference:0x000055ce31870780> #<Reference:0x000055ce318705c8> #<Reference:0x000055ce31870410> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823