1.0 2011-09-21 00:34:45 UTC 2015-07-21 06:57:52 UTC FDB023789 N4-Acetylcytidine N4-Acetylcytidine is a modified nucleoside. N4-acetylcytidine is an endogenous urinary nucleoside product of the degradation of transfer ribonucleic acid (tRNA); urinary nucleosides are biological markers for patients with colorectal cancer. tRNA has been shown to be excreted in abnormal amounts in the urine of cancer patients. tRNA from neoplastic tissue had a much more rapid turnover rate than the tRNA from the corresponding normal tissue. Evidence indicates that methylation of tRNA occurs only after synthesis of the intact macromolecule. Because there are no specific enzyme systems to incorporate the modified nucleosides into the macromolecular nucleic acid, these nucleosides once released in the process of tRNA turnover cannot be reutilized, nor are they further degraded, but are excreted in urine. (PMID: 15991285, 3506820) [HMDB] 4-Acetyl-1-(b-D-ribofuranosyl)cytosine 4-Acetyl-1-(beta-D-ribofuranosyl)cytosine 4-Acetyl-1-(beta-delta-ribofuranosyl)cytosine 4-Acetyl-1-(β-D-ribofuranosyl)cytosine 4-Acetylcytidine N-{1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-2-oxo-1,2-dihydropyrimidin-4-yl}acetamide N-4-Acetylcytidine n-acetyl-Cytidine N-acetylcytidine C11H15N3O6 285.2533 285.096085227 N-{1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-1,2-dihydropyrimidin-4-yl}acetamide N4-acetylcytidine 3768-18-1 CC(=O)NC1=NC(=O)N(C=C1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O InChI=1S/C11H15N3O6/c1-5(16)12-7-2-3-14(11(19)13-7)10-9(18)8(17)6(4-15)20-10/h2-3,6,8-10,15,17-18H,4H2,1H3,(H,12,13,16,19)/t6-,8-,9-,10-/m1/s1 NIDVTARKFBZMOT-PEBGCTIMSA-N belongs to the class of organic compounds known as pyrimidine nucleosides. Pyrimidine nucleosides are compounds comprising a pyrimidine base attached to a ribosyl or deoxyribosyl moiety. Pyrimidine nucleosides Organic compounds Nucleosides, nucleotides, and analogues Pyrimidine nucleosides Aromatic heteromonocyclic compounds Azacyclic compounds Carboximidic acids Glycosylamines Heteroaromatic compounds Hydrocarbon derivatives Hydropyrimidines Organic oxides Organonitrogen compounds Organopnictogen compounds Oxacyclic compounds Pentoses Primary alcohols Propargyl-type 1,3-dipolar organic compounds Pyrimidones Secondary alcohols Tetrahydrofurans Alcohol Aromatic heteromonocyclic compound Azacycle Carboximidic acid Carboximidic acid derivative Glycosyl compound Heteroaromatic compound Hydrocarbon derivative Hydropyrimidine Monosaccharide N-glycosyl compound Organic 1,3-dipolar compound Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Pentose monosaccharide Primary alcohol Propargyl-type 1,3-dipolar organic compound Pyrimidine Pyrimidine nucleoside Pyrimidone Secondary alcohol Tetrahydrofuran acetamides cytidines Solid logp -1.35 ALOGPS logs -1.37 ALOGPS solubility 1.23e+01 g/l ALOGPS logp -2.9 ChemAxon pka_strongest_acidic 12.47 ChemAxon pka_strongest_basic -3 ChemAxon iupac N-{1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-1,2-dihydropyrimidin-4-yl}acetamide ChemAxon average_mass 285.2533 ChemAxon mono_mass 285.096085227 ChemAxon smiles CC(=O)NC1=NC(=O)N(C=C1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O ChemAxon formula C11H15N3O6 ChemAxon inchi InChI=1S/C11H15N3O6/c1-5(16)12-7-2-3-14(11(19)13-7)10-9(18)8(17)6(4-15)20-10/h2-3,6,8-10,15,17-18H,4H2,1H3,(H,12,13,16,19)/t6-,8-,9-,10-/m1/s1 ChemAxon inchikey NIDVTARKFBZMOT-PEBGCTIMSA-N ChemAxon polar_surface_area 131.69 ChemAxon refractivity 63.99 ChemAxon polarizability 27.16 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 7 ChemAxon donor_count 4 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 11198 Specdb::CMs 38920 Specdb::CMs 168449 Specdb::NmrOneD 61332 Specdb::NmrOneD 61333 Specdb::NmrOneD 61334 Specdb::NmrOneD 61335 Specdb::NmrOneD 61336 Specdb::NmrOneD 61337 Specdb::NmrOneD 61338 Specdb::NmrOneD 61339 Specdb::NmrOneD 61340 Specdb::NmrOneD 61341 Specdb::NmrOneD 61342 Specdb::NmrOneD 61343 Specdb::NmrOneD 61344 Specdb::NmrOneD 61345 Specdb::NmrOneD 61346 Specdb::NmrOneD 61347 Specdb::NmrOneD 61348 Specdb::NmrOneD 61349 Specdb::NmrOneD 61350 Specdb::NmrOneD 61351 Specdb::MsMs 91437 Specdb::MsMs 91438 Specdb::MsMs 91439 Specdb::MsMs 154821 Specdb::MsMs 154822 Specdb::MsMs 154823 Specdb::MsMs 2244768 Specdb::MsMs 2245324 Specdb::MsMs 2842896 Specdb::MsMs 2842897 Specdb::MsMs 2842898 Specdb::MsMs 2865555 Specdb::MsMs 2865556 Specdb::MsMs 2865557 HMDB05923 #<Reference:0x000055ce33091e90> #<Reference:0x000055ce33091cd8> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823