1.0 2011-09-21 01:46:36 UTC 2015-07-21 06:59:33 UTC FDB028876 Glutarate semialdehyde In the lysine degradation IV pathway, glutarate semialdehyde reacts with NADP+ and H2O to produce glutarate, NADPH, and H+. In this pathway, glutarate semialdehyde is produced by the reaction between 5-aminopentanoate and 2-ketoglutarate, with L-glutamate as a byproduct. The enzyme responsible for this reaction is 5-aminovalerate aminotransferase. In the lysine degradation III pathway, glutarate semialdehyde reacts with NAD+ and H2O to produce glutarate and NADH. In this pathway, glutarate semialdehyde is produced by the reaction between 5-aminopentanoate and 2-ketoglutarate, with L-glutamate as a byproduct. The enzyme responsible for this reaction is 5-aminovalerate aminotransferase. [HMDB] 2-Formylethylacetate 2-Formylethylacetic acid 4-Formylbutyrate 4-Formylbutyric acid 5-oxo-pentanoate 5-oxo-pentanoic acid 5-oxo-Valerate 5-oxo-Valeriansaeure 5-oxo-Valeric acid 5-Oxopentanoate 5-oxopentanoic acid 5-Oxovalerate 5-oxovaleric acid Glutaric acid semialdehyde C5H8O3 116.1152 116.047344122 5-oxopentanoic acid 5-oxopentanoic acid 5746-02-1 OC(=O)CCCC=O InChI=1S/C5H8O3/c6-4-2-1-3-5(7)8/h4H,1-3H2,(H,7,8) VBKPPDYGFUZOAJ-UHFFFAOYSA-N belongs to the class of organic compounds known as straight chain fatty acids. These are fatty acids with a straight aliphatic chain. Straight chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Alpha-hydrogen aldehydes Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aldehyde Aliphatic acyclic compound Alpha-hydrogen aldehyde Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Oxo fatty acids aldehydic acid omega-oxo fatty acid oxopentanoic acid Solid logp -0.07 ALOGPS logs -0.05 ALOGPS solubility 1.03e+02 g/l ALOGPS logp -0.11 ChemAxon pka_strongest_acidic 4.33 ChemAxon pka_strongest_basic -6.9 ChemAxon iupac 5-oxopentanoic acid ChemAxon average_mass 116.1152 ChemAxon mono_mass 116.047344122 ChemAxon smiles OC(=O)CCCC=O ChemAxon formula C5H8O3 ChemAxon inchi InChI=1S/C5H8O3/c6-4-2-1-3-5(7)8/h4H,1-3H2,(H,7,8) ChemAxon inchikey VBKPPDYGFUZOAJ-UHFFFAOYSA-N ChemAxon polar_surface_area 54.37 ChemAxon refractivity 27.21 ChemAxon polarizability 11.26 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsIr 2717 Specdb::MsIr 2718 Specdb::MsIr 2719 Specdb::CMs 17718 Specdb::CMs 39877 Specdb::CMs 156344 Specdb::NmrOneD 11642 Specdb::NmrOneD 11643 Specdb::NmrOneD 11644 Specdb::NmrOneD 11645 Specdb::NmrOneD 11646 Specdb::NmrOneD 11647 Specdb::NmrOneD 11648 Specdb::NmrOneD 11649 Specdb::NmrOneD 11650 Specdb::NmrOneD 11651 Specdb::NmrOneD 11652 Specdb::NmrOneD 11653 Specdb::NmrOneD 11654 Specdb::NmrOneD 11655 Specdb::NmrOneD 11656 Specdb::NmrOneD 11657 Specdb::NmrOneD 11658 Specdb::NmrOneD 11659 Specdb::NmrOneD 11660 Specdb::NmrOneD 11661 Specdb::MsMs 305221 Specdb::MsMs 305222 Specdb::MsMs 305223 Specdb::MsMs 348580 Specdb::MsMs 348581 Specdb::MsMs 348582 Specdb::MsMs 2412601 Specdb::MsMs 2412602 Specdb::MsMs 2412603 Specdb::MsMs 2549688 Specdb::MsMs 2549689 Specdb::MsMs 2549690 HMDB12233 39153 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823