1.0 2010-04-08 22:06:54 UTC 2025-11-18 23:00:29 UTC FDB005931 Pretazettine Pretazettine, also known as pretazettine hydrochloride, (6abeta,8beta)-isomer, is a member of the class of compounds known as tazettine-type amaryllidaceae alkaloids. Tazettine-type amaryllidaceae alkaloids are amaryllidaceae alkaloids derived from the haemanthamine-type alkaloids, which are characterized as a linkage between C6 and C11 by an oxygen atom to form a [3,4-g]benzopyran framework. Pretazettine is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Pretazettine can be found in lovage, which makes pretazettine a potential biomarker for the consumption of this food product. Pretazettine Pretazzetine hydrochloride Tazettine, 6a-deoxy-8-hydroxy-, (6abeta,8beta)- C18H21NO5 331.363 331.141972787 (1S,11R,13R,16S,18S)-18-methoxy-15-methyl-5,7,12-trioxa-15-azapentacyclo[11.7.0.0¹,¹⁶.0²,¹⁰.0⁴,⁸]icosa-2,4(8),9,19-tetraen-11-ol pretazettine 17322-84-8 CO[C@H]1C[C@@H]2N(C)C[C@@H]3O[C@@H](O)C4=CC5=C(OCO5)C=C4[C@@]23C=C1 InChI=1S/C18H21NO5/c1-19-8-16-18(4-3-10(21-2)5-15(18)19)12-7-14-13(22-9-23-14)6-11(12)17(20)24-16/h3-4,6-7,10,15-17,20H,5,8-9H2,1-2H3/t10-,15+,16+,17-,18+/m1/s1 KLJOYDMUWKSYBP-YNBLHMCPSA-N belongs to the class of organic compounds known as tazettine-type amaryllidaceae alkaloids. These are amaryllidaceae alkaloids derived from the haemanthamine-type alkaloids, which are characterized as a linkage between C6 and C11 by an oxygen atom to form a [3,4-g]benzopyran framework. Tazettine-type amaryllidaceae alkaloids Organic compounds Alkaloids and derivatives Amaryllidaceae alkaloids Tazettine-type amaryllidaceae alkaloids Aromatic heteropolycyclic compounds 2-benzopyrans Acetals Aralkylamines Azacyclic compounds Benzenoids Benzodioxoles Dialkyl ethers Hemiacetals Hydrocarbon derivatives Indoles and derivatives N-alkylpyrrolidines Organopnictogen compounds Oxacyclic compounds Trialkylamines 2-benzopyran Acetal Amine Aralkylamine Aromatic heteropolycyclic compound Azacycle Benzenoid Benzodioxole Benzopyran Dialkyl ether Ether Hemiacetal Hydrocarbon derivative Indole or derivatives Isochromane N-alkylpyrrolidine Organic nitrogen compound Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Pyrrolidine Tazettine alkaloid skeleton Tertiary aliphatic amine Tertiary amine alkaloid logp 0.73 ALOGPS logs -2.13 ALOGPS solubility 2.46e+00 g/l ALOGPS logp 1.1 ChemAxon pka_strongest_acidic 11.54 ChemAxon pka_strongest_basic 7.71 ChemAxon iupac (1S,11R,13R,16S,18S)-18-methoxy-15-methyl-5,7,12-trioxa-15-azapentacyclo[11.7.0.0¹,¹⁶.0²,¹⁰.0⁴,⁸]icosa-2,4(8),9,19-tetraen-11-ol ChemAxon average_mass 331.363 ChemAxon mono_mass 331.141972787 ChemAxon smiles CO[C@H]1C[C@@H]2N(C)C[C@@H]3O[C@@H](O)C4=CC5=C(OCO5)C=C4[C@@]23C=C1 ChemAxon formula C18H21NO5 ChemAxon inchi InChI=1S/C18H21NO5/c1-19-8-16-18(4-3-10(21-2)5-15(18)19)12-7-14-13(22-9-23-14)6-11(12)17(20)24-16/h3-4,6-7,10,15-17,20H,5,8-9H2,1-2H3/t10-,15+,16+,17-,18+/m1/s1 ChemAxon inchikey KLJOYDMUWKSYBP-YNBLHMCPSA-N ChemAxon polar_surface_area 60.39 ChemAxon refractivity 86.89 ChemAxon polarizability 34.52 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 6 ChemAxon donor_count 1 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 54378 Specdb::MsMs 54379 Specdb::MsMs 54380 Specdb::MsMs 118731 Specdb::MsMs 118732 Specdb::MsMs 118733 Specdb::MsMs 3602324 Specdb::MsMs 3602325 Specdb::MsMs 3602326 Specdb::MsMs 3602327 Specdb::MsMs 3602328 Specdb::MsMs 3602329 Lovage Type 1 specific Levisticum officinale 48042 Anti leukemic 393 A substance that inhibits or prevents the proliferation of neoplasms. Anti-proteinigenic 555 Anti-viral 689 A substance that destroys or inhibits replication of viruses. Antitumor 672 A substance that inhibits or prevents the proliferation of neoplasms. HIV-reverse-transcriptase inhibitor 994 A compound or agent that combines with an enzyme in such a manner as to prevent the normal substrate-enzyme combination and the catalytic reaction.