1.0 2010-04-08 22:07:47 UTC 2025-11-18 23:05:37 UTC FDB007821 Perillene Perillene, also known as perillen, belongs to the class of organic compounds known as monoterpenes. Monoterpenoids are terpenes that contain 10 carbon atoms and are comprised of two isoprene units. The biosynthesis of monoterpenes is known to occur mainly through the methyl-erythritol-phosphate (MEP) pathway in plant cell plastids (PMID: 7640522). Geranyl diphosphate (GPP) is a key intermediate in the biosynthesis of cyclic monoterpenes. GPP undergoes several cyclization reactions to yield a diverse number of cyclic arrangements. Perillene also belongs to the class of organic compounds known as tetrahydrofurans. These are heterocyclic compounds containing a saturated, aliphatic, five-membered ring where a carbon is replaced by an oxygen. Perillene is a neutral, hydrophobic molecule that is insoluble in water. Perillene exists as a clear, colorless oil and has a woody, flowery, citrus aroma or taste. Perillene has been found in several plants and spices including ginger and oregano. It has also been found in the essential oils of other plants, such as Perilla ocimoides (PMID: 17269047), Kenyan Valencia (Citrus sinensis), Australian finger lime (Citrus australasica) peel oil, Neroli (Citrus aurantium) (PMID: 30723488) and Boswellia sacra (PMID: 18830149). 3-(4-Methyl-3-pentenyl)-furan (perillene) 3-(4-Methyl-3-pentenyl)furan Furan, 3-(4-methyl-3-pentenyl)- Perillen C10H14O 150.2176 150.10446507 3-(4-methylpent-3-en-1-yl)furan 3-(4-methylpent-3-en-1-yl)furan 539-52-6 CC(C)=CCCC1=COC=C1 InChI=1S/C10H14O/c1-9(2)4-3-5-10-6-7-11-8-10/h4,6-8H,3,5H2,1-2H3 XNGKCOFXDHYSGR-UHFFFAOYSA-N belongs to the class of organic compounds known as heteroaromatic compounds. Heteroaromatic compounds are compounds containing an aromatic ring where a carbon atom is linked to an hetero atom. Heteroaromatic compounds Organic compounds Organoheterocyclic compounds Heteroaromatic compounds Aromatic heteromonocyclic compounds Furans Hydrocarbon derivatives Organooxygen compounds Oxacyclic compounds Aromatic heteromonocyclic compound Furan Heteroaromatic compound Hydrocarbon derivative Organic oxygen compound Organooxygen compound Oxacycle furans monoterpenoid logp 3.78 ALOGPS logs -3.13 ALOGPS solubility 1.11e-01 g/l ALOGPS logp 3.29 ChemAxon pka_strongest_basic -2.8 ChemAxon iupac 3-(4-methylpent-3-en-1-yl)furan ChemAxon average_mass 150.2176 ChemAxon mono_mass 150.10446507 ChemAxon smiles CC(C)=CCCC1=COC=C1 ChemAxon formula C10H14O ChemAxon inchi InChI=1S/C10H14O/c1-9(2)4-3-5-10-6-7-11-8-10/h4,6-8H,3,5H2,1-2H3 ChemAxon inchikey XNGKCOFXDHYSGR-UHFFFAOYSA-N ChemAxon polar_surface_area 13.14 ChemAxon refractivity 47.42 ChemAxon polarizability 18.01 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 35681 Specdb::MsMs 59637 Specdb::MsMs 59638 Specdb::MsMs 59639 Specdb::MsMs 115818 Specdb::MsMs 115819 Specdb::MsMs 115820 Common oregano Type 1 specific Origanum vulgare 39352 0.02 0.02 0.02 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 4.8 4.8 4.8 mg/100 g wood woody