1.0 2010-04-08 22:09:57 UTC 2019-11-26 03:05:58 UTC FDB012019 beta-Cryptoxanthin Isolated from papaya (Carica papaya) and many other higher plants, also from fish eggs [DFC]. beta-Cryptoxanthin is found in many foods, some of which are smelt, soy yogurt, common carp, and rose hip. 3-Hydroxy-b-carotene b-Krypoxanthin b,b-Caroten-3-ol Caricaxanthin Cryptoxanthin Cryptoxanthol Neocryptoxanthin C40H56O 552.872 552.433116414 3,5,5-trimethyl-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohex-1-en-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl]cyclohex-3-en-1-ol 3,5,5-trimethyl-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohex-1-en-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl]cyclohex-3-en-1-ol 472-70-8 C\C(\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C)CC(O)CC1(C)C InChI=1S/C40H56O/c1-30(18-13-20-32(3)23-25-37-34(5)22-15-27-39(37,7)8)16-11-12-17-31(2)19-14-21-33(4)24-26-38-35(6)28-36(41)29-40(38,9)10/h11-14,16-21,23-26,36,41H,15,22,27-29H2,1-10H3/b12-11+,18-13+,19-14+,25-23+,26-24+,30-16+,31-17+,32-20+,33-21+ DMASLKHVQRHNES-QQGJMDNJSA-N belongs to the class of organic compounds known as xanthophylls. These are carotenoids containing an oxygenated carotene backbone. Carotenes are characterized by the presence of two end-groups (mostly cyclohexene rings, but also cyclopentene rings or acyclic groups) linked by a long branched alkyl chain. Carotenes belonging form a subgroup of the carotenoids family. Xanthophylls arise by oxygenation of the carotene backbone. Xanthophylls Organic compounds Lipids and lipid-like molecules Prenol lipids Tetraterpenoids Aliphatic homomonocyclic compounds Hydrocarbon derivatives Secondary alcohols Alcohol Aliphatic homomonocyclic compound Hydrocarbon derivative Organic oxygen compound Organooxygen compound Secondary alcohol Xanthophyll logp 9.08 ALOGPS logs -6.04 ALOGPS solubility 5.03e-04 g/l ALOGPS melting_point Mp 172-173° (169°) logp 9.74 ChemAxon pka_strongest_acidic 18.91 ChemAxon pka_strongest_basic -1.1 ChemAxon iupac 3,5,5-trimethyl-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohex-1-en-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl]cyclohex-3-en-1-ol ChemAxon average_mass 552.872 ChemAxon mono_mass 552.433116414 ChemAxon smiles C\C(\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C)CC(O)CC1(C)C ChemAxon formula C40H56O ChemAxon inchi InChI=1S/C40H56O/c1-30(18-13-20-32(3)23-25-37-34(5)22-15-27-39(37,7)8)16-11-12-17-31(2)19-14-21-33(4)24-26-38-35(6)28-36(41)29-40(38,9)10/h11-14,16-21,23-26,36,41H,15,22,27-29H2,1-10H3/b12-11+,18-13+,19-14+,25-23+,26-24+,30-16+,31-17+,32-20+,33-21+ ChemAxon inchikey DMASLKHVQRHNES-QQGJMDNJSA-N ChemAxon polar_surface_area 20.23 ChemAxon refractivity 193.28 ChemAxon polarizability 72.71 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 12695 Specdb::CMs 43535 Specdb::MsMs 96468 Specdb::MsMs 96469 Specdb::MsMs 96470 Specdb::MsMs 160947 Specdb::MsMs 160948 Specdb::MsMs 160949 HMDB33844 #<Reference:0x000055ce3170bd18> #<Reference:0x000055ce3170bb10> #<Reference:0x000055ce3170b8e0> #<Reference:0x000055ce3170b700> #<Reference:0x000055ce3170b548> #<Reference:0x000055ce3170b368> #<Reference:0x000055ce3170b160> #<Reference:0x000055ce3170af80> #<Reference:0x000055ce3170ad78> Abalone Type 1 specific Haliotis 6452 0.0 0.0 0.0 mg/100 g Acerola Type 1 specific Malpighia emarginata 151847 0.0 0.0 0.0 mg/100 g Acorn squash Type 1 Cucurbita pepo var. turbinata 0.0 0.0 0.0 mg/100 g Adobo Type 2 specific 0.006 0.006 0.006 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Agave Type 1 specific Agave 39509 0.0 0.0 0.0 mg/100 g Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 0.0 0.0 0.0 mg/100 g Alaska pollock Type 1 specific Theragra chalcogramma 1042646 0.0 0.0 0.0 mg/100 g Albacore tuna Type 1 specific Thunnus alalunga 8235 0.0 0.0 0.0 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 3.003 6.0 0.006 mg/100 g Allium Type 1 specific Allium 4678 0.0 0.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.75 9.0 0.0 mg/100 g Almond milk Type 1 0.0 0.0 0.0 mg/100 g Amaranth Type 1 specific Amaranthus 3564 0.0 0.0 0.0 mg/100 g American cranberry Type 1 specific Vaccinium macrocarpon 13750 0.0 0.0 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.0 0.0 0.0 mg/100 g American pokeweed Type 1 specific Phytolacca americana 3527 0.0 0.0 0.0 mg/100 g American shad Type 1 specific Alosa sapidissima 34773 0.0 0.0 0.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 0.0 0.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.0 0.0 0.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 0.0 0.0 0.0 mg/100 g Apple Type 1 specific Malus pumila 283210 0.155235 2.5 0.0 mg/100 g Apple cider Type 2 specific 0.0 0.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 8.72275 104.5 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 0.0 0.0 0.0 mg/100 g Arepa Type 2 specific 0.0 0.0 0.0 mg/100 g Arrowroot Type 1 specific Maranta arundinacea 210060 0.0 0.0 0.0 mg/100 g Asian pear Type 1 specific Pyrus pyrifolia 3767 0.0 0.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 0.0 0.0 0.0 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 0.0 0.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0 0.0 0.0 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 0.0 0.0 0.0 mg/100 g Atlantic mackerel Type 1 specific Scomber scombrus 13677 0.0 0.0 0.0 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 12.042 60.0 0.027 mg/100 g Babassu palm Type 1 specific Attalea speciosa 145700 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 0.00527 0.135 0.0 mg/100 g Bagel Type 2 specific 0.000667 0.002 0.0 mg/100 g Baked beans Type 2 specific 0.0 0.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.0 0.0 0.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.0 0.0 0.0 mg/100 g Bean Type 1 specific 0.0 0.0 0.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 0.0 0.0 0.0 mg/100 g Beefalo Type 1 specific Bos taurus X Bison bison 297284 Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 0.00078 0.018 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 0.0 0.0 0.0 mg/100 g Bitter gourd Type 1 specific Momordica charantia 3673 0.0 0.0 0.0 mg/100 g Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 0.0 0.0 0.0 mg/100 g Black cabbage Type 1 specific Brassica oleracea var. viridis 3713 0.0352 0.08 0.02 mg/100 g Black mulberry Type 1 specific Morus nigra 85232 0.0 0.0 0.0 mg/100 g Black raisin Type 1 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 0.0 0.0 0.0 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 0.0 0.0 0.0 mg/100 g Blue cheese Type 2 0.0 0.0 0.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 0.0 0.0 0.0 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 0.0 0.0 0.0 mg/100 g Boysenberry Type 1 specific Rubus ursinus X idaeus 0.0 0.0 0.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 0.0 0.0 0.0 mg/100 g Breakfast cereal Type 2 specific 0.0013 0.066 0.0 mg/100 g Breakfast sandwich Type 2 specific 0.002538 0.007 0.0 mg/100 g Broad bean Type 1 specific Vicia faba 3906 0.00225 0.009 0.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.0007 0.001 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.0 0.0 0.0 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 Bulgur Type 2 specific 0.0 0.0 0.0 mg/100 g Burdock Type 1 specific Arctium lappa 4217 0.0 0.0 0.0 mg/100 g Burrito Type 2 specific 0.006333 0.025 0.0 mg/100 g Butter Type 2 specific 0.0 0.0 0.0 mg/100 g Butter substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Butterfat Type 2 specific 0.0 0.0 0.0 mg/100 g Buttermilk Type 2 specific 0.0 0.0 0.0 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 696.4534 3471.0 1.564 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.0 0.0 0.0 mg/100 g Cake Type 2 specific 0.00044 0.002 0.0 mg/100 g Candy bar Type 2 specific 0.0 0.0 0.0 mg/100 g Canola Type 2 specific 138011 0.0 0.0 0.0 mg/100 g Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 0.0 0.0 0.0 mg/100 g Capers Type 1 specific Capparis spinosa 65558 0.0 0.0 0.0 mg/100 g Caraway Type 1 specific Carum carvi 48032 0.008 0.016 0.0 mg/100 g Carob Type 1 specific Ceratonia siliqua 20340 0.0 0.0 0.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.041692 0.199 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 0.0 0.0 0.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.0 0.0 0.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 0.000122 0.021 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.0 0.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 0.0 0.0 0.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.0 0.0 0.0 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 0.000083 0.002 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.2505 0.5 0.001 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 Chickpea Type 1 specific Cicer arietinum 3827 0.0 0.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.0 0.0 0.0 mg/100 g Chili Type 2 specific 0.05025 0.085 0.0 mg/100 g Chinese broccoli Type 1 specific Brassica alboglabra 3714 0.0 0.0 0.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.0 0.0 0.0 mg/100 g Chinese chives Type 1 specific Allium tuberosum 4683 0.0 0.0 0.0 mg/100 g Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 0.129 0.129 0.129 mg/100 g Chinese mustard Type 1 specific Brassica juncea 3707 0.0 0.0 0.0 mg/100 g Chinese water chestnut Type 1 specific Eleocharis dulcis 110284 0.0 0.0 0.0 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 0.0 0.0 0.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.0 0.0 0.0 mg/100 g Chocolate Type 2 specific 0.0006 0.001 0.0 mg/100 g Chocolate mousse Type 2 specific 0.003 0.003 0.003 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 0.0 0.0 0.0 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 129.0 129.0 129.0 mg/100 g Cisco Type 1 specific Coregonus artedi 36181 0.0 0.0 0.0 mg/100 g Clam Type 1 0.0 0.0 0.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.0 0.0 0.0 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 51.5515 103.0 0.103 mg/100 g Cocktail Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.0 0.0 0.0 mg/100 g Coconut milk Type 1 0.0 0.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 0.0 0.0 0.0 mg/100 g Coffee mocha Type 2 specific 0.0 0.0 0.0 mg/100 g Coffee substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 0.0 0.0 0.0 mg/100 g Cold cut Type 2 specific 0.0 0.0 0.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 0.0 0.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 0.001043 0.024 0.0 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 0.0 0.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.0 0.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.0 0.0 0.0 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 0.0 0.0 0.0 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 0.0095 0.019 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 0.002 0.009 0.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.0 0.0 0.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 2.7535 5.5 0.007 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.002605 0.0495 0.0 mg/100 g Common sage Type 1 specific Salvia officinalis 38868 0.109 0.109 0.109 mg/100 g Common salsify Type 1 specific Tragopogon porrifolius 13731 0.0 0.0 0.0 mg/100 g Common thyme Type 1 specific Thymus vulgaris 49992 16.5165 33.0 0.033 mg/100 g Common walnut Type 1 specific Juglans regia 51240 0.0 0.0 0.0 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 0.0 0.0 0.0 mg/100 g Conch Type 1 specific Strombidae 69694 0.0 0.0 0.0 mg/100 g Condensed milk Type 2 specific 0.0 0.0 0.0 mg/100 g Cooking oil Type 2 specific 0.0 0.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 82.292333 246.5 0.175 mg/100 g Corn Type 1 specific Zea mays 4577 0.02419 0.161 0.0 mg/100 g Corn chip Type 2 specific 0.0 0.0 0.0 mg/100 g Corn grits Type 2 specific 0.000308 0.001 0.0 mg/100 g Cornbread Type 2 specific 0.0 0.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Cottonseed oil Type 2 0.0 0.0 0.0 mg/100 g Couscous Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 0.0 0.0 0.0 mg/100 g Cracker Type 2 specific 0.001542 0.017 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 0.0 0.0 0.0 mg/100 g Cream substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Crisp bread Type 2 specific 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 2.967333 26.0 0.018 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 0.140167 2.145 0.0 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 0.0 0.0 0.0 mg/100 g Cupuaçu Type 1 specific Theobroma grandiflorum 108881 0.0 0.0 0.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.0 0.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 30.30075 121.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.0 0.0 0.0 mg/100 g Deer Type 1 specific Cervidae 9850 0.0 0.0 0.0 mg/100 g Dessert wine Type 2 0.0 0.0 0.0 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 0.0 0.0 0.0 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 0.000064 0.019 0.0 mg/100 g Dried milk Type 2 specific 0.0 0.0 0.0 mg/100 g Dripping Type 2 specific 0.0 0.0 0.0 mg/100 g Dulce de leche Type 2 specific 0.0 0.0 0.0 mg/100 g Durian Type 1 specific Durio zibethinus 66656 0.0 0.0 0.0 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 0.0 0.0 0.0 mg/100 g Edible shell Type 2 specific 0.013 0.013 0.013 mg/100 g Egg roll Type 2 specific 0.0 0.0 0.0 mg/100 g Egg substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.0 0.0 0.0 mg/100 g Eggs Unknown generic 0.194818 4.0 0.0 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 0.0 0.0 0.0 mg/100 g Empanada Type 2 specific 0.033 0.033 0.033 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 0.0 0.0 0.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g Energy drink Type 2 specific 0.0 0.0 0.0 mg/100 g European anchovy Type 1 specific Engraulis encrasicolus 184585 0.0 0.0 0.0 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 0.0 0.0 0.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.061 0.157 0.0 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 Evaporated milk Type 2 specific 0.0 0.0 0.0 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 1.5015 3.0 0.003 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 0.0 0.0 0.0 mg/100 g Fig Type 1 specific Ficus carica 3494 0.0 0.0 0.0 mg/100 g Fishes Unknown generic Flatfish Type 1 specific Pleuronectiformes 8252 0.0 0.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.0 0.0 0.0 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 0.0 0.0 0.0 mg/100 g Focaccia Type 2 specific 0.0 0.0 0.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 0.00325 0.011 0.0 mg/100 g French toast Type 2 specific 0.0 0.0 0.0 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 0.0 0.0 0.0 mg/100 g Frozen yogurt Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0194 0.098 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit salad Type 2 specific 0.055333 0.096 0.039 mg/100 g Fruit-flavor drink Type 2 specific 0.0043 0.062 0.0 mg/100 g Fruits Unknown generic Fudge Type 2 specific 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.0 0.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 0.0 0.0 0.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 0.0 0.0 0.0 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.0 0.0 0.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 0.0 0.0 0.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0 0.0 0.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 0.0 0.0 0.0 mg/100 g Garland chrysanthemum Type 1 specific Chrysanthemum coronarium 99038 6.006 24.0 0.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 0.0 0.0 0.0 mg/100 g Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.0 0.0 0.0 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gram bean Type 1 specific Vigna mungo 3915 0.0 0.0 0.0 mg/100 g Grape Type 1 specific Vitis 3603 0.0 0.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.002 0.006 0.0 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 15.0 15.0 15.0 mg/100 g Grapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Greater sturgeon Type 1 specific Acipenser 7901 0.0 0.0 0.0 mg/100 g Greek feta cheese Type 2 0.0 0.0 0.0 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 0.0048 0.024 0.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 0.117143 0.49 0.007 mg/100 g Green cabbage Type 1 Brassica oleracea var. sabauda L. 0.0 0.0 0.0 mg/100 g Green lentil Type 1 Lens culinaris 0.0 0.0 0.0 mg/100 g Green plum Type 1 29.5 29.5 29.5 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green turtle Type 1 specific Chelonia mydas 8469 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.0 0.0 0.0 mg/100 g Greylag goose Type 1 specific Anser anser 8843 Guava Type 1 specific Psidium guajava 120290 0.002 0.008 0.0 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.0 0.0 0.0 mg/100 g Hamburger Type 2 specific 0.001818 0.003 0.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 0.0 0.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 0.0 0.0 0.0 mg/100 g Heart of palm Type 1 specific 0.0 0.0 0.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 0.0 0.0 0.0 mg/100 g Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.0 0.0 0.0 mg/100 g Honey Type 2 specific 0.0 0.0 0.0 mg/100 g Horchata Type 2 specific 0.0 0.0 0.0 mg/100 g Horse Type 1 specific Equus caballus 9796 Horseradish Type 1 specific Armoracia rusticana 3704 0.0 0.0 0.0 mg/100 g Horseradish tree Type 1 specific Moringa oleifera 3735 0.0 0.0 0.0 mg/100 g Hot chocolate Type 2 specific 0.0 0.0 0.0 mg/100 g Hummus Type 2 specific 0.002 0.002 0.002 mg/100 g Hushpuppy Type 2 specific 0.001 0.001 0.001 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 0.0 0.0 0.0 mg/100 g Ice cream Type 2 specific 0.00055 0.005 0.0 mg/100 g Ice cream cone Type 2 specific 0.0 0.0 0.0 mg/100 g Iceberg lettuce Type 1 0.0 0.0 0.0 mg/100 g Icing Type 2 specific 0.000167 0.001 0.0 mg/100 g Irish moss Type 1 specific Chondrus crispus 2769 0.0 0.0 0.0 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 5.5 5.5 5.5 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 0.328556 0.49 0.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 2.2525 4.5 0.005 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' 105.0 105.0 105.0 mg/100 g Japanese persimmon Type 1 specific Diospyros kaki 35925 71.534333 213.0 0.156 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 0.000167 0.001 0.0 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 0.0 0.0 0.0 mg/100 g Jellyfish Type 1 specific Scyphozoa 6142 0.0 0.0 0.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.0 0.0 0.0 mg/100 g Jicama Type 1 specific Pachyrhizus erosus 109171 0.0 0.0 0.0 mg/100 g Jute Type 1 specific Corchorus olitorius 93759 0.0 0.0 0.0 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 1.8 9.0 0.0 mg/100 g Kefir Type 2 specific 0.0 0.0 0.0 mg/100 g Kelp Type 1 specific Laminaria 33637 0.0 0.0 0.0 mg/100 g Ketchup Type 2 specific 0.0 0.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.002775 0.0111 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 96.5965 193.0 0.193 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Lasagna Type 2 specific 0.005 0.005 0.005 mg/100 g Leavening agent Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.0 0.0 0.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 3.349 20.0 0.004 mg/100 g Lemon grass Type 1 specific Cymbopogon citratus 66014 0.0 0.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.0 0.0 0.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 0.0 0.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0 0.0 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 0.0 0.0 0.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 Lotus Type 1 specific Nelumbo 4430 0.0 0.0 0.0 mg/100 g Lupine Type 1 specific Lupinus 3869 0.0 0.0 0.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 0.0 0.0 0.0 mg/100 g Macaroni and cheese Type 2 specific 0.0 0.0 0.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Mallard duck Type 1 specific Anas platyrhynchos 8839 Mamey sapote Type 1 specific Pouteria sapota 233744 4.5035 9.0 0.007 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 28.297 221.0 0.214 mg/100 g Mango Type 1 specific Mangifera indica 29780 5.345333 16.0 0.01 mg/100 g Margarine Type 2 specific 0.0 0.0 0.0 mg/100 g Margarine-like spread Type 2 specific 0.0 0.0 0.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.0 0.0 0.0 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Meatloaf Type 2 specific 0.00575 0.046 0.0 mg/100 g Mexican groundcherry Type 1 specific Physalis philadelphica var. immaculata 374021 0.0 0.0 0.0 mg/100 g Mexican oregano Type 1 specific Lippia graveolens 5.5 5.5 5.5 mg/100 g Milk (Cow) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Milkshake Type 2 specific 0.0 0.0 0.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.0 0.0 0.0 mg/100 g Miso Type 2 specific 0.0 0.0 0.0 mg/100 g Mixed nuts Type 2 specific 0.00025 0.001 0.0 mg/100 g Molasses Type 2 specific 0.0 0.0 0.0 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 0.0 0.0 0.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Multigrain bread Type 2 specific 0.0 0.0 0.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 0.002 0.006 0.0 mg/100 g Muscadine grape Type 1 specific Vitis rotundifolia 103349 0.5005 1.0 0.001 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 0.25025 1.0 0.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Nachos Type 2 specific 0.0 0.0 0.0 mg/100 g Nance Type 1 specific Byrsonima crassifolia 4270 0.5025 1.0 0.005 mg/100 g Napa cabbage Type 1 specific Brassica rapa var. pekinensis 51351 0.0 0.0 0.0 mg/100 g Naranjilla Type 1 specific Solanum quitoense 227725 1.505 3.0 0.01 mg/100 g Narrowleaf cattail Type 1 specific Typha angustifolia 59011 0.0 0.0 0.0 mg/100 g Natto Type 2 specific 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 18.549 37.0 0.098 mg/100 g Nopal Type 1 specific Opuntia cochenillifera 338184 0.0 0.0 0.0 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 0.0 0.0 0.0 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.0 0.0 0.0 mg/100 g Nougat Type 2 specific 0.001 0.001 0.001 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 22.022 66.0 0.0 mg/100 g Nutritional drink Type 2 specific 0.0 0.0 0.0 mg/100 g Oat Type 1 specific Avena sativa 4498 0.0 0.0 0.0 mg/100 g Oat bread Type 2 specific 0.0 0.0 0.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Oil-seed Camellia Type 1 specific Camellia oleifera 385388 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.285714 2.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 4.4052 22.0 0.0 mg/100 g Opium poppy Type 1 specific Papaver somniferum 3469 0.0 0.0 0.0 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 0.34 0.49 0.19 mg/100 g Orange roughy Type 1 specific Hoplostethus atlanticus 96778 0.0 0.0 0.0 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 0.5005 1.0 0.001 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 0.0 0.0 0.0 mg/100 g Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 0.0 0.0 0.0 mg/100 g Other beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other bread Type 2 specific 0.000053 0.001 0.0 mg/100 g Other bread product Type 2 specific 0.0 0.0 0.0 mg/100 g Other candy Type 2 specific 0.000075 0.003 0.0 mg/100 g Other cereal product Type 2 specific 0.0 0.0 0.0 mg/100 g Other dish Type 2 specific 0.009059 0.07 0.0 mg/100 g Other fish product Type 2 specific 0.00025 0.001 0.0 mg/100 g Other frozen dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Other fruit product Type 2 specific 0.058 0.142 0.005 mg/100 g Other pasta dish Type 2 specific 0.0004 0.001 0.0 mg/100 g Other sandwich Type 2 specific 0.0013 0.009 0.0 mg/100 g Other snack food Type 2 specific 0.003154 0.041 0.0 mg/100 g Other soy product Type 2 specific 0.0 0.0 0.0 mg/100 g Other vegetable product Type 2 specific 0.031111 0.099 0.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0 0.0 0.0 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.0 0.0 0.0 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 0.0 0.0 0.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0 0.0 0.0 mg/100 g Pacific oyster Type 1 specific Crassostrea gigas 29159 0.0 0.0 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0 0.0 0.0 mg/100 g Pacific sardine Type 1 specific Sardinops sagax 28381 0.0 0.0 0.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 0.0 0.0 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.0 0.0 0.0 mg/100 g Pan dulce Type 2 specific 0.001 0.001 0.001 mg/100 g Pancake Type 2 specific 0.0005 0.002 0.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 156.58525 625.5 0.001 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.001333 0.004 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.0 0.0 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 10.27775 41.0 0.023 mg/100 g Pasta Type 2 specific 0.000095 0.001 0.0 mg/100 g Pastry Type 2 specific 0.001067 0.008 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Pea shoots Type 1 0.0 0.0 0.0 mg/100 g Peach Type 1 specific Prunus persica 3760 4.085071 55.5 0.026 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 55.5 55.5 55.5 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 0.0 0.0 0.0 mg/100 g Peanut oil Type 2 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.4007 4.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 3.5045 7.0 0.009 mg/100 g Pectin Type 2 specific 0.0 0.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 0.739071 6.252 0.0 mg/100 g Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 Pepper (Spice) Type 1 specific Piper nigrum 13216 21.0125 42.0 0.025 mg/100 g Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Percoidei (Bass and others) Type 1 specific Percoidei 8112 0.0 0.0 0.0 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 0.0 0.0 0.0 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 Phyllo dough Type 2 specific 0.0 0.0 0.0 mg/100 g Pie Type 2 specific 0.005 0.025 0.0 mg/100 g Pie crust Type 2 specific 0.0001 0.001 0.0 mg/100 g Pie filling Type 2 specific 0.002667 0.008 0.0 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 0.0 0.0 0.0 mg/100 g Piki bread Type 2 specific 0.001 0.001 0.001 mg/100 g Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 0.0 0.0 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 0.0 0.0 0.0 mg/100 g Pita bread Type 2 specific 0.0 0.0 0.0 mg/100 g Pizza Type 2 specific 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Popcorn Type 2 specific 0.023 0.16 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 0.0 0.0 0.0 mg/100 g Pot pie Type 2 specific 0.012 0.012 0.012 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 0.0 0.0 0.0 mg/100 g Potato bread Type 2 specific 0.0 0.0 0.0 mg/100 g Potato chip Type 2 specific 0.0 0.0 0.0 mg/100 g Potato puffs Type 2 specific 0.0 0.0 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 1.5015 3.0 0.003 mg/100 g Processed cheese Type 2 specific 0.0 0.0 0.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 0.0 0.0 0.0 mg/100 g Pudding Type 2 specific 0.000043 0.001 0.0 mg/100 g Pummelo Type 1 specific Citrus maxima 37334 5.005 10.0 0.01 mg/100 g Purple laver Type 1 specific Porphyra laciniata 0.0 0.0 0.0 mg/100 g Purple mangosteen Type 1 specific Garcinia mangostana 58228 0.009 0.009 0.009 mg/100 g Quail Type 1 specific Phasianidae 9005 0.0 0.0 0.0 mg/100 g Quesadilla Type 2 specific 0.0 0.0 0.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 0.5005 1.0 0.001 mg/100 g Rabbit Type 1 specific Leporidae 9979 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.0 0.0 0.0 mg/100 g Rainbow smelt Type 1 specific Osmerus mordax 8014 0.0 0.0 0.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.0 0.0 0.0 mg/100 g Raisin bread Type 2 specific 0.0 0.0 0.0 mg/100 g Rambutan Type 1 specific Nephelium lappaceum 151071 0.0 0.0 0.0 mg/100 g Rapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Rapini Type 1 specific Brassica ruvo 1204434 0.0 0.0 0.0 mg/100 g Ravioli Type 2 specific 0.0 0.0 0.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 0.295222 0.49 0.0 mg/100 g Red raspberry Type 1 specific Rubus idaeus 32247 0.0 0.0 0.0 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.0 0.0 0.0 mg/100 g Red tea Type 1 Red wine Type 2 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Relish Type 2 specific 0.159 0.296 0.022 mg/100 g Rice Type 1 specific Oryza sativa 4530 0.0 0.0 0.0 mg/100 g Rice bread Type 2 specific 0.0 0.0 0.0 mg/100 g Rice cake Type 2 specific 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 0.0 0.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 0.0 0.0 0.0 mg/100 g Roe Type 2 generic 0.0 0.0 0.0 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.0 0.0 0.0 mg/100 g Roman camomile Type 1 specific Chamaemelum nobile 99037 0.0 0.0 0.0 mg/100 g Rose hip Type 1 specific Rosa 3764 241.7415 483.0 0.483 mg/100 g Rosé wine Type 2 0.0 0.0 0.0 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.004429 0.031 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 0.0 0.0 0.0 mg/100 g Rye bread Type 2 specific 0.000571 0.001 0.0 mg/100 g Sacred lotus Type 1 specific Nelumbo nucifera 4432 0.0 0.0 0.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Sake Type 2 specific 0.0 0.0 0.0 mg/100 g Salad Type 2 specific 0.004 0.005 0.003 mg/100 g Salad dressing Type 2 specific 0.012895 0.092 0.0 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 0.0 0.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 0.0 0.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Salted butter Type 1 0.0 0.0 0.0 mg/100 g Sauce Type 2 specific 0.003979 0.068 0.0 mg/100 g Sausage Type 2 specific 0.001469 0.011 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.0 0.0 0.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.0 0.0 0.0 mg/100 g Scrapple Type 2 specific 0.0 0.0 0.0 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 0.0 0.0 0.0 mg/100 g Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 Sesame Type 1 specific Sesamum orientale 4182 0.0 0.0 0.0 mg/100 g Sesame oil Type 2 0.0 0.0 0.0 mg/100 g Shallot Type 1 specific Allium ascalonicum 1476995 0.0 0.0 0.0 mg/100 g Shark Type 1 specific Squaliformes 282414 0.0 0.0 0.0 mg/100 g Shea tree Type 1 specific Vitellaria paradoxa 292385 0.0 0.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Shiitake Type 1 specific Lentinus edodes 5353 0.0 0.0 0.0 mg/100 g Shortening Type 2 specific 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 0.0 0.0 0.0 mg/100 g Smelt Type 1 specific Osmeridae 8012 0.0 0.0 0.0 mg/100 g Snack bar Type 2 specific 0.007485 0.242 0.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Snapper Type 1 specific Lutjanidae 30850 0.0 0.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.0 0.0 0.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 0.005104 0.334 0.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 0.0 0.0 0.0 mg/100 g Sour cream Type 2 0.0 0.0 0.0 mg/100 g Soursop Type 1 specific Annona muricata 13337 0.0 0.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 0.00075 0.012 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Soy yogurt Type 2 specific 0.0 0.0 0.0 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 0.0 0.0 0.0 mg/100 g Spelt Type 1 specific Triticum spelta 58933 0.0 0.0 0.0 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.0 0.0 0.0 mg/100 g Spirulina Type 1 specific Spirulina 551299 0.0 0.0 0.0 mg/100 g Spotted seal Type 1 specific Phoca largha 39090 0.0 0.0 0.0 mg/100 g Spread Type 2 specific 0.003857 0.027 0.0 mg/100 g Squab Type 1 specific Columba 8931 Squid Type 1 specific Teuthida 551290 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Stew Type 2 specific 0.001 0.003 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 0.0 0.0 0.0 mg/100 g Stuffing Type 2 specific 0.0 0.0 0.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.0 0.0 0.0 mg/100 g Succotash Type 2 specific 0.061 0.061 0.061 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 0.000167 0.001 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.0 0.0 0.0 mg/100 g Sunflower oil Type 2 0.0 0.0 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 0.25 1.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 14.356667 43.0 0.024 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 0.0 0.0 0.0 mg/100 g Sweet custard Type 2 specific 0.001 0.002 0.0 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 35.035 70.0 0.07 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.108727 0.321 0.027 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.0 0.0 0.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Swiss cheese Type 2 0.0 0.0 0.0 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 0.0 0.0 0.0 mg/100 g Syrup Type 2 specific 0.0 0.0 0.0 mg/100 g Taco Type 2 specific 0.0 0.0 0.0 mg/100 g Taco shell Type 2 0.013 0.013 0.013 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tamale Type 2 specific 0.134667 0.342 0.004 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Tapioca pearl Type 2 specific 0.0 0.0 0.0 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 3.346833 20.0 0.0 mg/100 g Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Teff Type 1 specific Eragrostis tef 110835 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g Topping Type 2 specific 0.0 0.0 0.0 mg/100 g Tortilla Type 2 specific 0.00025 0.001 0.0 mg/100 g Tortilla chip Type 2 specific 0.008429 0.057 0.0 mg/100 g True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.0 0.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.0 0.0 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 0.0274 0.114 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Vanilla Type 1 specific Vanilla 51238 0.0 0.0 0.0 mg/100 g Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Vegetarian food Type 2 specific 0.0 0.0 0.0 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 0.0012 0.002 0.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Wasabi Type 1 specific Wasabia japonica 75806 0.0 0.0 0.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 77.539 155.0 0.078 mg/100 g Wax gourd Type 1 specific Benincasa hispida 102211 0.0 0.0 0.0 mg/100 g Wheat Type 1 specific Triticum 4564 0.0 0.0 0.0 mg/100 g Wheat bread Type 2 specific 0.0 0.0 0.0 mg/100 g Whelk Type 1 specific Buccinidae 37796 0.0 0.0 0.0 mg/100 g Whey Type 2 specific 0.0 0.0 0.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 0.000053 0.001 0.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 0.0 0.0 0.0 mg/100 g White mustard Type 1 specific Sinapis alba 3728 0.013 0.026 0.0 mg/100 g White wine Type 2 0.0 0.0 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.0 0.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 Wild carrot Type 1 specific Daucus carota 4039 Wild celery Type 1 specific Apium graveolens 4045 0.0 0.0 0.0 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 0.0 0.0 0.0 mg/100 g Wild rice Type 1 specific Zizania 15949 0.0 0.0 0.0 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 0.0 0.0 0.0 mg/100 g Winter squash Type 1 specific Cucurbita maxima 3661 0.0 0.0 0.0 mg/100 g Yam Type 1 specific Dioscorea 4672 0.0 0.0 0.0 mg/100 g Yautia Type 1 specific Xanthosoma sagittifolium 28478 0.0 0.0 0.0 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.19 0.19 0.19 mg/100 g Yellow wax bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 0.0 0.0 0.0 mg/100 g Yogurt Type 2 specific 0.0 0.0 0.0 mg/100 g Zwieback Type 2 specific 0.001 0.001 0.001 mg/100 g Anti-mutagenic 451 Anti-oxidant 502 A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. In European countries, E-numbers for permitted antioxidant food additives are from E 300 to E 324. Colorant 826 Vitamin-A activity 1429