1.0 2010-04-08 22:10:18 UTC 2024-11-29 22:28:11 UTC FDB012683 L-Methionine L-Methionine, also known as acimethin or H-met-H, belongs to the class of organic compounds known as methionine and derivatives. Methionine and derivatives are compounds containing methionine or a derivative thereof resulting from reaction of methionine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. The L-enantiomer of methionine. L-Methionine is a drug which is used for protein synthesis including the formation of same, l-homocysteine, l-cysteine, taurine, and sulfate. L-Methionine is a very strong basic compound (based on its pKa). L-Methionine exists in all living species, ranging from bacteria to humans. Outside of the human body, L-Methionine is found, on average, in the highest concentration within a few different foods, such as milk (cow), beluga whales, and smelts and in a lower concentration in white cabbages, wax gourds, and coconuts. L-Methionine has also been detected, but not quantified in, several different foods, such as pepper (c. chinense), acerola, grass pea, oxheart cabbages, and sherries. This could make L-methionine a potential biomarker for the consumption of these foods. L-Methionine is a potentially toxic compound. L-Methionine, with regard to humans, has been found to be associated with several diseases such as autism, leukemia, obesity, and heart failure; L-methionine has also been linked to the inborn metabolic disorder celiac disease. (2S)-2-Amino-4-(methylsulfanyl)butanoate (2S)-2-Amino-4-(methylsulfanyl)butanoic acid (2S)-2-amino-4-(Methylsulphanyl)butanoate (2S)-2-amino-4-(Methylsulphanyl)butanoic acid (L)-Methionine (S)-(-)-Methionine (S)-(+)-Methionine (S)-2-Amino-4-(methylmercapto)butyric acid (S)-2-amino-4-(methylthio)-Butanoate (S)-2-amino-4-(methylthio)-Butanoic acid (S)-2-Amino-4-(methylthio)butanoate (S)-2-Amino-4-(methylthio)butanoic acid (S)-2-amino-4-(methylthio)Butyrate (S)-2-Amino-4-(methylthio)butyric acid (S)-Methionine 2-amino-4-(methylthio)Butyrate 2-Amino-4-(methylthio)butyric acid, (S)- 2-amino-4-Methylthiobutanoate a-amino-g-Methylmercaptobutyrate a-amino-g-Methylmercaptobutyric acid Acimethin alpha-amino-alpha-Aminobutyric acid alpha-amino-gamma-Methylmercaptobutyrate Butanoic acid, 2-amino-4-(methylthio)-, (S)- Cymethion g-methylthio-a-Aminobutyrate g-methylthio-a-Aminobutyric acid gamma-methylthio-alpha-Aminobutyrate gamma-methylthio-alpha-Aminobutyric acid H-Met-H H-Met-OH L-(-)-Methionine L-2-Amino-4-(methylthio)butanoic acid L-2-Amino-4-(methylthio)butyric acid L-2-amino-4-Methylthiobutyric acid L-a-amino-g-Methylmercaptobutyrate L-a-amino-g-Methylmercaptobutyric acid L-a-Amino-g-methylthiobutyrate L-a-Amino-g-methylthiobutyric acid L-alpha-amino-gamma-Methylmercaptobutyrate L-alpha-Amino-gamma-methylmercaptobutyric acid L-alpha-Amino-gamma-methylthiobutyrate L-alpha-Amino-gamma-methylthiobutyric acid L-gamma-Methylthio-alpha-aminobutyric acid L-Homocysteine, S-methyl- L-Methionin L-Methionine L-Methioninum L-α-amino-γ-methylmercaptobutyrate L-α-amino-γ-methylmercaptobutyric acid L(-)-amino-alpha-amino-alpha-Aminobutyric acid L(-)-amino-gamma-Methylthiobutyric acid Liquimeth M Mepron Met Methilanin METHIONINE Methionine, 9CI, INN; L-form Methionine, L- (8CI) Methioninum Metionina Neo-methidin Poly-L-methionine Polymethionine S-Methionine S-Methyl-L-homocysteine Toxin war C5H11NO2S 149.211 149.051049291 (2S)-2-amino-4-(methylsulfanyl)butanoic acid L-methionine 63-68-3 CSCC[C@H](N)C(O)=O InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 FFEARJCKVFRZRR-BYPYZUCNSA-N belongs to the class of organic compounds known as methionine and derivatives. Methionine and derivatives are compounds containing methionine or a derivative thereof resulting from reaction of methionine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Methionine and derivatives Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids Dialkylthioethers Hydrocarbon derivatives L-alpha-amino acids Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Sulfenyl compounds Thia fatty acids Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Carbonyl group Carboxylic acid Dialkylthioether Fatty acid Fatty acyl Hydrocarbon derivative L-alpha-amino acid Methionine or derivatives Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Organosulfur compound Primary aliphatic amine Primary amine Sulfenyl compound Thia fatty acid Thioether Common amino acids L-alpha-amino acid aspartate family amino acid methionine proteinogenic amino acid Solid logp -1.85 ALOGPS logs -0.80 ALOGPS solubility 2.39e+01 g/l ALOGPS melting_point Mp 283° dec. logp -2.2 ChemAxon pka_strongest_acidic 2.53 ChemAxon pka_strongest_basic 9.5 ChemAxon iupac (2S)-2-amino-4-(methylsulfanyl)butanoic acid ChemAxon average_mass 149.211 ChemAxon mono_mass 149.051049291 ChemAxon smiles CSCC[C@H](N)C(O)=O ChemAxon formula C5H11NO2S ChemAxon inchi InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 ChemAxon inchikey FFEARJCKVFRZRR-BYPYZUCNSA-N ChemAxon polar_surface_area 63.32 ChemAxon refractivity 37.59 ChemAxon polarizability 15.5 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Betaine Metabolism SMP00123 map00260 Glycine and Serine Metabolism SMP00004 map00260 Methionine Metabolism SMP00033 map00270 Spermidine and Spermine Biosynthesis SMP00445 Transcription/Translation SMP00019 Metabolism and Physiological Effects of Homocysteine SMP0123280 Metabolism and Physiological Effects of Dimethylglycine SMP0124873 Metabolism and Physiological Effects of N-Acetylmethionine SMP0126707 Metabolism and Physiological Effects of N-Formyl-L-Methionine SMP0126765 Metabolism and Physiological Effects of S-Adenosylhomocysteine SMP0127690 Specdb::NmrTwoD 1031 Specdb::NmrTwoD 1430 Specdb::MsIr 751 Specdb::MsIr 752 Specdb::MsIr 753 Specdb::CMs 615 Specdb::CMs 616 Specdb::CMs 617 Specdb::CMs 1109 Specdb::CMs 1204 Specdb::CMs 2922 Specdb::CMs 30046 Specdb::CMs 30208 Specdb::CMs 30604 Specdb::CMs 30730 Specdb::CMs 30770 Specdb::CMs 31197 Specdb::CMs 31198 Specdb::CMs 37701 Specdb::CMs 170485 Specdb::CMs 1072495 Specdb::CMs 1072497 Specdb::CMs 1072499 Specdb::NmrOneD 1254 Specdb::NmrOneD 1484 Specdb::NmrOneD 4840 Specdb::NmrOneD 20602 Specdb::NmrOneD 20603 Specdb::NmrOneD 20604 Specdb::NmrOneD 20605 Specdb::NmrOneD 20606 Specdb::NmrOneD 20607 Specdb::NmrOneD 20608 Specdb::NmrOneD 20609 Specdb::NmrOneD 20610 Specdb::NmrOneD 20611 Specdb::NmrOneD 20612 Specdb::NmrOneD 20613 Specdb::NmrOneD 20614 Specdb::NmrOneD 20615 Specdb::NmrOneD 20616 Specdb::NmrOneD 20617 Specdb::NmrOneD 20618 Specdb::NmrOneD 20619 Specdb::NmrOneD 20620 Specdb::NmrOneD 20621 Specdb::NmrOneD 166452 Specdb::MsMs 969 Specdb::MsMs 970 Specdb::MsMs 971 Specdb::MsMs 4441 Specdb::MsMs 4442 Specdb::MsMs 4443 Specdb::MsMs 4444 Specdb::MsMs 4445 Specdb::MsMs 4446 Specdb::MsMs 4447 Specdb::MsMs 4448 Specdb::MsMs 4449 Specdb::MsMs 4450 Specdb::MsMs 4451 Specdb::MsMs 4452 Specdb::MsMs 4453 Specdb::MsMs 4454 Specdb::MsMs 4455 Specdb::MsMs 4456 Specdb::MsMs 4457 Specdb::MsMs 4458 Specdb::MsMs 4462 Specdb::MsMs 4463 Specdb::MsMs 179109 Specdb::MsMs 179110 HMDB00696 16643 MET #<Reference:0x000055ac40b5dc30> #<Reference:0x000055ac40b5da78> #<Reference:0x000055ac40b5d8c0> #<Reference:0x000055ac40b5d708> #<Reference:0x000055ac40b5d550> #<Reference:0x000055ac40b5d398> #<Reference:0x000055ac40b5d1e0> #<Reference:0x000055ac40b5d028> #<Reference:0x000055ac40b5ce70> #<Reference:0x000055ac40b5ccb8> #<Reference:0x000055ac40b5cb00> #<Reference:0x000055ac40b5c948> #<Reference:0x000055ac40b5c790> #<Reference:0x000055ac40b5c5d8> #<Reference:0x000055ac40b5c420> #<Reference:0x000055ac40b5c268> #<Reference:0x000055ac40b5c0b0> #<Reference:0x000055ac40b5bea8> #<Reference:0x000055ac40b5bcf0> Abalone Type 1 specific Haliotis 6452 413.5 441.0 386.0 mg/100 g Abiyuch Type 1 specific Crateva religiosa 202634 Acerola Type 1 specific Malpighia emarginata 151847 Acorn Type 1 specific Quercus 3511 91.27575 136.0 0.103 mg/100 g Acorn squash Type 1 Cucurbita pepo var. turbinata 0.01 0.01 0.01 mg/100 g Adzuki bean Type 1 specific Vigna angularis 3914 95.614286 226.3 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Agave Type 1 specific Agave 39509 4.5045 9.0 0.009 mg/100 g Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 Alaska pollock Type 1 specific Theragra chalcogramma 1042646 533.0 696.0 370.0 mg/100 g Alaska wild rhubarb Type 1 specific Polygonum alpinum 125586 Albacore tuna Type 1 specific Thunnus alalunga 8235 742.0 785.0 699.0 mg/100 g Albizia gummifera Type 1 Albizia gummifera Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 24.115385 90.0 2.0 mg/100 g Allspice Type 1 specific Pimenta dioica 375272 Almond Type 1 specific Prunus dulcis 3755 145.704385 190.0 0.0 mg/100 g Alpine sweetvetch Type 1 specific Hedysarum alpinum 57576 Amaranth Type 1 specific Amaranthus 3564 93.129333 234.55 0.226 mg/100 g American butterfish Type 1 specific Peprilus triacanthus 183653 389.504 656.0 0.512 mg/100 g American cranberry Type 1 specific Vaccinium macrocarpon 13750 3.0 3.0 3.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 296.137667 475.0 0.413 mg/100 g American pokeweed Type 1 specific Phytolacca americana 3527 American shad Type 1 specific Alosa sapidissima 34773 381.167 642.0 0.501 mg/100 g Anatidae Type 1 specific Anatidae 8830 330.1206 620.0 0.291 mg/100 g Anchovy Type 1 specific Engraulidae 43062 273.534 410.0 0.602 mg/100 g Angelica Type 1 specific Angelica keiskei 357850 Anguilliformes Type 1 specific Anguilliformes 7933 420.1092 560.0 0.546 mg/100 g Anise Type 1 specific Pimpinella anisum 271192 Annual wild rice Type 1 specific Zizania aquatica 75727 Apple Type 1 specific Malus pumila 283210 3.524172 13.0 0.001 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 7.041917 25.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 5.933333 23.0 0.0 mg/100 g Arctic blackberry Type 1 specific Rubus arcticus 70741 Arepa Type 2 specific 131.0 131.0 131.0 mg/100 g Arrowhead Type 1 specific Sagittaria latifolia 15008 Arrowroot Type 1 specific Maranta arundinacea 210060 6.0 6.0 6.0 mg/100 g Asian pear Type 1 specific Pyrus pyrifolia 3767 3.003 6.0 0.006 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 32.664789 201.6 0.031 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 747.3054 1859.0 0.527 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 350.508667 526.0 0.526 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 504.1598 630.0 0.799 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 515.255333 729.0 0.532 mg/100 g Atlantic mackerel Type 1 specific Scomber scombrus 13677 628.5 706.0 551.0 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 438.183667 738.0 0.551 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 524.1174 753.0 0.587 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 444.5036 664.0 0.518 mg/100 g Avocado Type 1 specific Persea americana 3435 37.634 86.4 0.038 mg/100 g Babassu palm Type 1 specific Attalea speciosa 145700 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 117.426471 476.0 0.0 mg/100 g Bagel Type 2 specific 190.111111 209.0 179.0 mg/100 g Baked beans Type 2 specific 77.571429 105.0 40.0 mg/100 g Baked potato Type 2 specific 97.6 135.0 40.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 10.50375 30.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 23.502 74.0 0.008 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 157.670833 294.0 0.19 mg/100 g Bayberry Type 1 specific Myrica 3509 Bean Type 1 specific 77.571429 105.0 40.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 1039.5 1684.0 482.0 mg/100 g Beech nut Type 1 specific Fagus 21024 73.073 146.0 0.146 mg/100 g Beefalo Type 1 specific Bos taurus X Bison bison 297284 Beer Type 2 specific 2.401579 5.815 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 1353.0 1353.0 1353.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 104.860465 268.0 22.0 mg/100 g Bison Type 1 specific Bison bison 9901 0.505 0.505 0.505 mg/100 g Bitter gourd Type 1 specific Momordica charantia 3673 Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 377.0 698.0 192.0 mg/100 g Black cabbage Type 1 specific Brassica oleracea var. viridis 3713 34.333333 40.0 28.0 mg/100 g Black chokeberry Type 1 specific Photinia melanocarpa 661339 Black crowberry Type 1 specific Empetrum nigrum 191066 Black elderberry Type 1 specific Sambucus nigra 4202 Black huckleberry Type 1 specific Gaylussacia baccata 128893 Black mulberry Type 1 specific Morus nigra 85232 Black plum Type 1 Syzygium cumini Black radish Type 1 specific Raphanus sativus var. niger 41679 Black raisin Type 1 Black raspberry Type 1 specific Rubus occidentalis 75079 Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 235.822333 467.0 0.467 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 89.490538 335.0 0.042 mg/100 g Blackberry Type 1 specific Rubus Blackcurrant Type 1 specific Ribes nigrum 78511 0.0 0.0 0.0 mg/100 g Blue cheese Type 2 0.584 0.584 0.584 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 396.3016 569.0 0.508 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 268.422667 537.0 0.268 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Bluefish Type 1 specific Pomatomus saltatrix 75034 451.197667 760.0 0.593 mg/100 g Bog bilberry Type 1 specific Vaccinium uliginosum 190548 Borage Type 1 specific Borago officinalis 13363 Boysenberry Type 1 specific Rubus ursinus X idaeus Brassicas Unknown generic 3705 Brazil nut Type 1 specific Bertholletia excelsa 3645 1058.075 1100.0 1008.0 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 62.251429 157.75 0.01 mg/100 g Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 28.345 50.0 0.035 mg/100 g Breakfast cereal Type 2 specific 115.791045 574.0 0.0 mg/100 g Breakfast sandwich Type 2 specific 277.047619 345.0 162.0 mg/100 g Broad bean Type 1 specific Vicia faba 3906 79.21875 213.0 37.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 37.205368 76.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 42.517625 130.25 0.032 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 0.511 0.511 0.511 mg/100 g Buffalo currant Type 1 specific Ribes aureum var. villosum 23283 Bulgur Type 2 specific 79.396667 190.0 0.19 mg/100 g Burbot Type 1 specific Lota lota 69944 326.393 733.0 0.0 mg/100 g Burdock Type 1 specific Arctium lappa 4217 12.0018 27.0 0.009 mg/100 g Burrito Type 2 specific 165.083333 289.0 59.0 mg/100 g Butter Type 2 specific 13.877625 21.0 0.021 mg/100 g Butterfat Type 2 specific 7.0 7.0 7.0 mg/100 g Buttermilk Type 2 specific 163.787111 860.0 0.084 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 411.070333 621.6 0.611 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 12.287429 22.0 0.012 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 43.106 86.2 0.012 mg/100 g Cake Type 2 specific 106.583333 280.0 47.0 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 11.8008 47.0 0.004 mg/100 g Canada blueberry Type 1 specific Vaccinium myrtilloides 1503870 Cannellini bean Type 1 Canola Type 2 specific 138011 Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 0.003 0.003 0.003 mg/100 g Cape gooseberry Type 1 Physalis peruviana Capers Type 1 specific Capparis spinosa 65558 Caraway Type 1 specific Carum carvi 48032 361.0 361.0 361.0 mg/100 g Cardamom Type 1 specific Elettaria cardamomum 105181 Cardoon Type 1 specific Cynara cardunculus 4265 Carob Type 1 specific Ceratonia siliqua 20340 275.5 470.0 81.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.264 0.528 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 12.094981 56.0 0.0045 mg/100 g Cascade huckleberry Type 1 specific Vaccinium deliciosum 190531 Casein Type 2 specific 1100.0 1100.0 1100.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 310.3625 362.0 270.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 17.4522 54.25 0.011 mg/100 g Castanospermum australe Type 1 Castanospermum australe Catfish Type 1 specific Siluriformes 7995 420.12125 660.0 0.485 mg/100 g Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 143.085 340.0 0.34 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 635.700216 978.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 27.053684 43.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 18.0 18.0 18.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 18.0 18.0 18.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.005 0.005 0.005 mg/100 g Cereals and cereal products Unknown generic Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Ceylon cinnamon Type 1 specific Cinnamomum verum 128608 Channel catfish Type 1 specific Ictalurus punctatus 7998 423.914167 547.0 0.485 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 1.821571 7.75 0.001 mg/100 g Cheese Type 2 specific 613.135593 1114.0 88.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 7.007 21.0 0.0 mg/100 g Cherry tomato Type 1 specific Solanum lycopersicum var. cerasiforme 195583 Chervil Type 1 specific Anthriscus cerefolium 40888 50.5 66.0 35.0 mg/100 g Chestnut Type 1 specific Castanea 21019 32.033667 48.0 0.101 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chia Type 1 specific Salvia hispanica 49212 294.294 588.0 0.588 mg/100 g Chicken Type 1 specific Gallus gallus 9031 489.285714 770.0 0.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 151.527 260.0 0.27 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 13.467778 64.2 0.01 mg/100 g Chicory leaves Type 1 specific Cichorium intybus var. foliosum 13427 Chicory roots Type 1 specific Cichorium intybus var. sativum 13427 Chili Type 2 specific 129.333333 190.0 95.0 mg/100 g Chimichanga Type 2 specific 213.75 247.0 166.0 mg/100 g Chinese bayberry Type 1 specific Myrica rubra 262757 Chinese broccoli Type 1 specific Brassica alboglabra 3714 Chinese cabbage Type 1 specific Brassica rapa 3711 4.669667 7.0 0.009 mg/100 g Chinese chestnut Type 1 specific Castanea mollissima 60419 88.8202 165.0 0.101 mg/100 g Chinese chives Type 1 specific Allium tuberosum 4683 0.036 0.036 0.036 mg/100 g Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 78.0 78.0 78.0 mg/100 g Chinese mustard Type 1 specific Brassica juncea 3707 22.0 25.0 21.0 mg/100 g Chinese plum Type 1 Chinese water chestnut Type 1 specific Eleocharis dulcis 110284 Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 510.432333 761.0 0.594 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 89.256 231.0 0.036 mg/100 g Chocolate Type 2 specific 98.75 200.0 0.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 566.432667 770.0 0.596 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 453.197667 766.0 0.593 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.026 0.078 0.0 mg/100 g Cisco Type 1 specific Coregonus artedi 36181 348.854 562.0 0.562 mg/100 g Citrus Unknown generic Clam Type 1 0.423 0.423 0.423 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 468.630429 560.0 0.413 mg/100 g Clementine Type 1 Citrus × clementina Climbing bean Type 1 specific Vigna umbellata 87088 Cloud ear fungus Type 1 specific Auricularia polytricha 29893 Cloudberry Type 1 specific Rubus chamaemorus 57936 Cloves Type 1 specific Syzygium aromaticum 219868 40.04 80.0 0.08 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 357.142857 710.0 0.0 mg/100 g Cocoa bean Type 1 specific Theobroma cacao 3641 Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 181.125 240.0 80.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 47.002385 130.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 5.933333 23.0 0.0 mg/100 g Coffee substitute Type 2 specific 50.0 83.0 17.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 600.377143 810.0 0.64 mg/100 g Cold cut Type 2 specific 360.363636 679.0 0.0 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 140.235667 213.5 0.207 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 198.359 520.0 0.552 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 116.229167 381.0 9.0 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 13.584833 21.0 0.018 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 109.379273 172.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 13.654769 54.0 0.012 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 401.842667 677.0 0.528 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 32.533333 67.6 9.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 0.221 0.221 0.221 mg/100 g Common ling Type 1 specific Molva molva 163112 320.8905 721.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 28.6 48.0 19.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 252.334 673.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 63.5635 127.0 0.127 mg/100 g Common pea Type 1 specific Pisum sativum 3888 73.224286 251.0 0.0 mg/100 g Common persimmon Type 1 specific Diospyros virginiana 13493 3.5035 7.0 0.007 mg/100 g Common sage Type 1 specific Salvia officinalis 38868 Common salsify Type 1 specific Tragopogon porrifolius 13731 Common thyme Type 1 specific Thymus vulgaris 49992 167.5 167.5 167.5 mg/100 g Common verbena Type 1 specific Verbena officinalis 79772 Common walnut Type 1 specific Juglans regia 51240 173.828667 285.25 0.236 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 213.75 250.0 174.0 mg/100 g Conch Type 1 specific Strombidae 69694 Condensed milk Type 2 specific 198.0 198.0 198.0 mg/100 g Cooking oil Type 2 specific 0.0 0.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 92.688677 293.0 0.0 mg/100 g Corn chip Type 2 specific 137.875 154.0 122.0 mg/100 g Corn grits Type 2 specific 78.230769 184.0 29.0 mg/100 g Corn salad Type 1 specific Valerianella locusta 59166 105.5 186.0 25.0 mg/100 g Cornbread Type 2 specific 145.25 163.0 133.0 mg/100 g Cornmint Type 1 specific Mentha arvensis 292239 Cottonseed Type 1 specific Gossypium 3633 350.066125 809.0 0.0 mg/100 g Cottonseed oil Type 2 0.0 0.0 0.0 mg/100 g Couscous Type 2 specific 129.0 199.0 59.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific 88.0 88.0 88.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 88.0 88.0 88.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 87.0 87.0 87.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 83.0 83.0 83.0 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 0.042 0.042 0.042 mg/100 g Crab Type 1 specific Brachyura 6752 422.393778 660.0 0.508 mg/100 g Cracker Type 2 specific 174.314286 290.0 112.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 262.124 494.0 0.0 mg/100 g Cream Type 2 specific 57.353862 81.0 0.054 mg/100 g Cream substitute Type 2 specific 46.333333 145.0 7.0 mg/100 g Crisp bread Type 2 specific 183.727273 250.0 121.0 mg/100 g Crosne Type 1 Stachys affinis Cubanelle pepper Type 1 Cucumber Type 1 specific Cucumis sativus 3659 6.783667 52.6 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 69.36 603.0 5.0 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 Cupuaçu Type 1 specific Theobroma grandiflorum 108881 0.0 0.0 0.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Cusk Type 1 specific Brosme brosme 81638 427.854 721.0 0.562 mg/100 g Custard apple Type 1 specific Annona reticulata 301862 4.335667 9.0 0.007 mg/100 g Cuttlefish Type 1 specific Sepiidae 6608 366.455333 733.0 0.366 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 14.12625 75.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 33.461167 109.75 0.017 mg/100 g Deer Type 1 specific Cervidae 9850 602.396222 837.0 0.566 mg/100 g Deerberry Type 1 specific Vaccinium stamineum 176259 Devilfish Type 1 specific Myoxocephalus 8095 Dill Type 1 specific Anethum graveolens 40922 41.943875 148.95 0.0 mg/100 g Dock Type 1 specific Rumex 3618 24.75875 35.0 0.035 mg/100 g Dolphin fish Type 1 specific Coryphaena hippurus 34814 625.0 702.0 548.0 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 426.184 726.0 0.552 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 522.273663 859.0 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 818.545455 910.0 660.0 mg/100 g Dumpling Type 2 specific 0.0 0.0 0.0 mg/100 g Dungeness crab Type 1 specific Cancer magister 29965 373.163333 629.0 0.49 mg/100 g Durian Type 1 specific Durio zibethinus 66656 Eastern oyster Type 1 specific Crassostrea virginica 6565 145.875571 257.0 0.129 mg/100 g Eddoe Type 1 Colocasia antiquorum Edible shell Type 2 specific 165.5 180.0 151.0 mg/100 g Egg roll Type 2 specific 149.25 190.0 100.0 mg/100 g Egg substitute Type 2 specific 193.6935 387.0 0.387 mg/100 g Egg yolk Type 1 0.03 0.03 0.03 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 14.710111 77.35 0.0 mg/100 g Eggs Unknown generic 772.095189 3204.0 0.045 mg/100 g Elderberry Type 1 specific Sambucus 4201 11.714286 14.0 10.0 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 0.534 0.534 0.534 mg/100 g Elliott's blueberry Type 1 specific Vaccinium elliottii 283798 Empanada Type 2 specific 207.0 207.0 207.0 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 0.432 0.432 0.432 mg/100 g Enchilada Type 2 specific 152.333333 195.0 126.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 27.102 119.7 0.014 mg/100 g Enokitake Type 1 specific Flammulina velutipes 38945 30.0 30.0 30.0 mg/100 g Epazote Type 1 specific Dysphania ambrosioides 330163 European anchovy Type 1 specific Engraulis encrasicolus 184585 485.867333 855.0 0.602 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 70.10475 151.0 0.038 mg/100 g European cranberry Type 1 specific Vaccinium oxycoccos 516948 European plum Type 1 specific Prunus domestica 3758 7.770833 23.25 3.0 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 0.545 0.545 0.545 mg/100 g Evaporated milk Type 2 specific 175.5 189.0 171.0 mg/100 g Evening primrose Type 1 specific Oenothera biennis 3942 558.15 558.15 558.15 mg/100 g Evergreen huckleberry Type 1 specific Vaccinium ovatum 84019 Falafel Type 2 specific 187.0 187.0 187.0 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 5.0035 10.0 0.007 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 243.32 315.6 0.0 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 281.9595 447.5 0.338 mg/100 g Fig Type 1 specific Ficus carica 3494 13.223767 34.0 0.0065 mg/100 g Fireweed Type 1 specific Chamerion angustifolium 13055 Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 411.091 560.0 0.455 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 235.061667 520.0 0.0 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 416.182333 701.0 0.547 mg/100 g Flour Type 2 specific Fox grape Type 1 specific Vitis labrusca 103355 French plantain Type 1 specific Musa X paradisiaca 89151 15.25 17.0 10.0 mg/100 g French toast Type 2 specific 155.75 188.0 86.0 mg/100 g Freshwater drum Type 1 specific Aplodinotus grunniens 225389 395.173 666.0 0.519 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 415.515333 700.0 0.546 mg/100 g Frozen yogurt Type 2 specific 88.5 94.0 83.0 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.25 1.0 0.0 mg/100 g Fruit-flavor drink Type 2 specific 39.0 76.0 2.0 mg/100 g Fruits Unknown generic Gadiformes Type 1 specific Gadiformes 8043 0.315 0.527 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 269.352852 750.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 35.0 35.0 35.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 22.784 59.5 0.002 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.002 0.002 0.002 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 11.0 11.0 11.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 24.081081 122.0 0.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 66.9 66.9 66.9 mg/100 g Garfish Type 1 specific Belone belone 129037 620.0 620.0 620.0 mg/100 g Garland chrysanthemum Type 1 specific Chrysanthemum coronarium 99038 Garlic Type 1 specific Allium sativum 4682 105.868 200.0 0.076 mg/100 g Gefilte fish Type 2 specific 255.0 255.0 255.0 mg/100 g Gelatin Type 2 specific 680.0 680.0 680.0 mg/100 g Gelatin dessert Type 2 specific 202.25 606.0 0.0 mg/100 g Gentiana lutea Type 1 Gentiana lutea German camomile Type 1 specific Matricaria recutita 127986 Giant butterbur Type 1 specific Petasites japonicus 186965 Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 160.893833 410.0 0.013 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 61.171 133.0 0.055 mg/100 g Ginseng Type 1 specific Panax 4054 Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Goji Type 1 0.087 0.087 0.087 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Gram bean Type 1 specific Vigna mungo 3915 195.666667 367.0 110.0 mg/100 g Grape Type 1 specific Vitis 3603 8.001875 21.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 5.0004 8.0 0.006 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.007 0.007 0.007 mg/100 g Grapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Grass pea Type 1 specific Lathyrus sativus 3860 Greater sturgeon Type 1 specific Acipenser 7901 503.8695 924.0 0.478 mg/100 g Greek feta cheese Type 2 0.368 0.368 0.368 mg/100 g Green apple Type 1 Green bean Type 1 specific Phaseolus vulgaris 3885 19.849333 29.0 9.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 29.892308 215.0 6.0 mg/100 g Green cabbage Type 1 Brassica oleracea var. sabauda L. Green grape Type 1 Green lentil Type 1 Lens culinaris 0.21 0.21 0.21 mg/100 g Green onion Type 1 Green plum Type 1 0.008 0.008 0.008 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green vegetables Unknown generic Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 25.614538 143.0 0.039 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 267.203571 545.0 0.0 mg/100 g Greenthread tea Type 1 specific Thelesperma 153159 Greylag goose Type 1 specific Anser anser 8843 Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Grouper Type 1 specific Epinephelus 94231 436.524667 735.0 0.574 mg/100 g Guarana Type 1 Paullinia cupana Guava Type 1 specific Psidium guajava 120290 8.419333 20.5 0.016 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 0.571 0.571 0.571 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 564.125 747.0 0.0 mg/100 g Half-highbush blueberry Type 1 specific Vaccinium angustifolium X Vaccinium corymbosum 934696 Hamburger Type 2 specific 299.28125 433.0 208.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 110.5 221.0 0.0 mg/100 g Hawthorn Type 1 Crataegus Hazelnut Type 1 specific Corylus 13450 160.888714 240.0 0.0 mg/100 g Heart of palm Type 1 specific 42.0 42.0 42.0 mg/100 g Hedge mustard Type 1 specific Sisymbrium 3729 311.0 311.0 311.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Herbs and Spices Unknown generic Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 Hickory nut Type 1 specific Carya 13402 150.15 300.0 0.3 mg/100 g Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 41.25 41.25 41.25 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 604.9232 861.0 0.616 mg/100 g Honey Type 2 specific 0.333667 1.0 0.0 mg/100 g Horned melon Type 2 specific Cucumis metuliferus 61886 Horse Type 1 specific Equus caballus 9796 0.473 0.473 0.473 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 27.666667 38.0 7.0 mg/100 g Horseradish tree Type 1 specific Moringa oleifera 3735 152.6875 349.75 69.0 mg/100 g Hot chocolate Type 2 specific 86.0 93.0 70.0 mg/100 g Hot dog Type 2 specific 209.666667 222.0 199.0 mg/100 g Hummus Type 2 specific 80.0 80.0 80.0 mg/100 g Hushpuppy Type 2 specific 169.0 169.0 169.0 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 63.055125 191.0 0.191 mg/100 g Hyssop Type 1 specific Hyssopus officinalis 39324 Ice cream Type 2 specific 73.086957 112.0 0.0 mg/100 g Ice cream cone Type 2 specific 140.5 142.0 139.0 mg/100 g Iceberg lettuce Type 1 0.005 0.005 0.005 mg/100 g Icing Type 2 specific 20.222222 72.0 0.0 mg/100 g Irish moss Type 1 specific Chondrus crispus 2769 Italian oregano Type 1 specific Origanum X majoricum 1384207 0.127 0.127 0.127 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 27.090909 215.0 5.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 17.017 34.0 0.034 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' Japanese chestnut Type 1 specific Castanea crenata 103480 54.2108 126.0 0.054 mg/100 g Japanese persimmon Type 1 specific Diospyros kaki 35925 5.668333 12.0 0.005 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 269.51 603.0 8.1 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 0.546 0.546 0.546 mg/100 g Japanese walnut Type 1 specific Juglans ailanthifolia 91209 Java plum Type 1 specific Syzygium cumini 260142 Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 28.6 85.8 0.0 mg/100 g Jew's ear Type 1 specific Auricularia auricula-judae 29892 Jicama Type 1 specific Pachyrhizus erosus 109171 17.5014 66.5 0.007 mg/100 g Jostaberry Type 1 specific Ribes × nidigrolaria Jujube Type 1 specific Ziziphus zizyphus 48393 Juniperus communis Type 1 Juniperus communis Junket Type 2 specific 66.4 78.0 24.0 mg/100 g Jute Type 1 specific Corchorus olitorius 93759 90.913 287.5 0.065 mg/100 g Kai-lan Type 1 specific Brassica oleracea var. alboglabra 3714 Kale Type 1 specific Brassica napus var. pabularia 27.0 54.0 18.0 mg/100 g Kefir Type 2 specific 88.0 88.0 88.0 mg/100 g Kelp Type 1 specific Laminaria 33637 12.5125 25.0 0.025 mg/100 g Ketchup Type 2 specific 14.8 22.0 0.0 mg/100 g King mackerel Type 1 specific Scomberomorus cavalla 13679 456.866667 770.0 0.6 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 16.0011 24.0 0.0055 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 20.823286 78.75 0.013 mg/100 g Komatsuna Type 1 specific Brassica rapa var. perviridis 344680 Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 60.7198 180.55 0.049 mg/100 g Lantern fruit Type 1 Physalis alkekengi Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Lasagna Type 2 specific 133.0 145.0 121.0 mg/100 g Leavening agent Type 2 specific 271.6 590.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 14.672667 22.0 0.018 mg/100 g Lemon Type 1 specific Citrus limon 2708 3.5 7.0 0.0 mg/100 g Lemon balm Type 1 specific Melissa officinalis 39338 Lemon grass Type 1 specific Cymbopogon citratus 66014 Lemon sole Type 1 specific Microstomus kitt 106175 380.11375 540.0 0.455 mg/100 g Lemon thyme Type 1 specific Thymus pulegioides 751873 Lemon verbena Type 1 specific Aloysia triphylla 542672 Lentils Type 1 generic Lens culinaris 3864 117.647333 227.5 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 19.709938 141.35 0.009 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 17.25 42.0 9.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 92.7459 271.0 0.068 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 3.3755 9.5 0.002 mg/100 g Linden Type 1 specific Tilia 64580 Lingcod Type 1 specific Ophiodon elongatus 225387 397.841 670.0 0.523 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 17.833333 72.0 0.0 mg/100 g Liquorice Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Longan Type 1 specific Dimocarpus longan 128017 20.671 49.0 0.013 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 3.001 4.0 0.004 mg/100 g Lotus Type 1 specific Nelumbo 4430 113.007333 267.0 0.022 mg/100 g Lovage Type 1 specific Levisticum officinale 48042 Lowbush blueberry Type 1 specific Vaccinium angustifolium 472369 Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Lupine Type 1 specific Lupinus 3869 0.255 0.255 0.255 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 34.88075 93.5 0.023 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 0.023 0.023 0.023 mg/100 g Macaroni and cheese Type 2 specific 137.5 266.0 63.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 7.5075 15.0 0.015 mg/100 g Malabar plum Type 1 specific Syzygium jambos 334483 Malabar spinach Type 1 specific Basella alba 3589 83.125 147.25 19.0 mg/100 g Mallard duck Type 1 specific Anas platyrhynchos 8839 Malus (Crab apple) Type 1 specific Malus 3749 4.0 4.0 4.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 12.012 24.0 0.024 mg/100 g Mammee apple Type 1 specific Mammea americana 198777 6.0 6.0 6.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 9.454 58.9 0.002 mg/100 g Mango Type 1 specific Mangifera indica 29780 9.6016 30.0 0.008 mg/100 g Margarine Type 2 specific 14.384615 21.0 0.0 mg/100 g Margarine-like spread Type 2 specific 10.333333 13.0 9.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 408.609714 650.0 0.268 mg/100 g Marshmallow Type 2 specific 7.5 15.0 0.0 mg/100 g Marzipan Type 2 specific 66.666667 100.0 0.0 mg/100 g Mate Type 1 Ilex paraguariensis Meat bouillon Type 2 specific 116.0 360.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meatloaf Type 2 specific 388.636364 506.0 258.0 mg/100 g Medlar Type 1 specific Mespilus germanica 36616 Mentha Type 1 specific Mentha 21819 Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Mexican groundcherry Type 1 specific Physalis philadelphica var. immaculata 374021 Mexican oregano Type 1 specific Lippia graveolens 0.127 0.127 0.127 mg/100 g Mikan Type 1 Citrus unshiu Milk (Cow) Type 2 specific 2444.633766 90000.0 0.0 mg/100 g Milk (Human) Type 2 specific 5.25 21.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 97.6 155.0 78.0 mg/100 g Milk substitute Type 2 specific 53.0 53.0 53.0 mg/100 g Milkfish Type 1 specific Chanos chanos 29144 462.536 779.0 0.608 mg/100 g Milkshake Type 2 specific 87.4 97.0 76.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 216.277625 330.0 0.221 mg/100 g Miso Type 2 specific 64.5 129.0 0.0 mg/100 g Mixed nuts Type 2 specific 278.444444 346.0 228.0 mg/100 g Monk fruit Type 1 Siraitia grosvenorii 0.003 0.003 0.003 mg/100 g Monkfish Type 1 specific Lophius piscatorius 8074 326.143 549.0 0.429 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 Moth bean Type 1 specific Vigna aconitifolia 3918 120.404 231.8 0.22 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 24.3036 57.5 0.018 mg/100 g Mugwort Type 1 specific Artemisia vulgaris 4220 Mulberry Type 1 specific Morus 3497 Mule deer Type 1 specific Odocoileus 9871 Multigrain bread Type 2 specific 144.0 150.0 138.0 mg/100 g Mundu Type 1 Garcinia dulcis Mung bean Type 1 specific Vigna radiata 157791 116.805733 300.25 0.286 mg/100 g Muscadine grape Type 1 specific Vitis rotundifolia 103349 Muskmelon Type 1 specific Cucumis melo 3656 7.222222 12.0 0.0 mg/100 g Mustard Type 2 specific 66.666667 100.0 0.0 mg/100 g Mustard spinach Type 1 specific Brassica perviridis Nachos Type 2 specific 146.5 181.0 97.0 mg/100 g Nance Type 1 specific Byrsonima crassifolia 4270 Nanking cherry Type 1 specific Prunus tomentosa 105667 Napa cabbage Type 1 specific Brassica rapa var. pekinensis 51351 8.333333 9.0 7.0 mg/100 g Naranjilla Type 1 specific Solanum quitoense 227725 Narrowleaf cattail Type 1 specific Typha angustifolia 59011 Natal plum Type 1 specific Carissa macrocarpa 403101 Natto Type 2 specific 208.0 208.0 208.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 4.501625 6.0 0.0065 mg/100 g New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 Nopal Type 1 specific Opuntia cochenillifera 338184 10.338333 16.0 0.015 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 525.23 885.0 0.69 mg/100 g Northern pike Type 1 specific Esox lucius 8010 325.3925 731.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 560.0 560.0 560.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.246 0.492 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Nutritional drink Type 2 specific 100.0 100.0 100.0 mg/100 g Nuts Unknown generic Oat Type 1 specific Avena sativa 4498 193.410385 335.0 0.0 mg/100 g Oat bread Type 2 specific 162.75 196.0 138.0 mg/100 g Ocean pout Type 1 specific Zoarces americanus 8199 374.497333 631.0 0.492 mg/100 g Ohelo berry Type 1 specific Vaccinium reticulatum 180767 Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Oil-seed Camellia Type 1 specific Camellia oleifera 385388 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 17.335667 21.0 0.021 mg/100 g Olive Type 1 specific Olea europaea 4146 2.6 14.0 0.0 mg/100 g Onion-family vegetables Unknown generic Opium poppy Type 1 specific Papaver somniferum 3469 494.55 502.0 487.1 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 41.6 73.2 10.0 mg/100 g Orange mint Type 1 specific Mentha aquatica 190902 Orange roughy Type 1 specific Hoplostethus atlanticus 96778 418.175333 728.0 0.526 mg/100 g Oregon yampah Type 1 specific Perideridia oregana 234866 Oriental wheat Type 1 specific Triticum turanicum 376534 120.417 251.0 0.251 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 0.598 0.615 0.565 mg/100 g Ostrich fern Type 1 specific Matteuccia struthiopteris 3277 Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 30.0 120.0 0.0 mg/100 g Other beverage Type 2 specific 61.75 120.0 4.0 mg/100 g Other bread Type 2 specific 112.5 218.0 0.0 mg/100 g Other bread product Type 2 specific 141.833333 233.0 0.0 mg/100 g Other candy Type 2 specific 49.166667 185.0 0.0 mg/100 g Other cereal product Type 2 specific Other dish Type 2 specific 216.21875 513.0 48.0 mg/100 g Other fermented milk Type 2 specific 90.5 93.0 88.0 mg/100 g Other fish product Type 2 specific 352.857143 515.0 0.0 mg/100 g Other frozen dessert Type 2 specific 23.333333 70.0 0.0 mg/100 g Other fruit product Type 2 specific 25.0 25.0 25.0 mg/100 g Other pasta dish Type 2 specific 73.0 73.0 73.0 mg/100 g Other sandwich Type 2 specific 290.8125 433.0 185.0 mg/100 g Other snack food Type 2 specific 152.368421 593.0 0.0 mg/100 g Other soy product Type 2 specific 714.083333 1150.0 41.0 mg/100 g Other vegetable product Type 2 specific 38.357143 59.0 17.0 mg/100 g Oval-leaf huckleberry Type 1 specific Vaccinium ovalifolium 190544 Oxheart cabbage Type 1 specific Brassica oleracea var. conica Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 90.680667 230.0 0.042 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 310.139333 512.0 0.418 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.616 0.616 0.616 mg/100 g Pacific herring Type 1 specific Clupea pallasii 30724 369.161667 622.0 0.485 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 343.297 686.0 0.594 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.244 0.488 0.0 mg/100 g Pacific oyster Type 1 specific Crassostrea gigas 29159 213.071 426.0 0.213 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 430.528 707.0 0.584 mg/100 g Pacific sardine Type 1 specific Sardinops sagax 28381 476.0 476.0 476.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 539.0 590.0 488.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 7.5015 9.0 0.009 mg/100 g Pancake Type 2 specific 147.615385 216.0 75.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 3.1904 9.95 0.002 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 119.515778 596.0 0.042 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 17.95 21.0 11.85 mg/100 g Partridge berry Type 1 Mitchella repens Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 140.482143 317.0 2.0 mg/100 g Pastry Type 2 specific 101.509434 238.0 0.0 mg/100 g Pate Type 2 specific 206.857143 340.0 0.0 mg/100 g Pea shoots Type 1 0.082 0.082 0.082 mg/100 g Peach Type 1 specific Prunus persica 3760 42.145739 180.0 0.002 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 0.002 0.002 0.002 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 277.888394 641.0 0.0 mg/100 g Peanut oil Type 2 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 5.684375 22.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 173.931917 200.0 0.183 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 34.186364 215.0 0.0 mg/100 g Pepper (C. baccatum) Type 1 specific Capsicum baccatum var. baccatum 165788 Pepper (C. chinense) Type 1 specific Capsicum chinense 80379 Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 109.9 109.9 109.9 mg/100 g Pepper (C. pubescens) Type 1 specific Capsicum pubescens 113210 Pepper (Capsicum) Type 1 specific Capsicum 4071 Pepper (Spice) Type 1 specific Piper nigrum 13216 32.032 96.0 0.0 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 26.5265 53.0 0.053 mg/100 g Perciformes Type 1 specific Perciformes 8111 452.0 762.0 0.0 mg/100 g Percoidei (Bass and others) Type 1 specific Percoidei 8112 547.075 736.0 0.525 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 1.334 2.0 0.002 mg/100 g Persimmon Type 1 specific Diospyros 13492 4.002333 6.0 0.007 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 0.698 0.71 0.686 mg/100 g Phyllo dough Type 2 specific 126.0 126.0 126.0 mg/100 g Pie Type 2 specific 70.142857 249.0 30.0 mg/100 g Pie crust Type 2 specific 84.9375 121.0 39.0 mg/100 g Pie filling Type 2 specific 2.0 2.0 2.0 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 124.8486 243.0 0.243 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Piki bread Type 2 specific Pili nut Type 1 specific Canarium ovatum 43691 197.6975 395.0 0.395 mg/100 g Pine nut Type 1 specific Pinus 3337 194.81475 260.0 0.259 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 8.484133 46.25 0.0 mg/100 g Pineappple sage Type 1 specific Salvia elegans 888065 Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 535.939571 693.0 0.577 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 310.001111 388.65 0.36 mg/100 g Pita bread Type 2 specific 157.666667 160.0 153.0 mg/100 g Pitanga Type 1 specific Eugenia uniflora 119951 Pitaya Type 1 Hylocereus undatus Pizza Type 2 specific 218.171429 461.0 0.0 mg/100 g Plains prickly pear Type 1 specific Opuntia macrorhiza 1041245 Plantain Type 1 Musa × paradisiaca Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 220.0 550.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.1 0.4 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Pomes Unknown generic Popcorn Type 2 specific 180.090909 252.0 73.0 mg/100 g Poppy Type 1 specific Papaver 3468 306.666667 460.0 0.0 mg/100 g Pot marjoram Type 1 specific Origanum onites 452416 Pot pie Type 2 specific 114.5 133.0 96.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 45.437586 153.0 0.0 mg/100 g Potato bread Type 2 specific 112.0 112.0 112.0 mg/100 g Potato chip Type 2 specific 106.833333 141.0 65.0 mg/100 g Potato gratin Type 2 specific 87.5 117.0 58.0 mg/100 g Potato puffs Type 2 specific 32.0 32.0 32.0 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 25.3 25.3 25.3 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Processed cheese Type 2 specific 405.666667 567.0 282.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 3.25 5.0 2.0 mg/100 g Pudding Type 2 specific 47.857143 74.0 0.0 mg/100 g Pulses Unknown generic Pummelo Type 1 specific Citrus maxima 37334 Pumpkinseed sunfish Type 1 specific Lepomis gibbosus 270329 436.858 736.0 0.574 mg/100 g Pupusa Type 2 specific 238.0 346.0 100.0 mg/100 g Purple laver Type 1 specific Porphyra laciniata 72.5725 145.0 0.145 mg/100 g Purple mangosteen Type 1 specific Garcinia mangostana 58228 Purslane Type 1 specific Portulaca oleracea 46147 46.3 145.2 12.0 mg/100 g Quail Type 1 specific Phasianidae 9005 499.17225 716.0 0.689 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 135.103 309.0 0.309 mg/100 g Rabbit Type 1 specific Leporidae 9979 546.309 826.0 0.545 mg/100 g Rabbiteye blueberry Type 1 specific Vaccinium virgatum Radish Type 1 specific Raphanus sativus 3726 19.652 71.25 0.01 mg/100 g Radish (var.) Type 1 specific Raphanus sativus var. sativus 240228 Rainbow smelt Type 1 specific Osmerus mordax 8014 397.174 669.0 0.522 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 330.20075 738.0 0.0 mg/100 g Raisin bread Type 2 specific 131.666667 139.0 128.0 mg/100 g Rambutan Type 1 specific Nephelium lappaceum 151071 Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Rapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Rapini Type 1 specific Brassica ruvo 1204434 53.0 58.0 48.0 mg/100 g Ravioli Type 2 specific 63.5 77.0 50.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 Red beetroot Type 1 specific Beta vulgaris var. rubra 15.65 75.55 4.0 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 741.167857 10000.0 5.0 mg/100 g Red clover Type 1 Trifolium pratense Red grape Type 1 Red huckleberry Type 1 specific Vaccinium parvifolium 180766 Red king crab Type 1 specific Paralithodes camtschaticus 6741 353.505 545.0 0.515 mg/100 g Red onion Type 1 Red raspberry Type 1 specific Rubus idaeus 32247 Red rice Type 1 specific Oryza rufipogon 4529 0.179 0.179 0.179 mg/100 g Red tea Type 1 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Relish Type 2 specific 9.666667 18.0 4.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 133.06383 310.0 0.0 mg/100 g Rice bread Type 2 specific 162.5 169.0 156.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 5.933333 23.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Rocket salad Type 1 specific Eruca vesicaria 180536 Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 Roe Type 2 generic 477.38825 710.0 0.553 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 11.266667 15.0 3.8 mg/100 g Roman camomile Type 1 specific Chamaemelum nobile 99037 Root vegetables Unknown generic Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Roselle Type 1 specific Hibiscus sabdariffa 183260 Rosemary Type 1 specific Rosmarinus officinalis 39367 23.5235 47.0 0.047 mg/100 g Rowal Type 1 specific Pangium edule 112823 Rowanberry Type 1 specific Sorbus aucuparia 36599 Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 127.457357 263.25 0.0 mg/100 g Rye bread Type 2 specific 66.714286 172.0 0.0 mg/100 g Sablefish Type 1 specific Anoplopoma fimbria 229290 357.34925 523.0 0.397 mg/100 g Sacred lotus Type 1 specific Nelumbo nucifera 4432 51.72 145.1 14.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 113.625 625.0 0.0 mg/100 g Saffron Type 1 specific Crocus sativus 82528 Sago palm Type 1 specific Metroxylon sagu 93297 Salad Type 2 specific 83.909091 211.0 7.0 mg/100 g Salad dressing Type 2 specific 20.540541 132.0 0.0 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 566.916667 860.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Salted butter Type 1 0.021 0.021 0.021 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 1.5015 3.0 0.003 mg/100 g Saskatoon berry Type 1 specific Amelanchier alnifolia 32219 0.2 0.2 0.2 mg/100 g Sauce Type 2 specific 33.0 243.0 0.0 mg/100 g Sausage Type 2 specific 324.396226 724.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 13.34 20.0 0.02 mg/100 g Scallop Type 1 specific Pectinidae 6566 283.6034 487.0 0.017 mg/100 g Scarlet bean Type 1 specific Phaseolus coccineus 3886 Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 500.0 550.0 390.0 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 425.186333 716.0 0.559 mg/100 g Sea trout Type 1 specific Salmo trutta forma trutta 13028 377.165333 635.0 0.496 mg/100 g Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 Semolina Type 2 specific 174.0 198.0 150.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 616.147091 1656.0 0.0 mg/100 g Sesame oil Type 2 0.0 0.0 0.0 mg/100 g Sesbania flower Type 1 specific Sesbania bispinosa 485725 11.004 16.0 0.016 mg/100 g Shallot Type 1 specific Allium ascalonicum 1476995 53.675667 134.0 0.027 mg/100 g Shark Type 1 specific Squaliformes 282414 387.540333 621.0 0.621 mg/100 g Shea tree Type 1 specific Vitellaria paradoxa 292385 0.0 0.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 315.315 630.0 0.63 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 412.222222 520.0 220.0 mg/100 g Sheepshead Type 1 specific Archosargus probatocephalus 119682 456.199333 770.0 0.598 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 49.172167 179.0 0.033 mg/100 g Shortening Type 2 specific 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 471.8 690.0 280.0 mg/100 g Silver linden Type 1 specific Tilia argentea Skipjack tuna Type 1 specific Katsuwonus pelamis 8226 495.550333 835.0 0.651 mg/100 g Skunk currant Type 1 specific Ribes glandulosum 175226 Small-leaf linden Type 1 specific Tilia cordata 172266 Smelt Type 1 specific Osmeridae 8012 1240.0 1240.0 1240.0 mg/100 g Snack bar Type 2 specific 149.642857 345.0 25.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Snapper Type 1 specific Lutjanidae 30850 461.869 778.0 0.607 mg/100 g Snow crab Type 1 specific Chionoecetes opilio 41210 594.5 668.0 521.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 664.2721 910.0 0.721 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 64.638 129.2 0.076 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 101.389667 169.0 0.169 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 35.0 35.0 35.0 mg/100 g Soup Type 2 specific 61.366197 320.0 7.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 Sour cream Type 2 73.0 73.0 73.0 mg/100 g Sour orange Type 1 Citrus × aurantium Sourdock Type 1 specific Rumex articus 395311 Sourdough Type 2 specific Soursop Type 1 specific Annona muricata 13337 9.669 22.0 0.007 mg/100 g Soy bean Type 1 specific Glycine max 3847 346.132175 1150.0 0.0 mg/100 g Soy cream Type 2 specific Soy milk Type 2 specific 17.8 27.0 0.0 mg/100 g Soy sauce Type 2 specific 85.861167 167.0 0.167 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 423.190333 698.0 0.571 mg/100 g Sparkleberry Type 1 specific Vaccinium arboreum 229201 Spearmint Type 1 specific Mentha spicata 29719 109.015333 281.0 0.046 mg/100 g Spelt Type 1 specific Triticum spelta 58933 129.129 258.0 0.258 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 55.778313 341.2 0.053 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spiny lobster Type 1 specific Palinuridae 6731 441.526667 744.0 0.58 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spirulina Type 1 specific Spirulina 551299 422.372667 1149.0 0.118 mg/100 g Spot croaker Type 1 specific Leiostomus xanthurus 59837 416.849333 702.0 0.548 mg/100 g Spread Type 2 specific 285.166667 475.0 23.0 mg/100 g Squab Type 1 specific Columba 8931 0.554 0.554 0.554 mg/100 g Squashberry Type 1 specific Viburnum edule 237934 Squid Type 1 specific Teuthida 551290 251.450333 403.0 0.351 mg/100 g Star anise Type 1 specific Illicium verum 124778 Star fruit Type 1 specific Averrhoa carambola 28974 26.2042 66.0 0.021 mg/100 g Steller sea lion Type 1 specific Eumetopias jubatus 34886 150.0 300.0 0.0 mg/100 g Stew Type 2 specific 154.5 211.0 90.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 6.0 10.0 1.0 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 5.418 12.25 0.004 mg/100 g Striped bass Type 1 specific Morone saxatilis 34816 399.508333 673.0 0.525 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 435.857667 734.0 0.573 mg/100 g Stuffing Type 2 specific 156.0 156.0 156.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.1195 0.478 0.0 mg/100 g Succotash Type 2 specific 56.0 68.0 35.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar apple Type 1 specific Annona squamosa 301693 11.75 16.5 7.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Summer grape Type 1 specific Vitis aestivalis 3605 Summer savory Type 1 specific Satureja hortensis 49987 Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 258.836364 603.0 13.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 361.823529 1286.0 0.0 mg/100 g Sunflower oil Type 2 0.0 0.0 0.0 mg/100 g Swamp cabbage Type 1 specific Ipomoea aquatica 89636 107.0625 314.25 35.0 mg/100 g Swede Type 1 specific Brassica napus 3708 6.0 10.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 139.509 320.0 0.036 mg/100 g Sweet bay Type 1 specific Laurus nobilis 85223 Sweet cherry Type 1 specific Prunus avium 42229 10.0 10.0 10.0 mg/100 g Sweet custard Type 2 specific 98.6 153.0 74.0 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 Sweet orange Type 1 specific Citrus sinensis 2711 11.119048 85.5 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 37.092227 87.0 0.029 mg/100 g Sweet rowanberry Type 1 specific Grataegosorbus mitschurinii Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 16.169833 20.0 0.019 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 428.528667 699.0 0.586 mg/100 g Syrup Type 2 specific 44.25 110.0 0.0 mg/100 g Taco Type 2 specific 194.333333 315.0 120.0 mg/100 g Taco shell Type 2 165.5 180.0 151.0 mg/100 g Tallow Type 2 specific 155.428571 520.0 0.0 mg/100 g Tamale Type 2 specific 135.0 188.0 67.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 11.8428 17.2 0.014 mg/100 g Tapioca pearl Type 2 specific 1.001 2.0 0.002 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 62.002222 315.0 0.02 mg/100 g Tarragon Type 1 specific Artemisia dracunculus 72341 Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Tea leaf willow Type 1 specific Salix pulchra 669814 Teff Type 1 specific Eragrostis tef 110835 184.476 428.0 0.428 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 714.153846 862.0 470.0 mg/100 g Tilefish Type 1 specific Lopholatilus chamaeleonticeps 390349 414.506 725.0 0.518 mg/100 g Tinda Type 1 specific Citrullus lanatus var. fistulosus Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 147.663429 613.0 0.0 mg/100 g Topping Type 2 specific 72.166667 149.0 30.0 mg/100 g Tortilla Type 2 specific 132.0 155.0 118.0 mg/100 g Tortilla chip Type 2 specific 164.5 181.0 154.0 mg/100 g Tostada Type 2 specific 155.25 260.0 96.0 mg/100 g Tostada shell Type 2 Towel gourd Type 1 specific Luffa aegyptiaca 3670 Trail mix Type 2 specific 196.8 217.0 146.0 mg/100 g Tree fern Type 1 specific Cyathea Triticale Type 1 specific X Triticosecale rimpaui 136.734667 206.0 0.204 mg/100 g Tronchuda cabbage Type 1 specific Brassica oleracea var. costata 416546 True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 230.0 230.0 230.0 mg/100 g True seal Type 1 specific Phocidae 9709 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 270.2275 540.0 0.455 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 404.895 609.0 0.475 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 262.598667 560.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.14 0.14 0.14 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 29.91955 76.0 0.011 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 110.0 440.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 6.111111 12.0 0.0 mg/100 g Vanilla Type 1 specific Vanilla 51238 Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Vegetarian food Type 2 specific 302.5 520.0 146.0 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 142.8 179.0 120.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 31.5315 63.0 0.063 mg/100 g Walleye Type 1 specific Sander vitreus 283036 646.0 726.0 566.0 mg/100 g Walnut Type 1 specific Juglans 16718 48.0934 240.0 0.0 mg/100 g Wampee Type 1 Clausena lansium Wasabi Type 1 specific Wasabia japonica 75806 Water Type 2 specific 0.0 0.0 0.0 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.053 0.053 0.053 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 52.004 210.0 0.02 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 214.415143 834.0 0.006 mg/100 g Wax apple Type 1 specific Eugenia javanica 119950 Wax gourd Type 1 specific Benincasa hispida 102211 9.8006 40.0 0.003 mg/100 g Welsh onion Type 1 specific Allium fistulosum 35875 10.5105 21.0 0.021 mg/100 g Wheat Type 1 specific Triticum 4564 187.77907 480.0 0.0 mg/100 g Wheat bread Type 2 specific 113.411765 191.0 0.0 mg/100 g Whelk Type 1 specific Buccinidae 37796 602.867667 1205.0 0.603 mg/100 g Whey Type 2 specific 184.4 420.0 14.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 159.117647 218.0 0.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 23.488333 86.2 9.0 mg/100 g White lupine Type 1 specific Lupinus albus 3870 186.25 270.0 110.0 mg/100 g White mulberry Type 1 Morus alba White mustard Type 1 specific Sinapis alba 3728 352.6 496.8 78.0 mg/100 g White sucker Type 1 specific Catostomus commersonii 7971 377.498667 636.0 0.496 mg/100 g White wine Type 2 6.275 8.1 4.9 mg/100 g Whitefish Type 1 specific Coregonus 27772 611.795 1740.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 309.3855 695.0 0.0 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 0.53 0.53 0.53 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 16.12725 32.25 0.0045 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 12.500714 58.5 0.005 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 43.6036 180.0 0.018 mg/100 g Wild rice Type 1 specific Zizania 15949 185.812667 438.0 0.438 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 192.165143 372.2 0.356 mg/100 g Winter savory Type 1 specific Satureja montana 49988 Winter squash Type 1 specific Cucurbita maxima 3661 13.728182 25.0 0.01 mg/100 g Wonton wrapper Type 2 specific 176.0 176.0 176.0 mg/100 g Yali pear Type 1 specific Pyrus × bretschneideri Yam Type 1 specific Dioscorea 4672 17.170167 21.0 0.021 mg/100 g Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 137.843333 361.95 0.04 mg/100 g Yau choy Type 1 Yautia Type 1 specific Xanthosoma sagittifolium 28478 Yellow bell pepper Type 1 specific Capsicum annuum 4072 24.05 73.2 5.0 mg/100 g Yellow pond-lily Type 1 specific Nuphar lutea 77113 Yellow wax bean Type 1 specific Phaseolus vulgaris 3885 57.75 331.0 9.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 28.305692 143.0 0.014 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 506.564 827.0 0.692 mg/100 g Yellowtail amberjack Type 1 specific Seriola lalandi 302047 521.228333 878.0 0.685 mg/100 g Ymer Type 2 specific 185.0 190.0 180.0 mg/100 g Yogurt Type 2 specific 98.852941 169.0 0.0 mg/100 g Zwieback Type 2 specific Glutamine synthetase P15104 GLUL Kynurenine--oxoglutarate transaminase 1 Q16773 CCBL1 Kynurenine--oxoglutarate transaminase 3 Q6YP21 CCBL2 Methionine--tRNA ligase, cytoplasmic P56192 MARS Methionine--tRNA ligase, mitochondrial Q96GW9 MARS2 Methionine-R-sulfoxide reductase B1 Q9NZV6 MSRB1 Methionine-R-sulfoxide reductase B2, mitochondrial Q9Y3D2 MSRB2 Methionine-R-sulfoxide reductase B3 Q8IXL7 MSRB3 Mitochondrial peptide methionine sulfoxide reductase Q9UJ68 MSRA Tyrosine aminotransferase P17735 TAT anti cataract 168 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti eczemic 247 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti hepatotic 327 Any compound that is able to prevent damage to the liver. anti Parkinsonian 509 A drug used in the treatment of Parkinson's disease. antidote 236 Any protective agent counteracting or neutralizing the action of poisons. antioxidant 502 A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. In European countries, E-numbers for permitted antioxidant food additives are from E 300 to E 324. cancer preventive 754 A substance that inhibits or prevents the proliferation of neoplasms. emetic 899 essential 920 glutathionigenic 958 hepatoprotective 981 Any compound that is able to prevent damage to the liver. lipotropic 1075 urine acidifier 1399 urine deodorant 1400