1.0 2010-04-08 22:11:22 UTC 2019-11-26 03:10:27 UTC FDB014613 beta-Carotene Yellow food colour, dietary supplement, nutrient, Vitamin A precursor. Nutriceutical with antioxidation props. beta-Carotene is found in many foods, some of which are summer savory, gram bean, sunburst squash (pattypan squash), and other bread product. (all-e)-1,1'-(3,7,12,16-Tetramethyl-1,3,5,7,9,11,13,15,17-octadecanonaene-1,18-diyl)bis (all-e)-1,1'-(3,7,12,16-Tetramethyl-1,3,5,7,9,11,13,15,17-octadecanonaene-1,18-diyl)bis[2,6,6-trimethyl-cyclohexene &beta;-Carotene &beta;,&beta;-Carotene 1,1'-[(1e,3e,5e,7e,9e,11e,13e,15e,17e)-3,7,12,16-Tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaene-1,18-diyl]bis(2,6,6-trimethylcyclohexene) all-e-b-Carotene all-epsilon-beta-Carotene all-trans-b-Carotene all-trans-beta-Carotene all-trans-β-carotene b-Carotene b-Karotin b,b-Carotene beta-Karotin Betacarotene Betacarotene, INN, USAN BetaVit C.I. Food Orange 5 Carotaben Carotene base 80S E160a Food Orange 5 KPMK Lucaratin Lucarotin Lurotin Phenoro Provatene Provatenol Rovimix b-carotene Serlabo Solatene trans-b-carotene Vetoron β-carotene β-karotin C40H56 536.888 536.438201803 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohex-1-en-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl]cyclohex-1-ene β-carotene 7235-40-7 C\C(\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C)CCCC1(C)C InChI=1S/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-22,25-28H,15-16,23-24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+ OENHQHLEOONYIE-JLTXGRSLSA-N belongs to the class of organic compounds known as carotenes. These are a type of unsaturated hydrocarbons containing eight consecutive isoprene units. They are characterized by the presence of two end-groups (mostly cyclohexene rings, but also cyclopentene rings or acyclic groups) linked by a long branched alkyl chain. Carotenes belonging form a subgroup of the carotenoids family. Carotenes Organic compounds Lipids and lipid-like molecules Prenol lipids Tetraterpenoids Aliphatic homomonocyclic compounds Branched unsaturated hydrocarbons Cycloalkenes Unsaturated aliphatic hydrocarbons Aliphatic homomonocyclic compound Branched unsaturated hydrocarbon Carotene Cyclic olefin Cycloalkene Hydrocarbon Olefin Unsaturated aliphatic hydrocarbon Unsaturated hydrocarbon C40 isoprenoids (tetraterpenes) C40 isoprenoids (tetraterpenes) Carotenoids cyclic carotene Solid logp 9.72 ALOGPS logs -6.14 ALOGPS solubility 3.91e-04 g/l ALOGPS melting_point Mp 183° (sealed tube) logp 11.12 ChemAxon iupac 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohex-1-en-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl]cyclohex-1-ene ChemAxon average_mass 536.888 ChemAxon mono_mass 536.438201803 ChemAxon smiles C\C(\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C)CCCC1(C)C ChemAxon formula C40H56 ChemAxon inchi InChI=1S/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-22,25-28H,15-16,23-24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+ ChemAxon inchikey OENHQHLEOONYIE-JLTXGRSLSA-N ChemAxon polar_surface_area 0 ChemAxon refractivity 191.61 ChemAxon polarizability 72.05 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Retinol Metabolism SMP00074 map00830 Specdb::EiMs 1774 Specdb::NmrTwoD 1364 Specdb::NmrOneD 273658 Specdb::NmrOneD 273659 Specdb::NmrOneD 273660 Specdb::NmrOneD 273661 Specdb::NmrOneD 273662 Specdb::NmrOneD 273663 Specdb::NmrOneD 273664 Specdb::NmrOneD 273665 Specdb::NmrOneD 273666 Specdb::NmrOneD 273667 Specdb::NmrOneD 273668 Specdb::NmrOneD 273669 Specdb::NmrOneD 273670 Specdb::NmrOneD 273671 Specdb::NmrOneD 273672 Specdb::NmrOneD 273673 Specdb::NmrOneD 273674 Specdb::NmrOneD 273675 Specdb::NmrOneD 273676 Specdb::NmrOneD 273677 Specdb::CMs 22043 Specdb::MsMs 782 Specdb::MsMs 783 Specdb::MsMs 784 Specdb::MsMs 4191 Specdb::MsMs 179661 Specdb::MsMs 179662 Specdb::MsMs 179663 Specdb::MsMs 181995 Specdb::MsMs 181996 Specdb::MsMs 181997 Specdb::MsMs 451859 Specdb::MsMs 2813936 Specdb::MsMs 2813937 Specdb::MsMs 2813938 Specdb::MsMs 2891832 Specdb::MsMs 2891833 Specdb::MsMs 2891834 HMDB00561 17579 BCR #<Reference:0x0000561272e644e0> #<Reference:0x0000561272e64300> #<Reference:0x0000561272e64148> #<Reference:0x0000561272e63f40> #<Reference:0x0000561272e63d38> #<Reference:0x0000561272e63b58> #<Reference:0x0000561272e63928> #<Reference:0x0000561272e63608> #<Reference:0x0000561272e63310> #<Reference:0x0000561272e63090> #<Reference:0x0000561272e62eb0> #<Reference:0x0000561272e62cd0> #<Reference:0x0000561272e62af0> #<Reference:0x0000561272e627f8> #<Reference:0x0000561272e62640> #<Reference:0x0000561272e62460> #<Reference:0x0000561272e62280> #<Reference:0x0000561272e61f38> #<Reference:0x0000561272e61c90> #<Reference:0x0000561272e61998> Abalone Type 1 specific Haliotis 6452 0.0 0.0 0.0 mg/100 g Abiyuch Type 1 specific Crateva religiosa 202634 30.03 60.0 0.06 mg/100 g Acerola Type 1 specific Malpighia emarginata 151847 0.305 0.305 0.305 mg/100 g Acorn squash Type 1 Cucurbita pepo var. turbinata 220.0 220.0 220.0 mg/100 g Adobo Type 2 specific 0.126 0.126 0.126 mg/100 g Adzuki bean Type 1 specific Vigna angularis 3914 0.016667 0.05 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Agave Type 1 specific Agave 39509 5.52525 22.0 0.011 mg/100 g Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 0.069 0.069 0.069 mg/100 g Alaska pollock Type 1 specific Theragra chalcogramma 1042646 0.0 0.0 0.0 mg/100 g Albacore tuna Type 1 specific Thunnus alalunga 8235 0.0 0.0 0.0 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 14.5465 87.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 0.414864 3.0 0.0 mg/100 g Allspice Type 1 specific Pimenta dioica 375272 11.15 11.15 11.15 mg/100 g Almond Type 1 specific Prunus dulcis 3755 1.334233 17.0 0.0 mg/100 g Almond milk Type 1 0.0 0.0 0.0 mg/100 g Amaranth Type 1 specific Amaranthus 3564 8.800333 25.4 0.001 mg/100 g American cranberry Type 1 specific Vaccinium macrocarpon 13750 0.0456 0.14 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.0 0.0 0.0 mg/100 g American pokeweed Type 1 specific Phytolacca americana 3527 14.696667 33.65 5.22 mg/100 g American shad Type 1 specific Alosa sapidissima 34773 0.0 0.0 0.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 0.0 0.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.0 0.0 0.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 0.0 0.0 0.0 mg/100 g Annual wild rice Type 1 specific Zizania aquatica 75727 Apple Type 1 specific Malus pumila 283210 0.26269 3.8 0.0 mg/100 g Apple cider Type 2 specific 0.0 0.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 31.866105 575.5 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 0.087423 2.25 0.0 mg/100 g Arepa Type 2 specific 0.007 0.007 0.007 mg/100 g Arrowroot Type 1 specific Maranta arundinacea 210060 5.5055 11.0 0.011 mg/100 g Asian pear Type 1 specific Pyrus pyrifolia 3767 0.0 0.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 8.390941 132.0 0.0 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 0.0 0.0 0.0 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 0.0 0.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0008 0.001 0.0 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 0.0 0.0 0.0 mg/100 g Atlantic mackerel Type 1 specific Scomber scombrus 13677 0.0 0.0 0.0 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 0.0 0.0 0.0 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 7.939286 54.0 0.016 mg/100 g Babassu palm Type 1 specific Attalea speciosa 145700 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 0.323089 7.156 0.0 mg/100 g Bagel Type 2 specific 0.000833 0.002 0.0 mg/100 g Baked beans Type 2 specific 0.043 0.065 0.005 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 1.337333 12.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 5.545 22.0 0.026 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 6.518615 40.45 0.0 mg/100 g Bean Type 1 specific 0.0515 0.137 0.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 0.0 0.0 0.0 mg/100 g Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 0.0 0.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.799833 2.3735 0.013 mg/100 g Biscuit Type 2 specific 0.017552 0.174 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 0.0 0.0 0.0 mg/100 g Bitter gourd Type 1 specific Momordica charantia 3673 8.0095 40.0 0.068 mg/100 g Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 0.0 0.0 0.0 mg/100 g Black cabbage Type 1 specific Brassica oleracea var. viridis 3713 5.436 6.818 3.842 mg/100 g Black elderberry Type 1 specific Sambucus nigra 4202 13.75 15.0 12.5 mg/100 g Black mulberry Type 1 specific Morus nigra 85232 0.009 0.009 0.009 mg/100 g Black raisin Type 1 0.0 0.0 0.0 mg/100 g Black salsify Type 1 specific Scorzonera hispanica 114289 0.02 0.02 0.02 mg/100 g Black tea Type 1 0.44448 5.55 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 4.8468 24.0 0.0 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 3.886 30.0 0.009 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.073636 0.45 0.0 mg/100 g Blue cheese Type 2 74.0 74.0 74.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 0.0 0.0 0.0 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 0.0 0.0 0.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Borage Type 1 specific Borago officinalis 13363 19.25 19.25 19.25 mg/100 g Boysenberry Type 1 specific Rubus ursinus X idaeus 0.04 0.04 0.04 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 0.11425 0.45 0.0 mg/100 g Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 2.0 2.0 2.0 mg/100 g Breakfast cereal Type 2 specific 0.02068 2.267 0.0 mg/100 g Breakfast sandwich Type 2 specific 0.016923 0.042 0.0 mg/100 g Broad bean Type 1 specific Vicia faba 3906 0.156 0.655 0.009 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 2.488722 32.0 0.361 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 6.3225 95.0 0.0 mg/100 g Bulgur Type 2 specific 1.668667 5.0 0.001 mg/100 g Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Burdock Type 1 specific Arctium lappa 4217 0.09 0.45 0.0 mg/100 g Burrito Type 2 specific 0.056222 0.144 0.016 mg/100 g Butter Type 2 specific 16.0142 158.0 0.107 mg/100 g Butter substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Butterfat Type 2 specific 0.193 0.193 0.193 mg/100 g Buttermilk Type 2 specific 0.780978 7.0 0.001 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 704.854 3509.0 1.904 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 28.315 56.0 0.63 mg/100 g Cake Type 2 specific 0.013769 0.131 0.0 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 Candy bar Type 2 specific 0.001688 0.01 0.0 mg/100 g Canola Type 2 specific 138011 0.0 0.0 0.0 mg/100 g Cantaloupe melon Type 1 Cucumis melo var. cantalupensis 1420.0 1420.0 1420.0 mg/100 g Capers Type 1 specific Capparis spinosa 65558 41.5415 83.0 0.083 mg/100 g Caraway Type 1 specific Carum carvi 48032 254.135333 762.0 0.2 mg/100 g Carob Type 1 specific Ceratonia siliqua 20340 0.008 0.008 0.008 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 11.063654 35.0 5.331 mg/100 g Casein Type 2 specific 0.0 0.0 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 0.311429 3.03 0.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 3.104 8.0 0.006 mg/100 g Catfish Type 1 specific Siluriformes 7995 0.0 0.0 0.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 0.004136 0.951 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.023647 0.093 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 0.02 0.03 0.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 0.0 0.0 0.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 187.0 187.0 187.0 mg/100 g Cereals and cereal products Unknown generic Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Ceylon cinnamon Type 1 specific Cinnamomum verum 128608 0.15 0.15 0.15 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 0.0 0.0 0.0 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 1.3 1.3 1.3 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 1.772 8.8 0.0 mg/100 g Cheese Type 2 specific 0.115463 7.0 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.1048 0.5 0.002 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 2.23 2.99 1.47 mg/100 g Chestnut Type 1 specific Castanea 21019 0.06 0.06 0.06 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 0.0 0.0 0.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 3.687091 40.0 0.009 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 430.6095 3430.0 0.0 mg/100 g Chili Type 2 specific 0.162 0.233 0.007 mg/100 g Chinese broccoli Type 1 specific Brassica alboglabra 3714 516.4915 1032.0 0.983 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 670.635 2681.0 0.1 mg/100 g Chinese chives Type 1 specific Allium tuberosum 4683 2612.0 2612.0 2612.0 mg/100 g Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 0.131 0.15 0.112 mg/100 g Chinese mustard Type 1 specific Brassica juncea 3707 3.8155 6.3 0.513 mg/100 g Chinese water chestnut Type 1 specific Eleocharis dulcis 110284 0.0 0.0 0.0 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 0.0 0.0 0.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 528.5644 2612.0 1.38 mg/100 g Chocolate Type 2 specific 0.031867 0.045 0.0 mg/100 g Chocolate mousse Type 2 specific 0.027 0.027 0.027 mg/100 g Chocolate spread Type 2 specific 3.200333 4.8 0.001 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 0.0 0.0 0.0 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 58.408 175.0 0.112 mg/100 g Cisco Type 1 specific Coregonus artedi 36181 0.0 0.0 0.0 mg/100 g Clam Type 1 0.0 0.0 0.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.0 0.0 0.0 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 8.598333 25.5 0.045 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 0.0 0.0 0.0 mg/100 g Cocktail Type 2 specific 0.0015 0.002 0.001 mg/100 g Cocoa bean Type 1 specific Theobroma cacao 3641 Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 0.005176 0.04 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.0 0.0 0.0 mg/100 g Coconut milk Type 1 0.0 0.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 0.00092 0.009 0.0 mg/100 g Coffee mocha Type 2 specific 0.002 0.002 0.002 mg/100 g Coffee substitute Type 2 specific 0.001667 0.005 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 0.0 0.0 0.0 mg/100 g Cold cut Type 2 specific 0.0 0.0 0.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 0.0 0.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 0.347621 13.895 0.0 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 3.009727 20.0 0.013 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.002667 0.012 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.733318 9.226 0.008 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 0.0 0.0 0.0 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 0.058 0.09 0.026 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 2.958 16.194 0.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 5.26 10.5 0.02 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.002667 0.01 0.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 70.102333 205.0 1.007 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.489433 1.25 0.0 mg/100 g Common sage Type 1 specific Salvia officinalis 38868 3.5675 3.65 3.485 mg/100 g Common salsify Type 1 specific Tragopogon porrifolius 13731 0.004467 0.0134 0.0 mg/100 g Common thyme Type 1 specific Thymus vulgaris 49992 1024.513 2851.0 2.264 mg/100 g Common verbena Type 1 specific Verbena officinalis 79772 Common walnut Type 1 specific Juglans regia 51240 7.687333 23.0 0.012 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 0.0062 0.011 0.005 mg/100 g Conch Type 1 specific Strombidae 69694 0.0 0.0 0.0 mg/100 g Condensed milk Type 2 specific 0.014 0.014 0.014 mg/100 g Cooking oil Type 2 specific 0.0 0.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 143.3047 1405.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 1.205181 97.0 0.0 mg/100 g Corn chip Type 2 specific 0.0186 0.051 0.0 mg/100 g Corn grits Type 2 specific 0.062143 0.666 0.0 mg/100 g Cornbread Type 2 specific 0.028 0.028 0.028 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Cottonseed oil Type 2 0.0 0.0 0.0 mg/100 g Couscous Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 0.002 0.002 0.002 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 0.004 0.004 0.004 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 0.007 0.007 0.007 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 0.794 0.794 0.794 mg/100 g Crab Type 1 specific Brachyura 6752 0.0 0.0 0.0 mg/100 g Cracker Type 2 specific 0.005962 0.063 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 5.90896 72.0 0.003 mg/100 g Cream substitute Type 2 specific 0.0095 0.045 0.0 mg/100 g Crisp bread Type 2 specific 0.006182 0.01 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 2.127182 45.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 1.125289 6.94 0.005 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 254.470667 762.0 0.65 mg/100 g Cupuaçu Type 1 specific Theobroma grandiflorum 108881 0.0 0.0 0.0 mg/100 g Curry powder Type 2 specific 0.593333 0.594 0.592 mg/100 g Custard apple Type 1 specific Annona reticulata 301862 0.01 0.01 0.01 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.504444 4.5 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 981.7535 5854.0 3.94 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 2.9775 17.5 0.006 mg/100 g Deer Type 1 specific Cervidae 9850 0.0 0.0 0.0 mg/100 g Dessert wine Type 2 0.0 0.0 0.0 mg/100 g Dill Type 1 specific Anethum graveolens 40922 2.991 5.982 0.0 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 0.0 0.0 0.0 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 0.001629 0.324 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 0.036496 0.118 0.001 mg/100 g Dripping Type 2 specific 0.0 0.0 0.0 mg/100 g Dulce de leche Type 2 specific 0.014 0.014 0.014 mg/100 g Dumpling Type 2 specific 0.0 0.0 0.0 mg/100 g Durian Type 1 specific Durio zibethinus 66656 0.859333 2.5 0.023 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 0.0 0.0 0.0 mg/100 g Edible shell Type 2 specific 0.003 0.003 0.003 mg/100 g Egg roll Type 2 specific 1.998 3.845 0.524 mg/100 g Egg substitute Type 2 specific 33.78375 135.0 0.0 mg/100 g Egg yolk Type 1 0.0 0.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 2.098889 18.5 0.0 mg/100 g Eggs Unknown generic 0.026816 0.246 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 0.108333 0.325 0.0 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 0.0 0.0 0.0 mg/100 g Empanada Type 2 specific 0.073 0.073 0.073 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 0.0 0.0 0.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 188.392857 1300.0 1.23 mg/100 g Energy drink Type 2 specific 0.0 0.0 0.0 mg/100 g Epazote Type 1 specific Dysphania ambrosioides 330163 19.019 38.0 0.038 mg/100 g European anchovy Type 1 specific Engraulis encrasicolus 184585 0.0 0.0 0.0 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 0.014 0.014 0.014 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.5094 2.22 0.002 mg/100 g Evaporated milk Type 2 specific 0.009 0.015 0.0 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 1.001 2.0 0.002 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 84.514 578.0 0.05 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 7.55 15.05 0.05 mg/100 g Fig Type 1 specific Ficus carica 3494 0.0984 0.815 0.0 mg/100 g Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.0 0.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.002006 0.01605 0.0 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 0.0 0.0 0.0 mg/100 g Flour Type 2 specific Focaccia Type 2 specific 0.001 0.001 0.001 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 0.552667 0.68 0.369 mg/100 g French toast Type 2 specific 0.0345 0.066 0.003 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 0.0 0.0 0.0 mg/100 g Frozen yogurt Type 2 specific 0.0098 0.012 0.008 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.007792 0.079 0.0 mg/100 g Fruit preserve Type 2 specific 0.0205 0.05 0.0 mg/100 g Fruit salad Type 2 specific 0.146667 0.254 0.104 mg/100 g Fruit-flavor drink Type 2 specific 0.008133 0.219 0.0 mg/100 g Fudge Type 2 specific 0.0116 0.017 0.01 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.0 0.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 598.855714 4150.0 2.48 mg/100 g Garden onion Type 1 specific Allium cepa 4679 3.725 8.5 1.0 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 1.0 1.0 1.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 6.2536 61.0 0.044 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 3.843382 103.5 0.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 54.75 103.5 6.0 mg/100 g Garfish Type 1 specific Belone belone 129037 0.0 0.0 0.0 mg/100 g Garland chrysanthemum Type 1 specific Chrysanthemum coronarium 99038 103.477667 527.0 1.38 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.715 5.0 0.0 mg/100 g Gelatin Type 2 specific 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 12.0 12.0 12.0 mg/100 g Giant butterbur Type 1 specific Petasites japonicus 186965 0.0265 0.0265 0.0265 mg/100 g Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.036333 0.2 0.0 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 0.25 0.25 0.25 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 1.00675 8.0 0.007 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.298 0.73 0.082 mg/100 g Gram bean Type 1 specific Vigna mungo 3915 0.024333 0.035 0.019 mg/100 g Grape Type 1 specific Vitis 3603 4.815714 59.0 0.0 mg/100 g Grape wine Type 2 specific 0.000036 0.001 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.087533 0.686 0.0 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 1047.5 1047.5 1047.5 mg/100 g Grapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Greater sturgeon Type 1 specific Acipenser 7901 0.0 0.0 0.0 mg/100 g Greek feta cheese Type 2 3.0 3.0 3.0 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 0.283538 0.42 0.104 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 0.577 3.177 0.096 mg/100 g Green cabbage Type 1 Brassica oleracea var. sabauda L. 42.0 42.0 42.0 mg/100 g Green lentil Type 1 Lens culinaris 23.0 23.0 23.0 mg/100 g Green plum Type 1 98.0 98.0 98.0 mg/100 g Green tea Type 1 0.44448 5.55 0.0 mg/100 g Green turtle Type 1 specific Chelonia mydas 8469 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.246889 0.67 0.101 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.0 0.0 0.0 mg/100 g Groundcherry Type 1 specific Physalis 24663 0.432 0.432 0.432 mg/100 g Guava Type 1 specific Psidium guajava 120290 85.437286 595.0 0.017 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.0 0.0 0.0 mg/100 g Hamburger Type 2 specific 0.056909 0.103 0.026 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 2.5 5.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 1.514571 10.5 0.0 mg/100 g Heart of palm Type 1 specific 20.5205 41.0 0.041 mg/100 g Herbal tea Type 1 0.794571 5.55 0.0 mg/100 g Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 0.089 0.178 0.0 mg/100 g Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 0.225 0.225 0.225 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.0 0.0 0.0 mg/100 g Honey Type 2 specific 0.0 0.0 0.0 mg/100 g Horchata Type 2 specific 0.001 0.001 0.001 mg/100 g Horned melon Type 2 specific Cucumis metuliferus 61886 3.544 7.0 0.088 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 0.2112 1.0 0.001 mg/100 g Horseradish tree Type 1 specific Moringa oleifera 3735 7.1832 13.0 4.208 mg/100 g Hot chocolate Type 2 specific 0.004663 0.011 0.0 mg/100 g Hummus Type 2 specific 0.002 0.002 0.002 mg/100 g Hushpuppy Type 2 specific 0.014 0.027 0.001 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 0.26 0.475 0.0 mg/100 g Ice cream Type 2 specific 0.0254 0.135 0.0 mg/100 g Ice cream cone Type 2 specific 0.003667 0.011 0.0 mg/100 g Iceberg lettuce Type 1 138.0 138.0 138.0 mg/100 g Icing Type 2 specific 0.027 0.091 0.0 mg/100 g Irish moss Type 1 specific Chondrus crispus 2769 25.523667 71.0 0.071 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 205.0 205.0 205.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 5.5276 42.891 0.994 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 7.990333 23.5 0.061 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' 294.5 294.5 294.5 mg/100 g Japanese persimmon Type 1 specific Diospyros kaki 35925 4.542333 13.0 0.253 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 0.935857 2.793 0.005 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 0.0 0.0 0.0 mg/100 g Java plum Type 1 specific Syzygium cumini 260142 0.15 0.15 0.15 mg/100 g Jellyfish Type 1 specific Scyphozoa 6142 0.0 0.0 0.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 2.466 12.0 0.009 mg/100 g Jicama Type 1 specific Pachyrhizus erosus 109171 6.5065 13.0 0.013 mg/100 g Junket Type 2 specific 0.014667 0.017 0.011 mg/100 g Jute Type 1 specific Corchorus olitorius 93759 10.874 26.4 3.111 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 89.0702 835.0 3.89 mg/100 g Kefir Type 2 specific 0.010533 0.0158 0.0 mg/100 g Kelp Type 1 specific Laminaria 33637 35.035 70.0 0.07 mg/100 g Ketchup Type 2 specific 0.386333 0.599 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 3.165067 18.5 0.0377 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 3.179643 22.0 0.021 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.44 0.44 0.44 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0565 0.113 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 6.4452 19.35 1.171 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Lasagna Type 2 specific 0.256 0.256 0.256 mg/100 g Leavening agent Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 333.476 1000.0 0.214 mg/100 g Lemon Type 1 specific Citrus limon 2708 0.247769 3.0 0.001 mg/100 g Lemon grass Type 1 specific Cymbopogon citratus 66014 1.5015 3.0 0.003 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.0 0.0 0.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 1.660867 23.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 235.005333 3490.0 0.15 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 7.982938 126.0 0.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 7.528 30.0 0.006 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.0105 0.021 0.0 mg/100 g Liquor Type 2 specific 0.004737 0.03 0.0 mg/100 g Liquorice Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 5.26725 21.0 0.021 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 1.79 3.53 0.92 mg/100 g Lotus Type 1 specific Nelumbo 4430 0.0 0.0 0.0 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Lupine Type 1 specific Lupinus 3869 0.0 0.0 0.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 0.0 0.0 0.0 mg/100 g Macaroni and cheese Type 2 specific 0.018 0.06 0.0 mg/100 g Madeira wine Type 2 specific 0.0 0.0 0.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Malabar plum Type 1 specific Syzygium jambos 334483 0.495 0.495 0.495 mg/100 g Malabar spinach Type 1 specific Basella alba 3589 37.15 37.15 37.15 mg/100 g Malus (Crab apple) Type 1 specific Malus 3749 0.024 0.024 0.024 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 46.291 92.5 0.082 mg/100 g Mammee apple Type 1 specific Mammea americana 198777 1.22 1.22 1.22 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 16.248462 207.5 0.038 mg/100 g Mango Type 1 specific Mangifera indica 29780 108.214 747.5 0.402 mg/100 g Margarine Type 2 specific 0.467143 0.61 0.36 mg/100 g Margarine-like spread Type 2 specific 0.48496 0.61 0.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.0 0.0 0.0 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Marzipan Type 2 specific 0.003 0.006 0.0 mg/100 g Meat bouillon Type 2 specific 0.0 0.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meatloaf Type 2 specific 0.018375 0.147 0.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Mexican groundcherry Type 1 specific Physalis philadelphica var. immaculata 374021 0.194 0.325 0.063 mg/100 g Mexican oregano Type 1 specific Lippia graveolens 205.0 205.0 205.0 mg/100 g Milk (Cow) Type 2 specific 0.193835 5.18375 0.0 mg/100 g Milk (Human) Type 2 specific 0.057 0.135 0.007 mg/100 g Milk (Other mammals) Type 2 specific 0.014467 0.0182 0.007 mg/100 g Milk substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Milkshake Type 2 specific 0.0106 0.039 0.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.000333 0.002 0.0 mg/100 g Miso Type 2 specific 0.033333 0.052 0.024 mg/100 g Mixed nuts Type 2 specific 0.00275 0.004 0.002 mg/100 g Molasses Type 2 specific 0.0 0.0 0.0 mg/100 g Morchella (Morel) Type 1 specific Morchellaceae 5192 0.0 0.0 0.0 mg/100 g Moth bean Type 1 specific Vigna aconitifolia 3918 0.02 0.02 0.02 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 Mugwort Type 1 specific Artemisia vulgaris 4220 9.45 9.45 9.45 mg/100 g Multigrain bread Type 2 specific 0.0 0.0 0.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 4.889429 68.0 0.002 mg/100 g Muscadine grape Type 1 specific Vitis rotundifolia 103349 19.5195 39.0 0.039 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 169.532383 2020.0 0.0 mg/100 g Mustard Type 2 specific 0.0004 0.002 0.0 mg/100 g Nachos Type 2 specific 0.0265 0.042 0.011 mg/100 g Nance Type 1 specific Byrsonima crassifolia 4270 1.560333 4.5 0.04 mg/100 g Napa cabbage Type 1 specific Brassica rapa var. pekinensis 51351 66.595 133.0 0.19 mg/100 g Naranjilla Type 1 specific Solanum quitoense 227725 74.1665 148.0 0.333 mg/100 g Narrowleaf cattail Type 1 specific Typha angustifolia 59011 0.503 1.0 0.006 mg/100 g Natto Type 2 specific 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 27.2375 108.5 0.15 mg/100 g New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 23.32 23.32 23.32 mg/100 g Nopal Type 1 specific Opuntia cochenillifera 338184 71.164 213.0 0.242 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 0.0 0.0 0.0 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.0 0.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 0.0 0.0 0.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nougat Type 2 specific 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 5.612 28.0 0.0 mg/100 g Nutritional drink Type 2 specific 0.0 0.0 0.0 mg/100 g Oat Type 1 specific Avena sativa 4498 0.288462 3.75 0.0 mg/100 g Oat bread Type 2 specific 0.000429 0.002 0.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Oil-seed Camellia Type 1 specific Camellia oleifera 385388 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 19.882333 177.0 0.17 mg/100 g Olive Type 1 specific Olea europaea 4146 3.979929 54.0 0.0 mg/100 g Opium poppy Type 1 specific Papaver somniferum 3469 0.0 0.0 0.0 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 0.9645 1.624 0.305 mg/100 g Orange roughy Type 1 specific Hoplostethus atlanticus 96778 0.0 0.0 0.0 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 2.5025 5.0 0.005 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 0.0 0.0 0.0 mg/100 g Ostrich fern Type 1 specific Matteuccia struthiopteris 3277 1.955 2.04 1.87 mg/100 g Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 0.0 0.0 0.0 mg/100 g Other beverage Type 2 specific 0.131609 1.253 0.0 mg/100 g Other bread Type 2 specific 0.004108 0.066 0.0 mg/100 g Other bread product Type 2 specific 0.0269 0.116 0.0 mg/100 g Other candy Type 2 specific 0.002967 0.064 0.0 mg/100 g Other cereal product Type 2 specific 0.0 0.0 0.0 mg/100 g Other dish Type 2 specific 0.180652 1.493 0.0 mg/100 g Other fermented milk Type 2 specific 0.0156 0.0158 0.0154 mg/100 g Other fish product Type 2 specific 0.0 0.0 0.0 mg/100 g Other frozen dessert Type 2 specific 0.019059 0.135 0.0 mg/100 g Other fruit product Type 2 specific 0.052133 0.11 0.001 mg/100 g Other pasta dish Type 2 specific 0.1482 0.407 0.011 mg/100 g Other sandwich Type 2 specific 0.0728 0.169 0.0 mg/100 g Other snack food Type 2 specific 0.507844 14.205 0.0 mg/100 g Other soy product Type 2 specific 0.004167 0.025 0.0 mg/100 g Other vegetable product Type 2 specific 3.289556 5.67 0.626 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 9.676333 29.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0 0.0 0.0 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.0 0.0 0.0 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 0.0 0.0 0.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0 0.0 0.0 mg/100 g Pacific oyster Type 1 specific Crassostrea gigas 29159 0.0 0.0 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0 0.0 0.0 mg/100 g Pacific sardine Type 1 specific Sardinops sagax 28381 0.026 0.026 0.026 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 0.0 0.0 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 448.729833 2681.0 1.8 mg/100 g Pan dulce Type 2 specific 0.003 0.003 0.003 mg/100 g Pancake Type 2 specific 0.0084 0.034 0.001 mg/100 g Papaya Type 1 specific Carica papaya 3649 59.81125 439.5 0.003 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 71.28075 538.5 0.03 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.014286 0.06 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 106.653857 743.0 0.419 mg/100 g Pasta Type 2 specific 0.015519 0.277 0.0 mg/100 g Pastry Type 2 specific 0.010319 0.226 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Pea shoots Type 1 108.5 108.5 108.5 mg/100 g Peach Type 1 specific Prunus persica 3760 4.4154 82.0 0.069 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 82.0 82.0 82.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 0.7289 21.85 0.0 mg/100 g Peanut oil Type 2 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.252633 3.5 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 1.733417 20.0 0.029 mg/100 g Pectin Type 2 specific 0.0 0.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 4.126976 42.891 0.0 mg/100 g Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 1.95 1.95 1.95 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 47.41002 236.5 0.0121 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 23.7 23.7 23.7 mg/100 g Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Percoidei (Bass and others) Type 1 specific Percoidei 8112 0.0 0.0 0.0 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 7.5175 30.0 0.01 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.42 0.42 0.42 mg/100 g Phyllo dough Type 2 specific 0.0 0.0 0.0 mg/100 g Pie Type 2 specific 0.380813 4.752 0.0 mg/100 g Pie crust Type 2 specific 0.0627 0.197 0.0 mg/100 g Pie filling Type 2 specific 0.049333 0.125 0.01 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 0.1184 0.272 0.03 mg/100 g Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Piki bread Type 2 specific 0.002 0.003 0.001 mg/100 g Pine nut Type 1 specific Pinus 3337 4.26325 17.0 0.017 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.784 16.5 0.003 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 0.0 0.0 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 14.696778 131.0 0.14 mg/100 g Pita bread Type 2 specific 0.0 0.0 0.0 mg/100 g Pitanga Type 1 specific Eugenia uniflora 119951 5.5 5.5 5.5 mg/100 g Pizza Type 2 specific 0.065826 0.14 0.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Popcorn Type 2 specific 0.0575 0.108 0.001 mg/100 g Poppy Type 1 specific Papaver 3468 0.0 0.0 0.0 mg/100 g Port wine Type 2 specific 0.0 0.0 0.0 mg/100 g Pot pie Type 2 specific 0.78 1.06 0.5 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 0.006836 0.1 0.0 mg/100 g Potato bread Type 2 specific 0.006 0.006 0.006 mg/100 g Potato chip Type 2 specific 0.011083 0.09 0.0 mg/100 g Potato gratin Type 2 specific 0.046 0.06 0.03 mg/100 g Potato puffs Type 2 specific 0.003 0.003 0.003 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 0.05 0.05 0.05 mg/100 g Prickly pear Type 1 specific Opuntia 106975 6.14625 24.5 0.025 mg/100 g Processed cheese Type 2 specific 0.046727 0.082 0.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 0.018333 0.069 0.0 mg/100 g Pudding Type 2 specific 0.006154 0.024 0.0 mg/100 g Pummelo Type 1 specific Citrus maxima 37334 0.0 0.0 0.0 mg/100 g Purple laver Type 1 specific Porphyra laciniata 1562.0605 3121.0 3.121 mg/100 g Purple mangosteen Type 1 specific Garcinia mangostana 58228 0.008 0.016 0.0 mg/100 g Purslane Type 1 specific Portulaca oleracea 46147 233.05 233.05 233.05 mg/100 g Quail Type 1 specific Phasianidae 9005 0.0 0.0 0.0 mg/100 g Quesadilla Type 2 specific 0.023 0.023 0.023 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.282667 0.8 0.024 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 4.004 8.0 0.008 mg/100 g Rabbit Type 1 specific Leporidae 9979 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 2.547 11.935 0.0 mg/100 g Rainbow smelt Type 1 specific Osmerus mordax 8014 0.0 0.0 0.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.0 0.0 0.0 mg/100 g Raisin bread Type 2 specific 0.0 0.0 0.0 mg/100 g Rambutan Type 1 specific Nephelium lappaceum 151071 1.001 2.0 0.002 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Rapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Rapini Type 1 specific Brassica ruvo 1204434 2.1465 2.72 1.573 mg/100 g Ravioli Type 2 specific 0.17 0.262 0.124 mg/100 g Red algae Type 1 specific Rhodophyta 2763 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 3.134571 21.9 0.007 mg/100 g Red bell pepper Type 1 specific Capsicum annuum 4072 4.913909 42.891 0.096 mg/100 g Red raspberry Type 1 specific Rubus idaeus 32247 2.86275 11.4 0.012 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.0 0.0 0.0 mg/100 g Red tea Type 1 1.11 5.55 0.0 mg/100 g Red wine Type 2 0.67 1.0 0.01 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 2.298136 25.0 0.0 mg/100 g Relish Type 2 specific 0.2785 0.519 0.038 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 3.764706 128.0 0.0 mg/100 g Rice bread Type 2 specific 0.0 0.0 0.0 mg/100 g Rice cake Type 2 specific 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 0.00092 0.009 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 712.712 1424.0 1.424 mg/100 g Roe Type 2 generic 0.0 0.0 0.0 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 3.393 5.226 1.56 mg/100 g Roman camomile Type 1 specific Chamaemelum nobile 99037 0.11 0.22 0.0 mg/100 g Rose hip Type 1 specific Rosa 3764 299.74375 2350.0 0.0 mg/100 g Rosé wine Type 2 0.0 0.0 0.0 mg/100 g Roselle Type 1 specific Hibiscus sabdariffa 183260 15.425 29.8 1.05 mg/100 g Rosemary Type 1 specific Rosmarinus officinalis 39367 2.0 2.0 2.0 mg/100 g Rowal Type 1 specific Pangium edule 112823 115.115 230.0 0.23 mg/100 g Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.059667 0.2 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 0.4676 7.0 0.0 mg/100 g Rye bread Type 2 specific 0.003561 0.066 0.0 mg/100 g Sacred lotus Type 1 specific Nelumbo nucifera 4432 0.004 0.012 0.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Saffron Type 1 specific Crocus sativus 82528 Sake Type 2 specific 0.0 0.0 0.0 mg/100 g Salad Type 2 specific 0.066 0.138 0.023 mg/100 g Salad dressing Type 2 specific 0.03963 0.32 0.0 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 0.277 0.277 0.277 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 0.0 0.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Salted butter Type 1 158.0 158.0 158.0 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 0.06 0.06 0.06 mg/100 g Sauce Type 2 specific 0.169136 1.02 0.0 mg/100 g Sausage Type 2 specific 0.00244 0.148 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 200.4 600.0 0.6 mg/100 g Scallop Type 1 specific Pectinidae 6566 43.333333 130.0 0.0 mg/100 g Scarlet bean Type 1 specific Phaseolus coccineus 3886 0.0125 0.015 0.01 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 0.00025 0.001 0.0 mg/100 g Scrapple Type 2 specific 0.0 0.0 0.0 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 0.0 0.0 0.0 mg/100 g Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 4.15 4.15 4.15 mg/100 g Semolina Type 2 specific 0.0 0.0 0.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.404692 5.0 0.0 mg/100 g Sesame oil Type 2 0.0 0.0 0.0 mg/100 g Shallot Type 1 specific Allium ascalonicum 1476995 1.005333 3.0 0.003 mg/100 g Shark Type 1 specific Squaliformes 282414 0.0 0.0 0.0 mg/100 g Shea tree Type 1 specific Vitellaria paradoxa 292385 0.0 0.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 0.0 0.0 0.0 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shiitake Type 1 specific Lentinus edodes 5353 0.0 0.0 0.0 mg/100 g Shortening Type 2 specific 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 0.0001 0.001 0.0 mg/100 g Smelt Type 1 specific Osmeridae 8012 0.0 0.0 0.0 mg/100 g Snack bar Type 2 specific 0.011147 0.173 0.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Snapper Type 1 specific Lutjanidae 30850 0.0 0.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.0 0.0 0.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 1.9377 5.0 0.0085 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 Sorrel Type 1 specific Rumex acetosa 41241 21.216667 58.85 2.4 mg/100 g Soup Type 2 specific 0.294143 5.62 0.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 0.5044 0.77 0.35 mg/100 g Sour cream Type 2 10.5 21.0 0.0 mg/100 g Soursop Type 1 specific Annona muricata 13337 0.25775 1.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 0.040891 0.875 0.0 mg/100 g Soy milk Type 2 specific 0.183091 2.0 0.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Soy yogurt Type 2 specific 0.02 0.02 0.02 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 0.0 0.0 0.0 mg/100 g Spearmint Type 1 specific Mentha spicata 29719 0.6 0.6 0.6 mg/100 g Spelt Type 1 specific Triticum spelta 58933 2.5025 5.0 0.005 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 197.133231 2465.0 4.186 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Spirulina Type 1 specific Spirulina 551299 16.671 33.0 0.342 mg/100 g Spotted seal Type 1 specific Phoca largha 39090 0.0 0.0 0.0 mg/100 g Spread Type 2 specific 0.013429 0.094 0.0 mg/100 g Squid Type 1 specific Teuthida 551290 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 5.7729 24.5 0.025 mg/100 g Stew Type 2 specific 0.223 0.563 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.016381 0.05 0.0 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 0.45 0.45 0.45 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 0.0 0.0 0.0 mg/100 g Stuffing Type 2 specific 0.124 0.124 0.124 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.0 0.0 0.0 mg/100 g Succotash Type 2 specific 0.082 0.082 0.082 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar apple Type 1 specific Annona squamosa 301693 0.01 0.01 0.01 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Summer savory Type 1 specific Satureja hortensis 49987 3.4 3.4 3.4 mg/100 g Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 0.0775 0.127 0.005 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.010067 0.03 0.0 mg/100 g Sunflower oil Type 2 0.0 0.0 0.0 mg/100 g Swamp cabbage Type 1 specific Ipomoea aquatica 89636 26.4 26.4 26.4 mg/100 g Swede Type 1 specific Brassica napus 3708 0.3105 1.0 0.001 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 563.8425 2235.0 0.378 mg/100 g Sweet cherry Type 1 specific Prunus avium 42229 0.092857 0.142 0.038 mg/100 g Sweet custard Type 2 specific 0.008 0.016 0.004 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 1605.268667 4806.0 4.806 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.117389 1.45 0.008 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 306.2678 5985.0 0.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 156.075167 921.5 2.0 mg/100 g Swiss cheese Type 2 7.0 7.0 7.0 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 0.0 0.0 0.0 mg/100 g Syrup Type 2 specific 0.000222 0.004 0.0 mg/100 g Taco Type 2 specific 0.04475 0.083 0.014 mg/100 g Taco shell Type 2 0.003 0.003 0.003 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tamale Type 2 specific 0.292 0.74 0.023 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 3.088 18.0 0.0 mg/100 g Tapioca pearl Type 2 specific 0.0 0.0 0.0 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 6.734875 35.0 0.031 mg/100 g Tarragon Type 1 specific Artemisia dracunculus 72341 3.8 3.8 3.8 mg/100 g Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Tea Type 1 specific Camellia sinensis 4442 0.2781 5.55 0.0 mg/100 g Teff Type 1 specific Eragrostis tef 110835 2.5025 5.0 0.005 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.0 0.0 0.0 mg/100 g Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 0.004 0.016 0.0 mg/100 g Topping Type 2 specific 0.019333 0.086 0.0 mg/100 g Tortilla Type 2 specific 0.0005 0.001 0.0 mg/100 g Tortilla chip Type 2 specific 0.043571 0.107 0.001 mg/100 g Towel gourd Type 1 specific Luffa aegyptiaca 3670 26.505 51.25 1.76 mg/100 g Triticale Type 1 specific X Triticosecale rimpaui True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True oyster Type 1 specific Ostreidae 6563 0.0 0.0 0.0 mg/100 g True seal Type 1 specific Phocidae 9709 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 0.0 0.0 0.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.0 0.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.0 0.0 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 2.682938 6.952 0.0 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 0.256091 1.568 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.021 0.036 0.0 mg/100 g Vanilla Type 1 specific Vanilla 51238 0.0 0.0 0.0 mg/100 g Vegetable juice Type 2 specific 3.028 5.226 0.83 mg/100 g Vegetarian food Type 2 specific 0.00575 0.053 0.0 mg/100 g Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 0.0012 0.002 0.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 108.108 216.0 0.216 mg/100 g Walnut Type 1 specific Juglans 16718 4.8 24.0 0.0 mg/100 g Wasabi Type 1 specific Wasabia japonica 75806 3.007 7.0 0.021 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Water spinach Type 1 Ipomoea aquatica 2465.0 2465.0 2465.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 390.6668 1914.0 1.914 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 29.7686 146.0 0.02 mg/100 g Wax gourd Type 1 specific Benincasa hispida 102211 0.041667 0.125 0.0 mg/100 g Wheat Type 1 specific Triticum 4564 0.001821 0.013 0.0 mg/100 g Wheat bread Type 2 specific 0.002525 0.066 0.0 mg/100 g Whelk Type 1 specific Buccinidae 37796 0.0 0.0 0.0 mg/100 g Whey Type 2 specific 0.025458 0.119 0.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 0.000952 0.009 0.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 0.1606 0.63 0.035 mg/100 g White mustard Type 1 specific Sinapis alba 3728 0.0235 0.029 0.018 mg/100 g White wine Type 2 0.0 0.0 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.0 0.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 35.0 35.0 35.0 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 19.6388 187.0 0.0 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 146.054857 1000.0 0.1 mg/100 g Wild rice Type 1 specific Zizania 15949 3.671 11.0 0.002 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 0.246333 0.4 0.0 mg/100 g Winter squash Type 1 specific Cucurbita maxima 3661 29.121 220.0 0.22 mg/100 g Yam Type 1 specific Dioscorea 4672 12.161286 83.0 0.0 mg/100 g Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 1.8525 3.675 0.03 mg/100 g Yautia Type 1 specific Xanthosoma sagittifolium 28478 4.88375 18.0 0.005 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 0.13025 0.305 0.0 mg/100 g Yellow wax bean Type 1 specific Phaseolus vulgaris 3885 0.059667 0.067 0.049 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 9.2222 90.0 0.101 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 0.0 0.0 0.0 mg/100 g Ymer Type 2 specific 0.01146 0.015 0.00792 mg/100 g Yogurt Type 2 specific 0.008448 0.034 0.0 mg/100 g Zwieback Type 2 specific 0.004 0.004 0.004 mg/100 g allergenic 43 A chemical compound which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. androgenic 60 anti acne 78 A drug used to treat or prevent skin disorders or for the routine care of skin. anti aging 95 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti arthritic 131 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti asthmatic 134 A drug used to treat asthma. anti cancer 159 A substance that inhibits or prevents the proliferation of neoplasms. anti carcinomic 162 A substance that inhibits or prevents the proliferation of neoplasms. anti cervicaldysplasic 173 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti coronary 207 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti hyperkeratotic 345 anti ichythyotic 361 anti leukoplakic 397 anti lipoperoxidant 407 anti lupus 410 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti maculitic 415 anti mastitic 420 anti mutagenic 451 anti ozenic 503 anti papillomic 507 A substance that destroys or inhibits replication of viruses. anti photophobic 528 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti pityriasic 529 anti porphyric 541 anti premenstrual syndrome 534 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti proliferant 547 anti psoriac 562 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti radicular 572 anti rheumatic 585 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti stress 632 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti ulcer 676 One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. anti xerophthalmic 695 Any substance introduced into a living organism with therapeutic or diagnostic purpose. antioxidant 502 A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. In European countries, E-numbers for permitted antioxidant food additives are from E 300 to E 324. antitumor 672 A substance that inhibits or prevents the proliferation of neoplasms. cancer preventive 754 A substance that inhibits or prevents the proliferation of neoplasms. chemopreventive 796 A substance that inhibits or prevents the proliferation of neoplasms. colorant 826 cyclooxygenase-1 inhibitor 840 A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. cyclooxygenase-2 inhibitor 841 A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. gastroprotective 947 A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. immunostimulant 1032 A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. interferon-synergist 1048 mucogenic 1120 phagocytotic 1212 prooxidant 1252 thymoprotective 1356 ubiquiot 1391