1.0 2011-09-26 22:55:43 UTC 2025-11-19 02:58:51 UTC FDB029746 cedr-8(15)-en-9-ol Flavouring compound [Flavornet] C15H24O 220.356 220.182715393 2,6,6-trimethyl-8-methylidenetricyclo[5.3.1.0¹,⁵]undecan-9-ol 2,6,6-trimethyl-8-methylidenetricyclo[5.3.1.0¹,⁵]undecan-9-ol 28231-03-0 CC1CCC2C(C)(C)C3CC12CC(O)C3=C InChI=1S/C15H24O/c1-9-5-6-13-14(3,4)11-7-15(9,13)8-12(16)10(11)2/h9,11-13,16H,2,5-8H2,1,3-4H3 DJYWGTBEZVORGE-UHFFFAOYSA-N belongs to the class of organic compounds known as cedrane and isocedrane sesquiterpenoids. These are sesquiternoids with a structure based on the cedrane or the isocedrane skeleton. Cedrane is a tricyclic molecules a 3,6,8,8-tetramethyl-1H-3a,7-methano-azulene moiety. Isocedrane is a rearranged cedrane arising from the migration of methyl group moved from the 6-position to the 4-position. Cedrane and isocedrane sesquiterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Sesquiterpenoids Aliphatic homopolycyclic compounds Cyclic alcohols and derivatives Hydrocarbon derivatives Secondary alcohols Alcohol Aliphatic homopolycyclic compound Cedrane sesquiterpenoid Cyclic alcohol Hydrocarbon derivative Organic oxygen compound Organooxygen compound Secondary alcohol logp 3.53 ALOGPS logs -4.09 ALOGPS solubility 1.78e-02 g/l ALOGPS logp 2.93 ChemAxon pka_strongest_acidic 18.68 ChemAxon pka_strongest_basic -1.2 ChemAxon iupac 2,6,6-trimethyl-8-methylidenetricyclo[5.3.1.0¹,⁵]undecan-9-ol ChemAxon average_mass 220.356 ChemAxon mono_mass 220.182715393 ChemAxon smiles CC1CCC2C(C)(C)C3CC12CC(O)C3=C ChemAxon formula C15H24O ChemAxon inchi InChI=1S/C15H24O/c1-9-5-6-13-14(3,4)11-7-15(9,13)8-12(16)10(11)2/h9,11-13,16H,2,5-8H2,1,3-4H3 ChemAxon inchikey DJYWGTBEZVORGE-UHFFFAOYSA-N ChemAxon polar_surface_area 20.23 ChemAxon refractivity 66.14 ChemAxon polarizability 26.5 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1288492 Specdb::MsMs 1288493 Specdb::MsMs 1288494 Specdb::MsMs 1403260 Specdb::MsMs 1403261 Specdb::MsMs 1403262 Specdb::MsMs 3607360 Specdb::MsMs 3607361 Specdb::MsMs 3607362 Specdb::MsMs 3607363 Specdb::MsMs 3607364 Specdb::MsMs 3607365 cedarwood fruit soft sweet woody