1.0 2010-04-08 22:05:14 UTC 2019-11-26 02:57:00 UTC FDB002100 Caffeine Component of coffee beans (Coffea arabica), many other Coffea subspecies, chocolate (Theobroma cacao), tea (Camellia thea), kolanut (Cola acuminata) and several other Cola subspecies and several other plants. It is used in many cola-type beverages as a flavour enhancer. Caffeine is found in many foods, some of which are black cabbage, canola, jerusalem artichoke, and yellow bell pepper. 1-Methyl-theobromine 1-Methyltheobromine 1,3,7-Trimethyl-2,6-dioxo-1,2,3,6-tetrahydropurine 1,3,7-Trimethyl-2,6-dioxopurine 1,3,7-Trimethyl-3,7-dihydro-1H-purine-2,6-dione 1,3,7-Trimethylpurine-2,6-dione 1,3,7-Trimethylxanthine 3,7-dihydro-1,3,7-Trimethyl-1H-purin-2,6-dion 3,7-dihydro-1,3,7-Trimethyl-1H-purine-2,6-dione 3,7-Dihydro-1,3,7-trimethyl-1H-purine-2,6-dione, 9CI 7-Methyl theophylline 7-Methyltheophylline Anhydrous caffeine Anhydrous caffeine (jp15) Cafeina Cafeine Caffein Cafipel Coffein Coffeine FEMA 2224 Guaranine Hycomine Koffein Lanorinal Mateina Methyltheobromide Methyltheobromine Methylxanthine theophylline Monohydrate caffeine Propoxyphene Teina Thein Theine C8H10N4O2 194.1906 194.080375584 1,3,7-trimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione caffeine 58-08-2 CN1C=NC2=C1C(=O)N(C)C(=O)N2C InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3 RYYVLZVUVIJVGH-UHFFFAOYSA-N belongs to the class of organic compounds known as xanthines. These are purine derivatives with a ketone group conjugated at carbons 2 and 6 of the purine moiety. Xanthines Organic compounds Organoheterocyclic compounds Imidazopyrimidines Purines and purine derivatives Aromatic heteropolycyclic compounds 6-oxopurines Alkaloids and derivatives Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Lactams N-substituted imidazoles Organic oxides Organonitrogen compounds Organooxygen compounds Organopnictogen compounds Pyrimidones Ureas Vinylogous amides 6-oxopurine Alkaloid or derivatives Aromatic heteropolycyclic compound Azacycle Azole Heteroaromatic compound Hydrocarbon derivative Imidazole Lactam N-substituted imidazole Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Purinone Pyrimidine Pyrimidone Urea Vinylogous amide Xanthine Purine alkaloids a small molecule purine alkaloid trimethylxanthine Solid logp -0.24 ALOGPS logs -1.25 ALOGPS solubility 1.10e+01 g/l ALOGPS melting_point Mp 236° (phase transition at 141°) logp -0.55 ChemAxon pka_strongest_basic -0.92 ChemAxon iupac 1,3,7-trimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione ChemAxon average_mass 194.1906 ChemAxon mono_mass 194.080375584 ChemAxon smiles CN1C=NC2=C1C(=O)N(C)C(=O)N2C ChemAxon formula C8H10N4O2 ChemAxon inchi InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3 ChemAxon inchikey RYYVLZVUVIJVGH-UHFFFAOYSA-N ChemAxon polar_surface_area 58.44 ChemAxon refractivity 49.83 ChemAxon polarizability 18.95 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 3 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Caffeine Metabolism SMP00028 map00232 Specdb::EiMs 937 Specdb::NmrTwoD 1088 Specdb::NmrTwoD 1691 Specdb::MsIr 1367 Specdb::MsIr 1368 Specdb::CMs 773 Specdb::CMs 774 Specdb::CMs 775 Specdb::CMs 776 Specdb::CMs 1536 Specdb::CMs 5869 Specdb::CMs 26866 Specdb::CMs 27428 Specdb::CMs 27522 Specdb::CMs 27529 Specdb::CMs 27588 Specdb::CMs 30177 Specdb::CMs 30268 Specdb::CMs 30493 Specdb::CMs 30752 Specdb::CMs 31354 Specdb::CMs 174028 Specdb::NmrOneD 1751 Specdb::NmrOneD 2495 Specdb::NmrOneD 3192 Specdb::NmrOneD 9642 Specdb::NmrOneD 9643 Specdb::NmrOneD 9644 Specdb::NmrOneD 9645 Specdb::NmrOneD 9646 Specdb::NmrOneD 9647 Specdb::NmrOneD 9648 Specdb::NmrOneD 9649 Specdb::NmrOneD 9650 Specdb::NmrOneD 9651 Specdb::NmrOneD 9652 Specdb::NmrOneD 9653 Specdb::NmrOneD 9654 Specdb::NmrOneD 9655 Specdb::NmrOneD 9656 Specdb::NmrOneD 9657 Specdb::NmrOneD 9658 Specdb::NmrOneD 9659 Specdb::NmrOneD 9660 Specdb::NmrOneD 9661 Specdb::NmrOneD 166389 Specdb::MsMs 1702 Specdb::MsMs 1703 Specdb::MsMs 1704 Specdb::MsMs 5449 Specdb::MsMs 5450 Specdb::MsMs 5451 Specdb::MsMs 5452 Specdb::MsMs 5453 Specdb::MsMs 5454 Specdb::MsMs 5455 Specdb::MsMs 5456 Specdb::MsMs 5457 Specdb::MsMs 5458 Specdb::MsMs 5463 Specdb::MsMs 5464 Specdb::MsMs 374054 Specdb::MsMs 374820 Specdb::MsMs 442073 Specdb::MsMs 442074 Specdb::MsMs 442075 Specdb::MsMs 442076 Specdb::MsMs 442077 Specdb::MsMs 442078 Specdb::MsMs 442079 Specdb::MsMs 442080 HMDB01847 27732 CFF #<Reference:0x00005612734f2c80> #<Reference:0x00005612734f2960> #<Reference:0x00005612734f27a8> #<Reference:0x00005612734f25f0> #<Reference:0x00005612734f2438> #<Reference:0x00005612734f2280> #<Reference:0x00005612734f20c8> #<Reference:0x00005612734f1f10> #<Reference:0x00005612734f1d58> #<Reference:0x00005612734f1b78> #<Reference:0x00005612734f1998> #<Reference:0x00005612734f1790> #<Reference:0x00005612734f15d8> #<Reference:0x00005612734f1380> #<Reference:0x00005612734f10b0> #<Reference:0x00005612734f0de0> #<Reference:0x00005612734f0b38> #<Reference:0x00005612734f0840> Abalone Type 1 specific Haliotis 6452 0.0 0.0 0.0 mg/100 g Abiyuch Type 1 specific Crateva religiosa 202634 Acerola Type 1 specific Malpighia emarginata 151847 0.0 0.0 0.0 mg/100 g Acorn Type 1 specific Quercus 3511 Adobo Type 2 specific 0.0 0.0 0.0 mg/100 g Adzuki bean Type 1 specific Vigna angularis 3914 Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Agave Type 1 specific Agave 39509 0.0 0.0 0.0 mg/100 g Alaska blueberry Type 1 specific Vaccinium alaskaense 190544 0.0 0.0 0.0 mg/100 g Alaska pollock Type 1 specific Theragra chalcogramma 1042646 0.0 0.0 0.0 mg/100 g Alaska wild rhubarb Type 1 specific Polygonum alpinum 125586 Albacore tuna Type 1 specific Thunnus alalunga 8235 0.0 0.0 0.0 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 0.0 0.0 0.0 mg/100 g Allspice Type 1 specific Pimenta dioica 375272 0.0 0.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.0 0.0 0.0 mg/100 g Almond milk Type 1 0.0 0.0 0.0 mg/100 g Alpine sweetvetch Type 1 specific Hedysarum alpinum 57576 Amaranth Type 1 specific Amaranthus 3564 American butterfish Type 1 specific Peprilus triacanthus 183653 American cranberry Type 1 specific Vaccinium macrocarpon 13750 0.0 0.0 0.0 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.0 0.0 0.0 mg/100 g American pokeweed Type 1 specific Phytolacca americana 3527 0.0 0.0 0.0 mg/100 g American shad Type 1 specific Alosa sapidissima 34773 0.0 0.0 0.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 0.0 0.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.0 0.0 0.0 mg/100 g Angelica Type 1 specific Angelica keiskei 357850 Anguilliformes Type 1 specific Anguilliformes 7933 0.0 0.0 0.0 mg/100 g Anise Type 1 specific Pimpinella anisum 271192 0.0 0.0 0.0 mg/100 g Annual wild rice Type 1 specific Zizania aquatica 75727 Apple Type 1 specific Malus pumila 283210 0.0 0.0 0.0 mg/100 g Apple cider Type 2 specific 0.0 0.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.0 0.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 548.214286 3142.0 1.0 mg/100 g Arctic blackberry Type 1 specific Rubus arcticus 70741 Arrowhead Type 1 specific Sagittaria latifolia 15008 Arrowroot Type 1 specific Maranta arundinacea 210060 Asian pear Type 1 specific Pyrus pyrifolia 3767 0.0 0.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 0.0 0.0 0.0 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 0.0 0.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0 0.0 0.0 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 0.0 0.0 0.0 mg/100 g Atlantic mackerel Type 1 specific Scomber scombrus 13677 0.0 0.0 0.0 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 0.0 0.0 0.0 mg/100 g Babassu palm Type 1 specific Attalea speciosa 145700 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 0.0 0.0 0.0 mg/100 g Bagel Type 2 specific 0.0 0.0 0.0 mg/100 g Baked beans Type 2 specific 0.0 0.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.0 0.0 0.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.0 0.0 0.0 mg/100 g Bayberry Type 1 specific Myrica 3509 Bean Type 1 specific 0.0 0.0 0.0 mg/100 g Bearded seal Type 1 specific Erignathus barbatus 39304 0.0 0.0 0.0 mg/100 g Beech nut Type 1 specific Fagus 21024 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Beluga whale Type 1 specific Delphinapterus leucas 9749 0.0 0.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 Biscuit Type 2 specific 3.875 46.0 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 0.0 0.0 0.0 mg/100 g Bitter gourd Type 1 specific Momordica charantia 3673 0.0 0.0 0.0 mg/100 g Bivalvia (Clam, Mussel, Oyster) Type 1 specific Bivalvia 6544 0.0 0.0 0.0 mg/100 g Black cabbage Type 1 specific Brassica oleracea var. viridis 3713 0.0 0.0 0.0 mg/100 g Black chokeberry Type 1 specific Photinia melanocarpa 661339 Black crowberry Type 1 specific Empetrum nigrum 191066 Black elderberry Type 1 specific Sambucus nigra 4202 Black huckleberry Type 1 specific Gaylussacia baccata 128893 Black mulberry Type 1 specific Morus nigra 85232 0.0 0.0 0.0 mg/100 g Black radish Type 1 specific Raphanus sativus var. niger 41679 Black raisin Type 1 0.0 0.0 0.0 mg/100 g Black raspberry Type 1 specific Rubus occidentalis 75079 Black salsify Type 1 specific Scorzonera hispanica 114289 Black tea Type 1 403.809524 3680.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 0.0 0.0 0.0 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 0.0 0.0 0.0 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 Blue cheese Type 2 0.0 0.0 0.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 0.0 0.0 0.0 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 0.0 0.0 0.0 mg/100 g Bog bilberry Type 1 specific Vaccinium uliginosum 190548 Borage Type 1 specific Borago officinalis 13363 Boysenberry Type 1 specific Rubus ursinus X idaeus 0.0 0.0 0.0 mg/100 g Brassicas Unknown generic 3705 Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 0.0 0.0 0.0 mg/100 g Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 Breakfast cereal Type 2 specific 0.228571 21.0 0.0 mg/100 g Breakfast sandwich Type 2 specific 0.0 0.0 0.0 mg/100 g Broad bean Type 1 specific Vicia faba 3906 0.0 0.0 0.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.0 0.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.0 0.0 0.0 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 Buffalo currant Type 1 specific Ribes aureum var. villosum 23283 Bulgur Type 2 specific 0.0 0.0 0.0 mg/100 g Burbot Type 1 specific Lota lota 69944 Burdock Type 1 specific Arctium lappa 4217 0.0 0.0 0.0 mg/100 g Burrito Type 2 specific 0.0 0.0 0.0 mg/100 g Butter Type 2 specific 0.0 0.0 0.0 mg/100 g Butter substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Butterfat Type 2 specific 0.0 0.0 0.0 mg/100 g Buttermilk Type 2 specific 0.0 0.0 0.0 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 Butternut squash Type 1 specific Cucurbita moschata 3662 0.0 0.0 0.0 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.0 0.0 0.0 mg/100 g Cake Type 2 specific 1.666667 11.0 0.0 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 0.0 0.0 0.0 mg/100 g Canada blueberry Type 1 specific Vaccinium myrtilloides 1503870 Candy bar Type 2 specific 10.294118 30.0 1.0 mg/100 g Canola Type 2 specific 138011 0.0 0.0 0.0 mg/100 g Capers Type 1 specific Capparis spinosa 65558 0.0 0.0 0.0 mg/100 g Caraway Type 1 specific Carum carvi 48032 0.0 0.0 0.0 mg/100 g Cardamom Type 1 specific Elettaria cardamomum 105181 Cardoon Type 1 specific Cynara cardunculus 4265 Carob Type 1 specific Ceratonia siliqua 20340 0.0 0.0 0.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.0 0.0 0.0 mg/100 g Cascade huckleberry Type 1 specific Vaccinium deliciosum 190531 Cashew nut Type 1 specific Anacardium occidentale 171929 0.0 0.0 0.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.0 0.0 0.0 mg/100 g Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 0.0 0.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.0 0.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 0.0 0.0 0.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.0 0.0 0.0 mg/100 g Cereals and cereal products Unknown generic Ceylon cinnamon Type 1 specific Cinnamomum verum 128608 Channel catfish Type 1 specific Ictalurus punctatus 7998 0.0 0.0 0.0 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 0.0 0.0 0.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 Cherry tomato Type 1 specific Solanum lycopersicum var. cerasiforme 195583 Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chestnut Type 1 specific Castanea 21019 Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chia Type 1 specific Salvia hispanica 49212 Chicken Type 1 specific Gallus gallus 9031 Chickpea Type 1 specific Cicer arietinum 3827 0.0 0.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.0 0.0 0.0 mg/100 g Chicory leaves Type 1 specific Cichorium intybus var. foliosum 13427 Chicory roots Type 1 specific Cichorium intybus var. sativum 13427 Chili Type 2 specific 0.0 0.0 0.0 mg/100 g Chinese bayberry Type 1 specific Myrica rubra 262757 Chinese broccoli Type 1 specific Brassica alboglabra 3714 0.0 0.0 0.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.0 0.0 0.0 mg/100 g Chinese chestnut Type 1 specific Castanea mollissima 60419 Chinese chives Type 1 specific Allium tuberosum 4683 0.0 0.0 0.0 mg/100 g Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 0.0 0.0 0.0 mg/100 g Chinese mustard Type 1 specific Brassica juncea 3707 0.0 0.0 0.0 mg/100 g Chinese water chestnut Type 1 specific Eleocharis dulcis 110284 0.0 0.0 0.0 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 0.0 0.0 0.0 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.0 0.0 0.0 mg/100 g Chocolate Type 2 specific 58.333333 86.0 14.0 mg/100 g Chocolate mousse Type 2 specific 7.0 7.0 7.0 mg/100 g Chocolate spread Type 2 specific 7.0 7.0 7.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 0.0 0.0 0.0 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.0 0.0 0.0 mg/100 g Cisco Type 1 specific Coregonus artedi 36181 0.0 0.0 0.0 mg/100 g Citrus Unknown generic Clam Type 1 0.0 0.0 0.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.0 0.0 0.0 mg/100 g Climbing bean Type 1 specific Vigna umbellata 87088 Cloud ear fungus Type 1 specific Auricularia polytricha 29893 Cloudberry Type 1 specific Rubus chamaemorus 57936 Cloves Type 1 specific Syzygium aromaticum 219868 0.0 0.0 0.0 mg/100 g Cocktail Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa and cocoa products Unknown generic Cocoa bean Type 1 specific Theobroma cacao 3641 247.15 670.0 28.8 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 86.090909 230.0 1.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.0 0.0 0.0 mg/100 g Coconut milk Type 1 0.0 0.0 0.0 mg/100 g Coffee Type 1 generic Coffea 13442 465.0 3142.0 1.0 mg/100 g Coffee and coffee products Unknown generic Coffee mocha Type 2 specific 250.5 476.0 25.0 mg/100 g Coffee substitute Type 2 specific 416.8 2063.0 0.0 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 0.0 0.0 0.0 mg/100 g Cold cut Type 2 specific 0.0 0.0 0.0 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 0.0 0.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 0.0 0.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.0 0.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.0 0.0 0.0 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 0.0 0.0 0.0 mg/100 g Common chokecherry Type 1 specific Prunus virginiana 133204 0.0 0.0 0.0 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 0.0 0.0 0.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.0 0.0 0.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 0.0 0.0 0.0 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.0 0.0 0.0 mg/100 g Common persimmon Type 1 specific Diospyros virginiana 13493 Common sage Type 1 specific Salvia officinalis 38868 0.0 0.0 0.0 mg/100 g Common salsify Type 1 specific Tragopogon porrifolius 13731 0.0 0.0 0.0 mg/100 g Common thyme Type 1 specific Thymus vulgaris 49992 0.0 0.0 0.0 mg/100 g Common verbena Type 1 specific Verbena officinalis 79772 Common walnut Type 1 specific Juglans regia 51240 0.0 0.0 0.0 mg/100 g Common wheat Type 1 specific Triticum aestivum 4565 0.0 0.0 0.0 mg/100 g Conch Type 1 specific Strombidae 69694 0.0 0.0 0.0 mg/100 g Condensed milk Type 2 specific 0.0 0.0 0.0 mg/100 g Cooking oil Type 2 specific 0.0 0.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 0.0 0.0 0.0 mg/100 g Corn chip Type 2 specific 0.0 0.0 0.0 mg/100 g Corn grits Type 2 specific 0.0 0.0 0.0 mg/100 g Corn salad Type 1 specific Valerianella locusta 59166 Cornbread Type 2 specific 0.0 0.0 0.0 mg/100 g Cornmint Type 1 specific Mentha arvensis 292239 Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Cottonseed oil Type 2 0.0 0.0 0.0 mg/100 g Couscous Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific 0.0 0.0 0.0 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 0.0 0.0 0.0 mg/100 g Cracker Type 2 specific 0.0 0.0 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 0.0 0.0 0.0 mg/100 g Cream substitute Type 2 specific 0.6 3.0 0.0 mg/100 g Crisp bread Type 2 specific 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 0.0 0.0 0.0 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 0.0 0.0 0.0 mg/100 g Cupuaçu Type 1 specific Theobroma grandiflorum 108881 0.0 0.0 0.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Custard apple Type 1 specific Annona reticulata 301862 Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.0 0.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.0 0.0 0.0 mg/100 g Deer Type 1 specific Cervidae 9850 0.0 0.0 0.0 mg/100 g Deerberry Type 1 specific Vaccinium stamineum 176259 Dessert wine Type 2 0.0 0.0 0.0 mg/100 g Devilfish Type 1 specific Myoxocephalus 8095 Dill Type 1 specific Anethum graveolens 40922 0.0 0.0 0.0 mg/100 g Dock Type 1 specific Rumex 3618 Domestic goat Type 1 specific Capra aegagrus hircus 9925 0.0 0.0 0.0 mg/100 g Domestic pig Type 1 specific Sus scrofa domestica 9825 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 0.0 0.0 0.0 mg/100 g Dripping Type 2 specific 0.0 0.0 0.0 mg/100 g Dulce de leche Type 2 specific 0.0 0.0 0.0 mg/100 g Durian Type 1 specific Durio zibethinus 66656 Eastern oyster Type 1 specific Crassostrea virginica 6565 0.0 0.0 0.0 mg/100 g Edible shell Type 2 specific 0.0 0.0 0.0 mg/100 g Egg roll Type 2 specific 0.0 0.0 0.0 mg/100 g Egg substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.0 0.0 0.0 mg/100 g Eggs Unknown generic 0.0 0.0 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 Elk Type 1 specific Cervus canadensis 1574408 0.0 0.0 0.0 mg/100 g Elliott's blueberry Type 1 specific Vaccinium elliottii 283798 Emu Type 1 specific Dromaius novaehollandiae 8790 0.0 0.0 0.0 mg/100 g Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g Energy drink Type 2 specific 25.5 33.0 0.0 mg/100 g Enokitake Type 1 specific Flammulina velutipes 38945 0.0 0.0 0.0 mg/100 g Epazote Type 1 specific Dysphania ambrosioides 330163 European anchovy Type 1 specific Engraulis encrasicolus 184585 0.0 0.0 0.0 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 0.0 0.0 0.0 mg/100 g European cranberry Type 1 specific Vaccinium oxycoccos 516948 European plum Type 1 specific Prunus domestica 3758 0.0 0.0 0.0 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 Evaporated milk Type 2 specific 0.0 0.0 0.0 mg/100 g Evening primrose Type 1 specific Oenothera biennis 3942 Evergreen huckleberry Type 1 specific Vaccinium ovatum 84019 Feijoa Type 1 specific Feijoa sellowiana 260130 Fennel Type 1 specific Foeniculum vulgare 48038 0.0 0.0 0.0 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 Fig Type 1 specific Ficus carica 3494 0.0 0.0 0.0 mg/100 g Fireweed Type 1 specific Chamerion angustifolium 13055 Flatfish Type 1 specific Pleuronectiformes 8252 0.0 0.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.0 0.0 0.0 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 0.0 0.0 0.0 mg/100 g Focaccia Type 2 specific 0.0 0.0 0.0 mg/100 g Fox grape Type 1 specific Vitis labrusca 103355 French plantain Type 1 specific Musa X paradisiaca 89151 0.0 0.0 0.0 mg/100 g French toast Type 2 specific 0.0 0.0 0.0 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 0.0 0.0 0.0 mg/100 g Frozen yogurt Type 2 specific 1.8 3.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit salad Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit-flavor drink Type 2 specific 0.0 0.0 0.0 mg/100 g Fruits Unknown generic Fudge Type 2 specific 7.0 18.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.0 0.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 0.0 0.0 0.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 0.0 0.0 0.0 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.0 0.0 0.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 0.0 0.0 0.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0 0.0 0.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 Garland chrysanthemum Type 1 specific Chrysanthemum coronarium 99038 0.0 0.0 0.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 0.0 0.0 0.0 mg/100 g Giant butterbur Type 1 specific Petasites japonicus 186965 Gin Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.0 0.0 0.0 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 0.0 0.0 0.0 mg/100 g Ginseng Type 1 specific Panax 4054 Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 Gram bean Type 1 specific Vigna mungo 3915 0.0 0.0 0.0 mg/100 g Grape Type 1 specific Vitis 3603 0.0 0.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.0 0.0 0.0 mg/100 g Grapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Grass pea Type 1 specific Lathyrus sativus 3860 Greater sturgeon Type 1 specific Acipenser 7901 0.0 0.0 0.0 mg/100 g Greek feta cheese Type 2 0.0 0.0 0.0 mg/100 g Green bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Green cabbage Type 1 Brassica oleracea var. sabauda L. 0.0 0.0 0.0 mg/100 g Green lentil Type 1 Lens culinaris 0.0 0.0 0.0 mg/100 g Green onion Type 1 Green plum Type 1 0.0 0.0 0.0 mg/100 g Green tea Type 1 403.428571 3680.0 0.0 mg/100 g Green turtle Type 1 specific Chelonia mydas 8469 0.0 0.0 0.0 mg/100 g Green vegetables Unknown generic Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.0 0.0 0.0 mg/100 g Greenthread tea Type 1 specific Thelesperma 153159 Greylag goose Type 1 specific Anser anser 8843 Groundcherry Type 1 specific Physalis 24663 Guarana Type 1 Paullinia cupana Guava Type 1 specific Psidium guajava 120290 0.0 0.0 0.0 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.0 0.0 0.0 mg/100 g Half-highbush blueberry Type 1 specific Vaccinium angustifolium X Vaccinium corymbosum 934696 Hamburger Type 2 specific 0.0 0.0 0.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 0.0 0.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 0.0 0.0 0.0 mg/100 g Heart of palm Type 1 specific 0.0 0.0 0.0 mg/100 g Hedge mustard Type 1 specific Sisymbrium 3729 Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Herbs and Spices Unknown generic Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 0.0 0.0 0.0 mg/100 g Hickory nut Type 1 specific Carya 13402 Highbush blueberry Type 1 specific Vaccinium corymbosum 69266 Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.0 0.0 0.0 mg/100 g Honey Type 2 specific 0.0 0.0 0.0 mg/100 g Horchata Type 2 specific 0.0 0.0 0.0 mg/100 g Horned melon Type 2 specific Cucumis metuliferus 61886 Horse Type 1 specific Equus caballus 9796 Horseradish Type 1 specific Armoracia rusticana 3704 0.0 0.0 0.0 mg/100 g Horseradish tree Type 1 specific Moringa oleifera 3735 0.0 0.0 0.0 mg/100 g Hot chocolate Type 2 specific 1.75 2.0 1.0 mg/100 g Hummus Type 2 specific 0.0 0.0 0.0 mg/100 g Hushpuppy Type 2 specific 0.0 0.0 0.0 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 0.0 0.0 0.0 mg/100 g Hyssop Type 1 specific Hyssopus officinalis 39324 Ice cream Type 2 specific 0.909091 4.0 0.0 mg/100 g Ice cream cone Type 2 specific 2.333333 7.0 0.0 mg/100 g Iceberg lettuce Type 1 0.0 0.0 0.0 mg/100 g Icing Type 2 specific 2.625 6.0 0.0 mg/100 g Irish moss Type 1 specific Chondrus crispus 2769 0.0 0.0 0.0 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 0.0 0.0 0.0 mg/100 g Italian sweet red pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' 0.0 0.0 0.0 mg/100 g Japanese chestnut Type 1 specific Castanea crenata 103480 Japanese persimmon Type 1 specific Diospyros kaki 35925 0.0 0.0 0.0 mg/100 g Japanese pumpkin Type 1 specific Cucurbita maxima 3661 0.0 0.0 0.0 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 0.0 0.0 0.0 mg/100 g Japanese walnut Type 1 specific Juglans ailanthifolia 91209 Java plum Type 1 specific Syzygium cumini 260142 Jellyfish Type 1 specific Scyphozoa 6142 0.0 0.0 0.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.0 0.0 0.0 mg/100 g Jew's ear Type 1 specific Auricularia auricula-judae 29892 Jicama Type 1 specific Pachyrhizus erosus 109171 0.0 0.0 0.0 mg/100 g Jostaberry Type 1 specific Ribes × nidigrolaria Jujube Type 1 specific Ziziphus zizyphus 48393 Junket Type 2 specific 3.0 13.0 0.0 mg/100 g Jute Type 1 specific Corchorus olitorius 93759 0.0 0.0 0.0 mg/100 g Kai-lan Type 1 specific Brassica oleracea var. alboglabra 3714 Kale Type 1 specific Brassica napus var. pabularia 0.0 0.0 0.0 mg/100 g Kefir Type 2 specific 0.0 0.0 0.0 mg/100 g Kelp Type 1 specific Laminaria 33637 0.0 0.0 0.0 mg/100 g Ketchup Type 2 specific 0.0 0.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.0 0.0 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Komatsuna Type 1 specific Brassica rapa var. perviridis 344680 Kombu Type 1 specific Saccharina japonica 88149 Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Lasagna Type 2 specific 0.0 0.0 0.0 mg/100 g Leavening agent Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.0 0.0 0.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 0.714286 5.0 0.0 mg/100 g Lemon balm Type 1 specific Melissa officinalis 39338 Lemon grass Type 1 specific Cymbopogon citratus 66014 Lemon sole Type 1 specific Microstomus kitt 106175 0.0 0.0 0.0 mg/100 g Lemon thyme Type 1 specific Thymus pulegioides 751873 Lemon verbena Type 1 specific Aloysia triphylla 542672 Lentils Type 1 generic Lens culinaris 3864 0.0 0.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0 0.0 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 0.0 0.0 0.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Linden Type 1 specific Tilia 64580 Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 Liquor Type 2 specific 15.0 26.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Longan Type 1 specific Dimocarpus longan 128017 Loquat Type 1 specific Eriobotrya japonica 32224 Lotus Type 1 specific Nelumbo 4430 0.0 0.0 0.0 mg/100 g Lovage Type 1 specific Levisticum officinale 48042 Lowbush blueberry Type 1 specific Vaccinium angustifolium 472369 Lupine Type 1 specific Lupinus 3869 0.0 0.0 0.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 0.0 0.0 0.0 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 0.0 0.0 0.0 mg/100 g Macaroni and cheese Type 2 specific 0.0 0.0 0.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Malabar plum Type 1 specific Syzygium jambos 334483 Malabar spinach Type 1 specific Basella alba 3589 Mallard duck Type 1 specific Anas platyrhynchos 8839 Malus (Crab apple) Type 1 specific Malus 3749 Mamey sapote Type 1 specific Pouteria sapota 233744 Mammee apple Type 1 specific Mammea americana 198777 Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.0 0.0 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.0 0.0 0.0 mg/100 g Margarine Type 2 specific 0.0 0.0 0.0 mg/100 g Margarine-like spread Type 2 specific 0.0 0.0 0.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.0 0.0 0.0 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Mate Type 1 Ilex paraguariensis Meatloaf Type 2 specific 0.0 0.0 0.0 mg/100 g Medlar Type 1 specific Mespilus germanica 36616 Mentha Type 1 specific Mentha 21819 Mexican groundcherry Type 1 specific Physalis philadelphica var. immaculata 374021 0.0 0.0 0.0 mg/100 g Mexican oregano Type 1 specific Lippia graveolens 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Milkshake Type 2 specific 0.6 2.0 0.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.0 0.0 0.0 mg/100 g Miso Type 2 specific 0.0 0.0 0.0 mg/100 g Mixed nuts Type 2 specific 0.0 0.0 0.0 mg/100 g Molasses Type 2 specific 0.0 0.0 0.0 mg/100 g Moth bean Type 1 specific Vigna aconitifolia 3918 Mountain hare Type 1 specific Lepus timidus 62621 Mountain yam Type 1 specific Dioscorea pentaphylla 167592 0.0 0.0 0.0 mg/100 g Mugwort Type 1 specific Artemisia vulgaris 4220 Mulberry Type 1 specific Morus 3497 Mule deer Type 1 specific Odocoileus 9871 Multigrain bread Type 2 specific 0.0 0.0 0.0 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 0.0 0.0 0.0 mg/100 g Muscadine grape Type 1 specific Vitis rotundifolia 103349 Muskmelon Type 1 specific Cucumis melo 3656 0.0 0.0 0.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Mustard spinach Type 1 specific Brassica perviridis Nance Type 1 specific Byrsonima crassifolia 4270 Nanking cherry Type 1 specific Prunus tomentosa 105667 Napa cabbage Type 1 specific Brassica rapa var. pekinensis 51351 0.0 0.0 0.0 mg/100 g Naranjilla Type 1 specific Solanum quitoense 227725 Narrowleaf cattail Type 1 specific Typha angustifolia 59011 Natal plum Type 1 specific Carissa macrocarpa 403101 Natto Type 2 specific 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 0.0 0.0 0.0 mg/100 g Nopal Type 1 specific Opuntia cochenillifera 338184 0.0 0.0 0.0 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 0.0 0.0 0.0 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.0 0.0 0.0 mg/100 g Nougat Type 2 specific 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Nutritional drink Type 2 specific 0.181818 2.0 0.0 mg/100 g Nuts Unknown generic Oat Type 1 specific Avena sativa 4498 0.0 0.0 0.0 mg/100 g Oat bread Type 2 specific 0.0 0.0 0.0 mg/100 g Ohelo berry Type 1 specific Vaccinium reticulatum 180767 Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Oil-seed Camellia Type 1 specific Camellia oleifera 385388 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.0 0.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Onion-family vegetables Unknown generic Opium poppy Type 1 specific Papaver somniferum 3469 0.0 0.0 0.0 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 Orange mint Type 1 specific Mentha aquatica 190902 Orange roughy Type 1 specific Hoplostethus atlanticus 96778 0.0 0.0 0.0 mg/100 g Oregon yampah Type 1 specific Perideridia oregana 234866 Oriental wheat Type 1 specific Triticum turanicum 376534 Ostrich Type 1 specific Struthio camelus 8801 0.0 0.0 0.0 mg/100 g Ostrich fern Type 1 specific Matteuccia struthiopteris 3277 Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 0.0 0.0 0.0 mg/100 g Other beverage Type 2 specific 5.173913 37.0 0.0 mg/100 g Other bread Type 2 specific 0.0 0.0 0.0 mg/100 g Other bread product Type 2 specific 0.0 0.0 0.0 mg/100 g Other candy Type 2 specific 36.77193 839.0 0.0 mg/100 g Other cereal product Type 2 specific 0.0 0.0 0.0 mg/100 g Other dish Type 2 specific 0.0 0.0 0.0 mg/100 g Other fish product Type 2 specific 0.0 0.0 0.0 mg/100 g Other frozen dessert Type 2 specific 1.533333 6.0 0.0 mg/100 g Other fruit product Type 2 specific 0.0 0.0 0.0 mg/100 g Other pasta dish Type 2 specific 0.0 0.0 0.0 mg/100 g Other sandwich Type 2 specific 0.0 0.0 0.0 mg/100 g Other snack food Type 2 specific 0.0 0.0 0.0 mg/100 g Other soy product Type 2 specific 0.0 0.0 0.0 mg/100 g Other vegetable product Type 2 specific 0.0 0.0 0.0 mg/100 g Oval-leaf huckleberry Type 1 specific Vaccinium ovalifolium 190544 Oxheart cabbage Type 1 specific Brassica oleracea var. conica Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0 0.0 0.0 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.0 0.0 0.0 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 0.0 0.0 0.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0 0.0 0.0 mg/100 g Pacific oyster Type 1 specific Crassostrea gigas 29159 0.0 0.0 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0 0.0 0.0 mg/100 g Pacific sardine Type 1 specific Sardinops sagax 28381 0.0 0.0 0.0 mg/100 g Painted comber Type 1 specific Serranus scriba 349661 0.0 0.0 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.0 0.0 0.0 mg/100 g Pan dulce Type 2 specific 0.0 0.0 0.0 mg/100 g Pancake Type 2 specific 0.0 0.0 0.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.0 0.0 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.0 0.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.0 0.0 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 0.0 0.0 0.0 mg/100 g Pastry Type 2 specific 0.159091 2.0 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Pea shoots Type 1 0.0 0.0 0.0 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0 0.0 0.0 mg/100 g Peach (var.) Type 1 specific Prunus persica var. persica 323852 Peanut Type 1 specific Arachis hypogaea 3818 0.0 0.0 0.0 mg/100 g Peanut oil Type 2 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.0 0.0 0.0 mg/100 g Pectin Type 2 specific 0.0 0.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Pepper (C. baccatum) Type 1 specific Capsicum baccatum var. baccatum 165788 Pepper (C. chinense) Type 1 specific Capsicum chinense 80379 Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 Pepper (C. pubescens) Type 1 specific Capsicum pubescens 113210 Pepper (Capsicum) Type 1 specific Capsicum 4071 Pepper (Spice) Type 1 specific Piper nigrum 13216 0.0 0.0 0.0 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Percoidei (Bass and others) Type 1 specific Percoidei 8112 0.0 0.0 0.0 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 0.0 0.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 Pheasant Type 1 specific Phasianus colchicus 9054 Phyllo dough Type 2 specific 0.0 0.0 0.0 mg/100 g Pie Type 2 specific 0.0625 1.0 0.0 mg/100 g Pie crust Type 2 specific 2.0 15.0 0.0 mg/100 g Pie filling Type 2 specific 0.0 0.0 0.0 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 0.0 0.0 0.0 mg/100 g Pili nut Type 1 specific Canarium ovatum 43691 Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pineappple sage Type 1 specific Salvia elegans 888065 Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 0.0 0.0 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 0.0 0.0 0.0 mg/100 g Pita bread Type 2 specific 0.0 0.0 0.0 mg/100 g Pitanga Type 1 specific Eugenia uniflora 119951 Pizza Type 2 specific 0.0 0.0 0.0 mg/100 g Plains prickly pear Type 1 specific Opuntia macrorhiza 1041245 Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Pomes Unknown generic Popcorn Type 2 specific 0.0 0.0 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 0.0 0.0 0.0 mg/100 g Pot marjoram Type 1 specific Origanum onites 452416 Pot pie Type 2 specific 0.0 0.0 0.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 0.0 0.0 0.0 mg/100 g Potato bread Type 2 specific 0.0 0.0 0.0 mg/100 g Potato chip Type 2 specific 0.0 0.0 0.0 mg/100 g Potato puffs Type 2 specific 0.0 0.0 0.0 mg/100 g Prairie turnip Type 1 specific Pediomelum esculentum 458363 Prickly pear Type 1 specific Opuntia 106975 Processed cheese Type 2 specific 0.0 0.0 0.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 0.0 0.0 0.0 mg/100 g Pudding Type 2 specific 1.386364 18.0 0.0 mg/100 g Pulses Unknown generic Pummelo Type 1 specific Citrus maxima 37334 Purple laver Type 1 specific Porphyra laciniata 0.0 0.0 0.0 mg/100 g Purple mangosteen Type 1 specific Garcinia mangostana 58228 Purslane Type 1 specific Portulaca oleracea 46147 0.0 0.0 0.0 mg/100 g Quail Type 1 specific Phasianidae 9005 0.0 0.0 0.0 mg/100 g Quesadilla Type 2 specific 0.0 0.0 0.0 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 Quinoa Type 1 specific Chenopodium quinoa 63459 Rabbit Type 1 specific Leporidae 9979 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.0 0.0 0.0 mg/100 g Radish (var.) Type 1 specific Raphanus sativus var. sativus 240228 Rainbow smelt Type 1 specific Osmerus mordax 8014 0.0 0.0 0.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.0 0.0 0.0 mg/100 g Raisin bread Type 2 specific 0.0 0.0 0.0 mg/100 g Rambutan Type 1 specific Nephelium lappaceum 151071 Rape Type 1 specific Brassica napus var. napus 138011 Rapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Rapini Type 1 specific Brassica ruvo 1204434 Ravioli Type 2 specific 0.0 0.0 0.0 mg/100 g Red algae Type 1 specific Rhodophyta 2763 Red beetroot Type 1 specific Beta vulgaris var. rubra Red bell pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Red huckleberry Type 1 specific Vaccinium parvifolium 180766 Red onion Type 1 Red raspberry Type 1 specific Rubus idaeus 32247 0.0 0.0 0.0 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.0 0.0 0.0 mg/100 g Red tea Type 1 Red wine Type 2 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Relish Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 0.0 0.0 0.0 mg/100 g Rice bread Type 2 specific 0.0 0.0 0.0 mg/100 g Rice cake Type 2 specific 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 465.0 3142.0 1.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 Rocket salad Type 1 specific Eruca vesicaria 180536 Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 0.0 0.0 0.0 mg/100 g Roe Type 2 generic 0.0 0.0 0.0 mg/100 g Romaine lettuce Type 1 specific Lactuca sativa L. var. longifolia 0.0 0.0 0.0 mg/100 g Roman camomile Type 1 specific Chamaemelum nobile 99037 0.0 0.0 0.0 mg/100 g Root vegetables Unknown generic Rose hip Type 1 specific Rosa 3764 Rosé wine Type 2 0.0 0.0 0.0 mg/100 g Roselle Type 1 specific Hibiscus sabdariffa 183260 Rosemary Type 1 specific Rosmarinus officinalis 39367 Rowal Type 1 specific Pangium edule 112823 Rowanberry Type 1 specific Sorbus aucuparia 36599 Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rum Type 2 specific 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 0.0 0.0 0.0 mg/100 g Rye bread Type 2 specific 0.0 0.0 0.0 mg/100 g Sacred lotus Type 1 specific Nelumbo nucifera 4432 0.0 0.0 0.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Saffron Type 1 specific Crocus sativus 82528 0.0 0.0 0.0 mg/100 g Sago palm Type 1 specific Metroxylon sagu 93297 Sake Type 2 specific 0.0 0.0 0.0 mg/100 g Salad Type 2 specific 0.0 0.0 0.0 mg/100 g Salad dressing Type 2 specific 0.0 0.0 0.0 mg/100 g Salmonberry Type 1 specific Rubus spectabilis 59499 Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 0.0 0.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Salted butter Type 1 0.0 0.0 0.0 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 Saskatoon berry Type 1 specific Amelanchier alnifolia 32219 Sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Sausage Type 2 specific 0.0 0.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.0 0.0 0.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.0 0.0 0.0 mg/100 g Scarlet bean Type 1 specific Phaseolus coccineus 3886 Scrapple Type 2 specific 0.0 0.0 0.0 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 0.0 0.0 0.0 mg/100 g Sea-buckthornberry Type 1 specific Hippophae rhamnoides 193516 Sesame Type 1 specific Sesamum orientale 4182 0.0 0.0 0.0 mg/100 g Sesame oil Type 2 0.0 0.0 0.0 mg/100 g Sesbania flower Type 1 specific Sesbania bispinosa 485725 Shallot Type 1 specific Allium ascalonicum 1476995 0.0 0.0 0.0 mg/100 g Shark Type 1 specific Squaliformes 282414 0.0 0.0 0.0 mg/100 g Shea tree Type 1 specific Vitellaria paradoxa 292385 0.0 0.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Shiitake Type 1 specific Lentinus edodes 5353 0.0 0.0 0.0 mg/100 g Shortening Type 2 specific 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 0.0 0.0 0.0 mg/100 g Silver linden Type 1 specific Tilia argentea Skunk currant Type 1 specific Ribes glandulosum 175226 Small-leaf linden Type 1 specific Tilia cordata 172266 Smelt Type 1 specific Osmeridae 8012 0.0 0.0 0.0 mg/100 g Snack bar Type 2 specific 1.848485 11.0 0.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Snapper Type 1 specific Lutjanidae 30850 0.0 0.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.0 0.0 0.0 mg/100 g Soft drink Type 2 specific 6.055556 27.0 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 0.0 0.0 0.0 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 Sorrel Type 1 specific Rumex acetosa 41241 Soup Type 2 specific 0.0 0.0 0.0 mg/100 g Sour cherry Type 1 specific Prunus cerasus 140311 0.0 0.0 0.0 mg/100 g Sour cream Type 2 0.0 0.0 0.0 mg/100 g Sourdock Type 1 specific Rumex articus 395311 Sourdough Type 2 specific Soursop Type 1 specific Annona muricata 13337 0.0 0.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 0.0 0.0 0.0 mg/100 g Soy milk Type 2 specific 0.888889 2.0 0.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Soy yogurt Type 2 specific 0.0 0.0 0.0 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 0.0 0.0 0.0 mg/100 g Sparkleberry Type 1 specific Vaccinium arboreum 229201 Spearmint Type 1 specific Mentha spicata 29719 Spelt Type 1 specific Triticum spelta 58933 Spinach Type 1 specific Spinacia oleracea 3562 0.0 0.0 0.0 mg/100 g Spirulina Type 1 specific Spirulina 551299 0.0 0.0 0.0 mg/100 g Spotted seal Type 1 specific Phoca largha 39090 0.0 0.0 0.0 mg/100 g Spread Type 2 specific 0.0 0.0 0.0 mg/100 g Squab Type 1 specific Columba 8931 Squashberry Type 1 specific Viburnum edule 237934 Squid Type 1 specific Teuthida 551290 0.0 0.0 0.0 mg/100 g Star anise Type 1 specific Illicium verum 124778 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Stew Type 2 specific 0.0 0.0 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 Striped mullet Type 1 specific Mugil cephalus 48193 0.0 0.0 0.0 mg/100 g Stuffing Type 2 specific 0.0 0.0 0.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.0 0.0 0.0 mg/100 g Succotash Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar apple Type 1 specific Annona squamosa 301693 Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Summer grape Type 1 specific Vitis aestivalis 3605 Summer savory Type 1 specific Satureja hortensis 49987 Sunburst squash (pattypan squash) Type 1 specific Cucurbita pepo var. clypeata 0.0 0.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.0 0.0 0.0 mg/100 g Sunflower oil Type 2 0.0 0.0 0.0 mg/100 g Swamp cabbage Type 1 specific Ipomoea aquatica 89636 Swede Type 1 specific Brassica napus 3708 0.0 0.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.0 0.0 0.0 mg/100 g Sweet bay Type 1 specific Laurus nobilis 85223 Sweet cherry Type 1 specific Prunus avium 42229 0.0 0.0 0.0 mg/100 g Sweet custard Type 2 specific 0.0 0.0 0.0 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 0.0 0.0 0.0 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.0 0.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.0 0.0 0.0 mg/100 g Sweet rowanberry Type 1 specific Grataegosorbus mitschurinii Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 0.0 0.0 0.0 mg/100 g Syrup Type 2 specific 1.3125 7.0 0.0 mg/100 g Taco Type 2 specific 0.0 0.0 0.0 mg/100 g Taco shell Type 2 0.0 0.0 0.0 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Tapioca pearl Type 2 specific 0.0 0.0 0.0 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 0.0 0.0 0.0 mg/100 g Tarragon Type 1 specific Artemisia dracunculus 72341 0.0 0.0 0.0 mg/100 g Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Tea Type 1 specific Camellia sinensis 4442 423.0 3680.0 0.0 mg/100 g Tea leaf willow Type 1 specific Salix pulchra 669814 Teff Type 1 specific Eragrostis tef 110835 Thistle Type 1 specific Cirsium 41549 Thunnus Type 1 specific Thunnus 8234 0.0 0.0 0.0 mg/100 g Tinda Type 1 specific Citrullus lanatus var. fistulosus Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g Topping Type 2 specific 0.0 0.0 0.0 mg/100 g Tortilla Type 2 specific 0.0 0.0 0.0 mg/100 g Tortilla chip Type 2 specific 0.0 0.0 0.0 mg/100 g Towel gourd Type 1 specific Luffa aegyptiaca 3670 0.0 0.0 0.0 mg/100 g Tree fern Type 1 specific Cyathea Triticale Type 1 specific X Triticosecale rimpaui Tronchuda cabbage Type 1 specific Brassica oleracea var. costata 416546 True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.0 0.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.0 0.0 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Vanilla Type 1 specific Vanilla 51238 0.0 0.0 0.0 mg/100 g Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Vegetarian food Type 2 specific 0.0 0.0 0.0 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Waffle Type 2 specific 2.0 10.0 0.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Wasabi Type 1 specific Wasabia japonica 75806 0.0 0.0 0.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.0 0.0 0.0 mg/100 g Wax apple Type 1 specific Eugenia javanica 119950 Wax gourd Type 1 specific Benincasa hispida 102211 0.0 0.0 0.0 mg/100 g Welsh onion Type 1 specific Allium fistulosum 35875 0.0 0.0 0.0 mg/100 g Wheat Type 1 specific Triticum 4564 0.0 0.0 0.0 mg/100 g Wheat bread Type 2 specific 0.0 0.0 0.0 mg/100 g Whelk Type 1 specific Buccinidae 37796 0.0 0.0 0.0 mg/100 g Whey Type 2 specific 0.0 0.0 0.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 0.0 0.0 0.0 mg/100 g White cabbage Type 1 specific Brassica oleracea L. var. capitata L. f. alba DC. 0.0 0.0 0.0 mg/100 g White lupine Type 1 specific Lupinus albus 3870 White mustard Type 1 specific Sinapis alba 3728 0.0 0.0 0.0 mg/100 g White wine Type 2 0.0 0.0 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.0 0.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 Wild carrot Type 1 specific Daucus carota 4039 Wild celery Type 1 specific Apium graveolens 4045 0.0 0.0 0.0 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 0.0 0.0 0.0 mg/100 g Wild rice Type 1 specific Zizania 15949 0.0 0.0 0.0 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 0.0 0.0 0.0 mg/100 g Winter savory Type 1 specific Satureja montana 49988 Winter squash Type 1 specific Cucurbita maxima 3661 0.0 0.0 0.0 mg/100 g Yam Type 1 specific Dioscorea 4672 0.0 0.0 0.0 mg/100 g Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 Yautia Type 1 specific Xanthosoma sagittifolium 28478 Yellow bell pepper Type 1 specific Capsicum annuum 4072 Yellow pond-lily Type 1 specific Nuphar lutea 77113 0.0 0.0 0.0 mg/100 g Yellow wax bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 0.0 0.0 0.0 mg/100 g Yogurt Type 2 specific 0.190476 2.0 0.0 mg/100 g Zwieback Type 2 specific 0.0 0.0 0.0 mg/100 g bitter odorless Adenosine receptor A1 P30542 ADORA1 Adenosine receptor A2a P29274 ADORA2A Cytochrome P450 2D6 Q6NWU0 CYP2D6 Cytochrome P450, family 1, subfamily A, polypeptide 1 A0N0X8 CYP1A1 (+)-inotropic 1 adenosine antagonist 28 Substance that attaches to and blocks cell receptors that normally bind naturally occurring substances. analeptic 55 Any drug that enhances the activity of the central nervous system. analgesic 56 An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. anti apneic 123 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti apoptotic 125 anti asthmatic 134 A drug used to treat asthma. anti carcinogenic 161 A substance that inhibits or prevents the proliferation of neoplasms. anti cariogenic 165 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti dermatitic 225 A drug used to treat or prevent skin disorders or for the routine care of skin. anti emetic 253 A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. anti feedant 275 anti flu 284 A substance that destroys or inhibits replication of viruses. anti herpetic 329 A substance that destroys or inhibits replication of viruses. anti hypotensive 357 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti narcotic 463 anti obesity 486 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti rhinitic 587 Any substance introduced into a living organism with therapeutic or diagnostic purpose. anti serotonergic 606 anti vaccinia 685 A substance that destroys or inhibits replication of viruses. anti viral 689 A substance that destroys or inhibits replication of viruses. antioxidant 502 A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. In European countries, E-numbers for permitted antioxidant food additives are from E 300 to E 324. antitumor 672 A substance that inhibits or prevents the proliferation of neoplasms. apoptotic 704 arrhythmigenic 706 A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cAMP-phosphodiesterase inhibitor 753 A compound or agent that combines with an enzyme in such a manner as to prevent the normal substrate-enzyme combination and the catalytic reaction. cancer preventive 754 A substance that inhibits or prevents the proliferation of neoplasms. cardiotonic 771 A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. catabolic 780 central nervous system stimulant 816 A class of drugs producing both physiological and psychological effects through a variety of mechanisms involving the central nervous system. cGMP-phosphodiesterase inhibitor 794 A compound or agent that combines with an enzyme in such a manner as to prevent the normal substrate-enzyme combination and the catalytic reaction. choleretic 801 coronarydilator 835 diuretic 883 An agent that promotes the excretion of urine through its effects on kidney function. energizer 905 ergotamine enhancer 915 flavor 936 A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. herbicide 986 A substance used to destroy plant pests. hypertensive 1007 hypoglycemic 1017 A drug which lowers the blood glucose level. insecticide 1040 Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. lypolytic 1085 myorelaxant 1134 neurotoxic 1160 A poison that interferes with the functions of the nervous system. pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. phosphodiesterase inhibitor 1215 A compound or agent that combines with an enzyme in such a manner as to prevent the normal substrate-enzyme combination and the catalytic reaction. psychotropic 1270 A loosely defined grouping of drugs that have effects on psychological function. pyrogenic 1276 respirastimulant 1289 serine/threonine kinase inhibitor 36 An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. spasmogenic 1320 stimulant 1329 tachycardic 1345 A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. teratogenic 1347 A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. topoisomerase-I inhibitor 1368 A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. topoisomerase-II inhibitor 1366 A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (topoisomerase II), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. vasodilator 1413 A drug used to cause dilation of the blood vessels.