1.0 2010-04-08 22:05:22 UTC 2019-11-26 02:57:27 UTC FDB002434 (R)-alpha-Tocotrienol Occurs in wheat, barley, rye and palm oil. Alpha-Tocotrienol is found in the blood plasma and all lipoprotein subfractions.; Compared to tocopherols, alpha- Tocotrienols are poorly studied. Its presence in the blood plasma at nanomolar concentration help to prevent stroke-related neurodegeneration. (PMID: 16771695 ). alpha- Tocotrienol is found to have vitamine E activity. (2R,3'E,7'E)-alpha-Tocotrienol (r)-alpha-tocotrienol a-Tocotrienol Alpha-tocotrienol D-alpha-tocotrienol Delta-alpha-tocotrienol Tocotrienol, alpha Z1-Tocopherol zeta1-tocopherol α-tocotrienol ζ1-tocopherol C29H44O2 424.6585 424.334130652 2,5,7,8-tetramethyl-2-[(3Z,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-1-benzopyran-6-ol z 1 -tocopherol 1721-51-3 CC(C)=CCC\C(C)=C\CC\C(C)=C/CCC1(C)CCC2=C(O1)C(C)=C(C)C(O)=C2C InChI=1S/C29H44O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h12,14,16,30H,9-11,13,15,17-19H2,1-8H3/b21-14+,22-16- RZFHLOLGZPDCHJ-AOOUSOOLSA-N belongs to the class of organic compounds known as tocotrienols. These are vitamin E derivatives containing an unsaturated trimethyltrideca-3,7,11-trien-1-yl chain attached to the carbon C6 atom of a benzopyran ring system. The differ from tocopherols that contain a saturated trimethyltridecyl chain. Tocotrienols Organic compounds Lipids and lipid-like molecules Prenol lipids Quinone and hydroquinone lipids Aromatic heteropolycyclic compounds 1-benzopyrans Alkyl aryl ethers Benzenoids Diterpenoids Hydrocarbon derivatives Oxacyclic compounds 1-benzopyran Alkyl aryl ether Aromatic heteropolycyclic compound Benzenoid Benzopyran Chromane Diterpenoid Ether Hydrocarbon derivative Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Tocotrienol Solid logp 7.70 ALOGPS logs -6.19 ALOGPS solubility 2.72e-04 g/l ALOGPS melting_point Mp 30-31° logp 9.29 ChemAxon pka_strongest_acidic 10.8 ChemAxon pka_strongest_basic -4.9 ChemAxon iupac 2,5,7,8-tetramethyl-2-[(3Z,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-1-benzopyran-6-ol ChemAxon average_mass 424.6585 ChemAxon mono_mass 424.334130652 ChemAxon smiles CC(C)=CCC\C(C)=C\CC\C(C)=C/CCC1(C)CCC2=C(O1)C(C)=C(C)C(O)=C2C ChemAxon formula C29H44O2 ChemAxon inchi InChI=1S/C29H44O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h12,14,16,30H,9-11,13,15,17-19H2,1-8H3/b21-14+,22-16- ChemAxon inchikey RZFHLOLGZPDCHJ-AOOUSOOLSA-N ChemAxon polar_surface_area 29.46 ChemAxon refractivity 137.92 ChemAxon polarizability 53.5 ChemAxon rotatable_bond_count 9 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 83568 Specdb::MsMs 83569 Specdb::MsMs 83570 Specdb::MsMs 145194 Specdb::MsMs 145195 Specdb::MsMs 145196 HMDB06327 33270 #<Reference:0x000055ce2f31e9f0> Agave Type 1 specific Agave 39509 0.0 0.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.035 0.035 0.035 mg/100 g Almond milk Type 1 0.0 0.0 0.0 mg/100 g Amaranth Type 1 specific Amaranthus 3564 0.0 0.0 0.0 mg/100 g Annual wild rice Type 1 specific Zizania aquatica 75727 Apple Type 1 specific Malus pumila 283210 0.0 0.0 0.0 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 0.0 0.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 0.02 0.02 0.02 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.045 0.045 0.045 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 Black walnut Type 1 specific Juglans nigra 16719 0.0 0.0 0.0 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 0.0 0.0 0.0 mg/100 g Breakfast cereal Type 2 specific Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.015 0.015 0.015 mg/100 g Bulgur Type 2 specific Butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.04 0.04 0.04 mg/100 g Canola Type 2 specific 138011 0.0 0.0 0.0 mg/100 g Canola oil Type 2 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.0 0.0 0.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.01 0.01 0.01 mg/100 g Cereals and cereal products Unknown generic Cheddar Cheese Type 2 Cheddar Cheese 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 0.04 0.04 0.04 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.0 0.0 0.0 mg/100 g Clam Type 1 0.055 0.055 0.055 mg/100 g Clementine Type 1 Citrus × clementina 0.0 0.0 0.0 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 1.46 1.46 1.46 mg/100 g Coconut oil Type 2 0.38 0.38 0.38 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 Common wheat Type 1 specific Triticum aestivum 4565 Corn Type 1 specific Zea mays 4577 Corn oil Type 2 0.215 0.215 0.215 mg/100 g Cottage cheese Type 2 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 0.006667 0.02 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.03 0.03 0.03 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.015 0.015 0.015 mg/100 g Egg yolk Type 1 0.075 0.075 0.075 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 0.0 0.0 0.0 mg/100 g Fig Type 1 specific Ficus carica 3494 0.025 0.025 0.025 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.0 0.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.0 0.0 0.0 mg/100 g Flour Type 2 specific Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.0 0.0 0.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 0.055 0.055 0.055 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.055 0.055 0.055 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0 0.0 0.0 mg/100 g Garden tomato (var.) Type 1 specific Solanum lycopersicum var. lycopersicum 397755 0.0 0.0 0.0 mg/100 g Grape Type 1 specific Vitis 3603 0.0 0.0 0.0 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.01 0.01 0.01 mg/100 g Green lentil Type 1 Lens culinaris 0.0 0.0 0.0 mg/100 g Green plum Type 1 0.035 0.035 0.035 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.0 0.0 0.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.0 0.0 0.0 mg/100 g Iceberg lettuce Type 1 0.015 0.015 0.015 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 0.05 0.05 0.05 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' 0.005 0.005 0.005 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 0.0 0.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.0 0.0 0.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 0.0 0.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.03 0.03 0.03 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 0.36 0.36 0.36 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.0275 0.055 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.015 0.015 0.015 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.0 0.0 0.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 Mozzarella cheese Type 2 0.0 0.0 0.0 mg/100 g Nance Type 1 specific Byrsonima crassifolia 4270 0.015 0.015 0.015 mg/100 g Naranjilla Type 1 specific Solanum quitoense 227725 0.005 0.005 0.005 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Oat Type 1 specific Avena sativa 4498 2.21 2.21 2.21 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.0 0.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Orange roughy Type 1 specific Hoplostethus atlanticus 96778 0.0 0.0 0.0 mg/100 g Oriental wheat Type 1 specific Triticum turanicum 376534 0.005 0.005 0.005 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.03 0.03 0.03 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.0 0.0 0.0 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.0 0.0 0.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0 0.0 0.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.0 0.0 0.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.005 0.005 0.005 mg/100 g Parmesan cheese Type 2 0.0 0.0 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.0 0.0 0.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 0.845 0.845 0.845 mg/100 g Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.02 0.02 0.02 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.015 0.015 0.015 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.06 0.06 0.06 mg/100 g Rice Type 1 specific Oryza sativa 4530 Rose hip Type 1 specific Rosa 3764 0.01 0.01 0.01 mg/100 g Rye Type 1 specific Secale cereale 4550 Rye bread Type 2 specific 0.8 0.8 0.8 mg/100 g Salted butter Type 1 0.0 0.0 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 0.0 0.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.0 0.0 0.0 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 Soy bean Type 1 specific Glycine max 3847 Soybean oil Type 2 0.075 0.075 0.075 mg/100 g Spelt Type 1 specific Triticum spelta 58933 0.03 0.03 0.03 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.0 0.0 0.0 mg/100 g Sunflower oil Type 2 0.0 0.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.0 0.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.005 0.005 0.005 mg/100 g Swiss cheese Type 2 0.04 0.04 0.04 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 0.0 0.0 0.0 mg/100 g Tartary buckwheat Type 1 specific Fagopyrum tataricum 62330 Teff Type 1 specific Eragrostis tef 110835 0.01 0.01 0.01 mg/100 g Triticale Type 1 specific X Triticosecale rimpaui True sole Type 1 specific Soleidae 30948 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.0 0.0 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.12 0.12 0.12 mg/100 g Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Wasabi Type 1 specific Wasabia japonica 75806 2.27 2.27 2.27 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.015 0.015 0.015 mg/100 g Wheat Type 1 specific Triticum 4564 Wild carrot Type 1 specific Daucus carota 4039 0.0 0.0 0.0 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 0.01 0.01 0.01 mg/100 g Wild rice Type 1 specific Zizania 15949 Yellowfin tuna Type 1 specific Thunnus albacares 8236 0.0 0.0 0.0 mg/100 g