1.0 2010-04-08 22:10:45 UTC 2025-11-18 23:45:33 UTC FDB013516 4(10)-Thujene 4(10)-thujene, also known as sabinen or 1-isopropyl-4-methylenebicyclo[3.1.0]hexane, is a member of the class of compounds known as bicyclic monoterpenoids. Bicyclic monoterpenoids are monoterpenoids containing exactly 2 rings, which are fused to each other. 4(10)-thujene is a citrus, pepper, and pine tasting compound and can be found in a number of food items such as sweet orange, green bell pepper, pot marjoram, and parsley, which makes 4(10)-thujene a potential biomarker for the consumption of these food products. 1-Isopropyl-4-methylenebicyclo[3.1.0]hexane 4-Methylene-1-(1-methylethyl)bicyclo[3.1.0]hexane, 9CI 4-Thujene Bicyclo[3.1.0]hexane, 4-methylene-1-(1-methylethyl)- Sabinene Thuj-4(10)-ene C10H16 136.234 136.125200512 4-methylidene-1-(propan-2-yl)bicyclo[3.1.0]hexane sabinene 3387-41-5 CC(C)C12CC1C(=C)CC2 InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h7,9H,3-6H2,1-2H3 NDVASEGYNIMXJL-UHFFFAOYSA-N belongs to the class of organic compounds known as bicyclic monoterpenoids. These are monoterpenoids containing exactly 2 rings, which are fused to each other. Bicyclic monoterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Monoterpenoids Aliphatic homopolycyclic compounds Branched unsaturated hydrocarbons Cyclic olefins Polycyclic hydrocarbons Unsaturated aliphatic hydrocarbons Aliphatic homopolycyclic compound Bicyclic monoterpenoid Branched unsaturated hydrocarbon Cyclic olefin Hydrocarbon Olefin Polycyclic hydrocarbon Thujane monoterpenoid Unsaturated aliphatic hydrocarbon Unsaturated hydrocarbon Bicyclic monoterpenoids Cyclic monoterpenes a monoterpenoid thujene logp 3.04 ALOGPS logs -3.33 ALOGPS solubility 6.40e-02 g/l ALOGPS logp 2.86 ChemAxon iupac 4-methylidene-1-(propan-2-yl)bicyclo[3.1.0]hexane ChemAxon average_mass 136.234 ChemAxon mono_mass 136.125200512 ChemAxon smiles CC(C)C12CC1C(=C)CC2 ChemAxon formula C10H16 ChemAxon inchi InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h7,9H,3-6H2,1-2H3 ChemAxon inchikey NDVASEGYNIMXJL-UHFFFAOYSA-N ChemAxon polar_surface_area 0 ChemAxon refractivity 43.65 ChemAxon polarizability 17.25 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 1962 Specdb::CMs 35606 Specdb::CMs 103747 Specdb::MsMs 85233 Specdb::MsMs 85234 Specdb::MsMs 85235 Specdb::MsMs 147297 Specdb::MsMs 147298 Specdb::MsMs 147299 Specdb::MsMs 448162 Specdb::MsMs 448163 50027 Allspice Type 1 specific Pimenta dioica 375272 Anise Type 1 specific Pimpinella anisum 271192 0.1 0.1 0.1 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 Caraway Type 1 specific Carum carvi 48032 4.5 4.5 4.5 mg/100 g Cardamom Type 1 specific Elettaria cardamomum 105181 96.25 96.25 96.25 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 59.25 102.5 16.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 Celery stalks Type 1 specific Apium graveolens var. dulce 117781 Ceylon cinnamon Type 1 specific Cinnamomum verum 128608 0.5 0.5 0.5 mg/100 g Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 Common oregano Type 1 specific Origanum vulgare 39352 105.45 105.45 105.45 mg/100 g Common sage Type 1 specific Salvia officinalis 38868 3.3 3.3 3.3 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 4.2 4.2 4.2 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 52.2 52.2 52.2 mg/100 g Dill Type 1 specific Anethum graveolens 40922 Fennel Type 1 specific Foeniculum vulgare 48038 3.05 3.05 3.05 mg/100 g Fig Type 1 specific Ficus carica 3494 Ginger Type 1 specific Zingiber officinale 94328 1.775 1.775 1.775 mg/100 g Green bell pepper Type 1 specific Capsicum annuum 4072 Hyssop Type 1 specific Hyssopus officinalis 39324 12.3 20.4 5.5 mg/100 g Lemon Type 1 specific Citrus limon 2708 11.25 11.25 11.25 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 16.0 16.0 16.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 12.5 12.5 12.5 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 2439.0 2439.0 2439.0 mg/100 g Orange bell pepper Type 1 specific Capsicum annuum 4072 Orange mint Type 1 specific Mentha aquatica 190902 2.1 2.1 2.1 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 29.802 59.55 0.054 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 Pepper Type 1 specific Capsicum annuum 4072 Pepper (Spice) Type 1 specific Piper nigrum 13216 Peppermint Type 1 specific Mentha X piperita 34256 Pot marjoram Type 1 specific Origanum onites 452416 0.01 0.01 0.01 mg/100 g Pummelo Type 1 specific Citrus maxima 37334 Red bell pepper Type 1 specific Capsicum annuum 4072 Roman camomile Type 1 specific Chamaemelum nobile 99037 Rosemary Type 1 specific Rosmarinus officinalis 39367 6.63 9.505 3.755 mg/100 g Saffron Type 1 specific Crocus sativus 82528 Spearmint Type 1 specific Mentha spicata 29719 38.5 38.5 38.5 mg/100 g Star anise Type 1 specific Illicium verum 124778 1.05 1.05 1.05 mg/100 g Summer savory Type 1 specific Satureja hortensis 49987 Sunflower Type 1 specific Helianthus annuus 4232 Sweet basil Type 1 specific Ocimum basilicum 39350 0.8 0.8 0.8 mg/100 g Sweet bay Type 1 specific Laurus nobilis 85223 155.0 155.0 155.0 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 25.25 25.25 25.25 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.0075 0.0075 0.0075 mg/100 g Tarragon Type 1 specific Artemisia dracunculus 72341 203.5 203.5 203.5 mg/100 g Wild carrot Type 1 specific Daucus carota 4039 59.25 102.5 16.0 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 Winter savory Type 1 specific Satureja montana 49988 0.1 0.1 0.1 mg/100 g Yellow bell pepper Type 1 specific Capsicum annuum 4072 citrus pepper pine spice terpene turpentine wood woody Anti bacterial 145 A substance that kills or slows the growth of bacteria. Anti helicobacter 317 A substance that kills or slows the growth of bacteria. Anti septic 603 A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. Anti ulcer 676 One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. Perfumery 1206 A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell.